data_bmse010171 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010171 _Entry.Title Vanillin_a_G_b_CA _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2009-09-01 _Entry.Last_release_date 2012-09-13 _Entry.Original_release_date 2009-11-23 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name Vanillin_a_G_b_CA loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.First_initial _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 John Ralph ? ? ? bmse010171 2 Sally Ralph ? ? ? bmse010171 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010171 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 2 bmse010171 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 68 bmse010171 "1H chemical shifts" 35 bmse010171 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2009-11-23 2009-05-26 original Author "Original spectra from USDA" bmse010171 2 2010-12-01 2010-12-01 update BMRB "Set correct NMR STAR version" bmse010171 3 2011-04-04 2011-04-04 update BMRB "Added Provenance tag to chem_comp" bmse010171 4 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010171 5 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010171 6 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010171 7 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010171 8 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010171 9 2012-09-13 2012-09-13 update BMRB "Added PubChem SID 111678032 to database loop" bmse010171 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010171 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010171 1 2 John Ralph ? ? ? bmse010171 1 3 Larry Landucci ? L. ? bmse010171 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010171 _Assembly.ID 1 _Assembly.Name Vanillin-a-G-b-CA _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 Vanillin-a-G-b-CA 1 $Vanillin-a-G-b-CA yes native no no ? ? ? bmse010171 1 stop_ save_ save_Vanillin-a-G-b-CA _Entity.Sf_category entity _Entity.Sf_framecode Vanillin-a-G-b-CA _Entity.Entry_ID bmse010171 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name Vanillin-a-G-b-CA _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010171 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010171 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $Vanillin-a-G-b-CA . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010171 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010171 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $Vanillin-a-G-b-CA . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010171 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010171 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name Vanillin-a-G-b-CA _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C34H36O12/c1-21(36)42-15-7-8-24-9-12-28(30(16-24)39-4)45-33(20-43-22(2)37)34(46-29-13-10-25(19-35)17-31(29)40-5)26-11-14-27(44-23(3)38)32(18-26)41-6/h7-14,16-19,33-34H,15,20H2,1-6H3/b8-7+ ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C34 H36 O12' _Chem_comp.Formula_weight 636.64244 _Chem_comp.Formula_mono_iso_wt_nat 636.2206766208 _Chem_comp.Formula_mono_iso_wt_13C 670.334741106 _Chem_comp.Formula_mono_iso_wt_15N 636.2206766208 _Chem_comp.Formula_mono_iso_wt_13C_15N 670.334741106 _Chem_comp.Image_file_name standards/Vanillin_a_G_b_CA/lit/jr_258.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/Vanillin_a_G_b_CA/lit/jr_258.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID Vanillin-a-G-b-CA synonym bmse010171 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID Vanillin-a-G-b-CA Beilstein bmse010171 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OCC=CC1=CC(=C(C=C1)OC(COC(C)=O)C(C2=CC(=C(C=C2)OC(C)=O)OC)OC3=C(C=C(C=C3)C=O)OC)OC bmse010171 1 Isomeric CC(=O)OCC=CC1=CC(=C(C=C1)OC(COC(C)=O)C(C2=CC(=C(C=C2)OC(C)=O)OC)OC3=C(C=C(C=C3)C=O)OC)OC bmse010171 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 BGAcMe C ? ? ? ? 427.4208 374.0000 ? ? ? bmse010171 1 C2 GAcMe C ? ? ? ? 288.8576 294.0000 ? ? ? bmse010171 1 C3 A4AcMe C ? ? ? ? 233.4304 6.0000 ? ? ? bmse010171 1 C4 OMe C ? ? ? ? 344.2816 134.0000 ? ? ? bmse010171 1 C5 OMe C ? ? ? ? 94.8672 246.0000 ? ? ? bmse010171 1 C6 OMe C ? ? ? ? 122.5792 102.0000 ? ? ? bmse010171 1 C7 BB C ? ? ? ? 371.9968 278.0000 ? ? ? bmse010171 1 C8 BA C ? ? ? ? 371.9968 246.0000 ? ? ? bmse010171 1 C9 B6 C ? ? ? ? 316.5696 246.0000 ? ? ? bmse010171 1 C10 C6 C ? ? ? ? 205.7184 278.0000 ? ? ? bmse010171 1 C11 A6 C ? ? ? ? 233.4304 134.0000 ? ? ? bmse010171 1 C12 B5 C ? ? ? ? 288.8576 230.0000 ? ? ? bmse010171 1 C13 C5 C ? ? ? ? 205.7184 246.0000 ? ? ? bmse010171 1 C14 A5 C ? ? ? ? 233.4304 102.0000 ? ? ? bmse010171 1 C15 BG C ? ? ? ? 399.7088 294.0000 ? ? ? bmse010171 1 C16 B2 C ? ? ? ? 344.2816 198.0000 ? ? ? bmse010171 1 C17 C2 C ? ? ? ? 150.2944 278.0000 ? ? ? bmse010171 1 C18 A2 C ? ? ? ? 178.0064 134.0000 ? ? ? bmse010171 1 C19 CA C ? ? ? ? 178.0064 326.0000 ? ? ? bmse010171 1 C20 G C ? ? ? ? 233.4304 230.0000 ? ? ? bmse010171 1 C21 GAcC=O C ? ? ? ? 427.4208 342.0000 ? ? ? bmse010171 1 C22 GAcC=O C ? ? ? ? 261.1456 278.0000 ? ? ? bmse010171 1 C23 A4AcC=O C ? ? ? ? 233.4304 38.0000 ? ? ? bmse010171 1 C24 B1 C ? ? ? ? 344.2816 230.0000 ? ? ? bmse010171 1 C25 C1 C ? ? ? ? 178.0064 294.0000 ? ? ? bmse010171 1 C26 A1 C ? ? ? ? 205.7184 150.0000 ? ? ? bmse010171 1 C27 A4 C ? ? ? ? 205.7184 86.0000 ? ? ? bmse010171 1 C28 B4 C ? ? ? ? 288.8576 198.0000 ? ? ? bmse010171 1 C29 C4 C ? ? ? ? 178.0064 230.0000 ? ? ? bmse010171 1 C30 B3 C ? ? ? ? 316.5696 182.0000 ? ? ? bmse010171 1 C31 C3 C ? ? ? ? 150.2944 246.0000 ? ? ? bmse010171 1 C32 A3 C ? ? ? ? 178.0064 102.0000 ? ? ? bmse010171 1 C33 B C ? ? ? ? 233.4304 198.0000 ? ? ? bmse010171 1 C34 A C ? ? ? ? 205.7184 182.0000 ? ? ? bmse010171 1 O35 ? O ? ? ? ? 150.2944 342.0000 ? ? ? bmse010171 1 O36 ? O ? ? ? ? 455.1328 326.0000 ? ? ? bmse010171 1 O37 ? O ? ? ? ? 233.4304 294.0000 ? ? ? bmse010171 1 O38 ? O ? ? ? ? 261.1456 54.0000 ? ? ? bmse010171 1 O39 ? O ? ? ? ? 316.5696 150.0000 ? ? ? bmse010171 1 O40 ? O ? ? ? ? 122.5792 230.0000 ? ? ? bmse010171 1 O41 ? O ? ? ? ? 150.2944 86.0000 ? ? ? bmse010171 1 O42 ? O ? ? ? ? 399.7088 326.0000 ? ? ? bmse010171 1 O43 ? O ? ? ? ? 261.1456 246.0000 ? ? ? bmse010171 1 O44 ? O ? ? ? ? 205.7184 54.0000 ? ? ? bmse010171 1 O45 ? O ? ? ? ? 261.1456 182.0000 ? ? ? bmse010171 1 O46 ? O ? ? ? ? 178.0064 198.0000 ? ? ? bmse010171 1 H47 AcMe H ? ? ? ? 447.2608 374.0000 ? ? ? bmse010171 1 H48 AcMe H ? ? ? ? 427.4208 393.8400 ? ? ? bmse010171 1 H49 AcMe H ? ? ? ? 407.5808 374.0000 ? ? ? bmse010171 1 H50 AcMe H ? ? ? ? 298.7778 276.8182 ? ? ? bmse010171 1 H51 AcMe H ? ? ? ? 306.0394 303.9202 ? ? ? bmse010171 1 H52 AcMe H ? ? ? ? 278.9374 311.1818 ? ? ? bmse010171 1 H53 AcMe H ? ? ? ? 213.5904 6.0000 ? ? ? bmse010171 1 H54 AcMe H ? ? ? ? 233.4304 -13.8400 ? ? ? bmse010171 1 H55 AcMe H ? ? ? ? 253.2704 6.0000 ? ? ? bmse010171 1 H56 OMe H ? ? ? ? 334.3614 116.8182 ? ? ? bmse010171 1 H57 OMe H ? ? ? ? 361.4634 124.0798 ? ? ? bmse010171 1 H58 OMe H ? ? ? ? 354.2018 151.1818 ? ? ? bmse010171 1 H59 OMe H ? ? ? ? 104.7874 263.1818 ? ? ? bmse010171 1 H60 OMe H ? ? ? ? 77.6854 255.9202 ? ? ? bmse010171 1 H61 OMe H ? ? ? ? 84.9470 228.8182 ? ? ? bmse010171 1 H62 OMe H ? ? ? ? 132.4986 119.1823 ? ? ? bmse010171 1 H63 OMe H ? ? ? ? 105.3969 111.9194 ? ? ? bmse010171 1 H64 OMe H ? ? ? ? 112.6598 84.8177 ? ? ? bmse010171 1 H65 BB H ? ? ? ? 354.8148 287.9199 ? ? ? bmse010171 1 H66 BA H ? ? ? ? 389.1786 236.0797 ? ? ? bmse010171 1 H67 B6 H ? ? ? ? 316.5696 265.8400 ? ? ? bmse010171 1 H68 C6 H ? ? ? ? 222.9004 287.9199 ? ? ? bmse010171 1 H69 A6 H ? ? ? ? 250.6124 143.9199 ? ? ? bmse010171 1 H70 B5 H ? ? ? ? 271.6756 239.9199 ? ? ? bmse010171 1 H71 C5 H ? ? ? ? 222.9004 236.0801 ? ? ? bmse010171 1 H72 A5 H ? ? ? ? 250.6124 92.0801 ? ? ? bmse010171 1 H73 BG H ? ? ? ? 406.4946 275.3566 ? ? ? bmse010171 1 H74 B H ? ? ? ? 419.2474 297.4453 ? ? ? bmse010171 1 H75 B2 H ? ? ? ? 361.4636 188.0801 ? ? ? bmse010171 1 H76 C2 H ? ? ? ? 133.1124 287.9199 ? ? ? bmse010171 1 H77 A2 H ? ? ? ? 160.8244 143.9199 ? ? ? bmse010171 1 H78 CA H ? ? ? ? 195.1884 335.9199 ? ? ? bmse010171 1 H79 G1 H ? ? ? ? 226.6452 248.6437 ? ? ? bmse010171 1 H80 G2 H ? ? ? ? 213.8918 226.5551 ? ? ? bmse010171 1 H81 ? H ? ? ? ? 233.4309 178.1600 ? ? ? bmse010171 1 H82 A H ? ? ? ? 188.5364 172.0801 ? ? ? bmse010171 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010171 1 C2 C2 BMRB bmse010171 1 C3 C3 BMRB bmse010171 1 C4 C4 BMRB bmse010171 1 C5 C5 BMRB bmse010171 1 C6 C6 BMRB bmse010171 1 C7 C7 BMRB bmse010171 1 C8 C8 BMRB bmse010171 1 C9 C9 BMRB bmse010171 1 C10 C10 BMRB bmse010171 1 C11 C11 BMRB bmse010171 1 C12 C12 BMRB bmse010171 1 C13 C13 BMRB bmse010171 1 C14 C14 BMRB bmse010171 1 C15 C15 BMRB bmse010171 1 C16 C16 BMRB bmse010171 1 C17 C17 BMRB bmse010171 1 C18 C18 BMRB bmse010171 1 C19 C19 BMRB bmse010171 1 C20 C20 BMRB bmse010171 1 C21 C21 BMRB bmse010171 1 C22 C22 BMRB bmse010171 1 C23 C23 BMRB bmse010171 1 C24 C24 BMRB bmse010171 1 C25 C25 BMRB bmse010171 1 C26 C26 BMRB bmse010171 1 C27 C27 BMRB bmse010171 1 C28 C28 BMRB bmse010171 1 C29 C29 BMRB bmse010171 1 C30 C30 BMRB bmse010171 1 C31 C31 BMRB bmse010171 1 C32 C32 BMRB bmse010171 1 C33 C33 BMRB bmse010171 1 C34 C34 BMRB bmse010171 1 O35 O35 BMRB bmse010171 1 O36 O36 BMRB bmse010171 1 O37 O37 BMRB bmse010171 1 O38 O38 BMRB bmse010171 1 O39 O39 BMRB bmse010171 1 O40 O40 BMRB bmse010171 1 O41 O41 BMRB bmse010171 1 O42 O42 BMRB bmse010171 1 O43 O43 BMRB bmse010171 1 O44 O44 BMRB bmse010171 1 O45 O45 BMRB bmse010171 1 O46 O46 BMRB bmse010171 1 H47 H47 BMRB bmse010171 1 H48 H48 BMRB bmse010171 1 H49 H49 BMRB bmse010171 1 H50 H50 BMRB bmse010171 1 H51 H51 BMRB bmse010171 1 H52 H52 BMRB bmse010171 1 H53 H53 BMRB bmse010171 1 H54 H54 BMRB bmse010171 1 H55 H55 BMRB bmse010171 1 H56 H56 BMRB bmse010171 1 H57 H57 BMRB bmse010171 1 H58 H58 BMRB bmse010171 1 H59 H59 BMRB bmse010171 1 H60 H60 BMRB bmse010171 1 H61 H61 BMRB bmse010171 1 H62 H62 BMRB bmse010171 1 H63 H63 BMRB bmse010171 1 H64 H64 BMRB bmse010171 1 H65 H65 BMRB bmse010171 1 H66 H66 BMRB bmse010171 1 H67 H67 BMRB bmse010171 1 H68 H68 BMRB bmse010171 1 H69 H69 BMRB bmse010171 1 H70 H70 BMRB bmse010171 1 H71 H71 BMRB bmse010171 1 H72 H72 BMRB bmse010171 1 H73 H73 BMRB bmse010171 1 H74 H74 BMRB bmse010171 1 H75 H75 BMRB bmse010171 1 H76 H76 BMRB bmse010171 1 H77 H77 BMRB bmse010171 1 H78 H78 BMRB bmse010171 1 H79 H79 BMRB bmse010171 1 H80 H80 BMRB bmse010171 1 H81 H81 BMRB bmse010171 1 H82 H82 BMRB bmse010171 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C21 ? bmse010171 1 2 covalent SING C2 C22 ? bmse010171 1 3 covalent SING C3 C23 ? bmse010171 1 4 covalent SING C4 O39 ? bmse010171 1 5 covalent SING C5 O40 ? bmse010171 1 6 covalent SING C6 O41 ? bmse010171 1 7 covalent DOUB C7 C8 ? bmse010171 1 8 covalent SING C7 C15 ? bmse010171 1 9 covalent SING C8 C24 ? bmse010171 1 10 covalent DOUB C9 C12 ? bmse010171 1 11 covalent SING C9 C24 ? bmse010171 1 12 covalent DOUB C10 C13 ? bmse010171 1 13 covalent SING C10 C25 ? bmse010171 1 14 covalent DOUB C11 C14 ? bmse010171 1 15 covalent SING C11 C26 ? bmse010171 1 16 covalent SING C12 C28 ? bmse010171 1 17 covalent SING C13 C29 ? bmse010171 1 18 covalent SING C14 C27 ? bmse010171 1 19 covalent SING C15 O42 ? bmse010171 1 20 covalent DOUB C16 C24 ? bmse010171 1 21 covalent SING C16 C30 ? bmse010171 1 22 covalent DOUB C17 C25 ? bmse010171 1 23 covalent SING C17 C31 ? bmse010171 1 24 covalent DOUB C18 C26 ? bmse010171 1 25 covalent SING C18 C32 ? bmse010171 1 26 covalent SING C19 C25 ? bmse010171 1 27 covalent DOUB C19 O35 ? bmse010171 1 28 covalent SING C20 C33 ? bmse010171 1 29 covalent SING C20 O43 ? bmse010171 1 30 covalent DOUB C21 O36 ? bmse010171 1 31 covalent SING C21 O42 ? bmse010171 1 32 covalent DOUB C22 O37 ? bmse010171 1 33 covalent SING C22 O43 ? bmse010171 1 34 covalent DOUB C23 O38 ? bmse010171 1 35 covalent SING C23 O44 ? bmse010171 1 36 covalent SING C26 C34 ? bmse010171 1 37 covalent DOUB C27 C32 ? bmse010171 1 38 covalent SING C27 O44 ? bmse010171 1 39 covalent DOUB C28 C30 ? bmse010171 1 40 covalent SING C28 O45 ? bmse010171 1 41 covalent DOUB C29 C31 ? bmse010171 1 42 covalent SING C29 O46 ? bmse010171 1 43 covalent SING C30 O39 ? bmse010171 1 44 covalent SING C31 O40 ? bmse010171 1 45 covalent SING C32 O41 ? bmse010171 1 46 covalent SING C33 C34 ? bmse010171 1 47 covalent SING C33 O45 ? bmse010171 1 48 covalent SING C34 O46 ? bmse010171 1 49 covalent SING C1 H47 ? bmse010171 1 50 covalent SING C1 H48 ? bmse010171 1 51 covalent SING C1 H49 ? bmse010171 1 52 covalent SING C2 H50 ? bmse010171 1 53 covalent SING C2 H51 ? bmse010171 1 54 covalent SING C2 H52 ? bmse010171 1 55 covalent SING C3 H53 ? bmse010171 1 56 covalent SING C3 H54 ? bmse010171 1 57 covalent SING C3 H55 ? bmse010171 1 58 covalent SING C4 H56 ? bmse010171 1 59 covalent SING C4 H57 ? bmse010171 1 60 covalent SING C4 H58 ? bmse010171 1 61 covalent SING C5 H59 ? bmse010171 1 62 covalent SING C5 H60 ? bmse010171 1 63 covalent SING C5 H61 ? bmse010171 1 64 covalent SING C6 H62 ? bmse010171 1 65 covalent SING C6 H63 ? bmse010171 1 66 covalent SING C6 H64 ? bmse010171 1 67 covalent SING C7 H65 ? bmse010171 1 68 covalent SING C8 H66 ? bmse010171 1 69 covalent SING C9 H67 ? bmse010171 1 70 covalent SING C10 H68 ? bmse010171 1 71 covalent SING C11 H69 ? bmse010171 1 72 covalent SING C12 H70 ? bmse010171 1 73 covalent SING C13 H71 ? bmse010171 1 74 covalent SING C14 H72 ? bmse010171 1 75 covalent SING C15 H73 ? bmse010171 1 76 covalent SING C15 H74 ? bmse010171 1 77 covalent SING C16 H75 ? bmse010171 1 78 covalent SING C17 H76 ? bmse010171 1 79 covalent SING C18 H77 ? bmse010171 1 80 covalent SING C19 H78 ? bmse010171 1 81 covalent SING C20 H79 ? bmse010171 1 82 covalent SING C20 H80 ? bmse010171 1 83 covalent SING C33 H81 ? bmse010171 1 84 covalent SING C34 H82 ? bmse010171 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID no PubChem 111678032 sid ? Vanillin-a-G-b-CA ? "matching entry" ? bmse010171 1 yes USDA_NMR_database 258 "Compound Number" ? Vanillin-a-G-b-CA ? "matching entry" ? bmse010171 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010171 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010171 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 Vanillin-a-G-b-CA "natural abundance" 1 $Vanillin-a-G-b-CA ? Solute 6 ? ? mg/ml ? "Sally Ralph" Vanillin-a-G-b-CA n/a bmse010171 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010171 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010171 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 Vanillin-a-G-b-CA "natural abundance" 1 $Vanillin-a-G-b-CA ? Solute 6 ? ? mg/ml ? "Sally Ralph" Vanillin-a-G-b-CA n/a bmse010171 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010171 2 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010171 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010171 1 temperature 297 ? K bmse010171 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010171 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010171 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010171 1 stop_ save_ save_Bruker_250 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_250 _NMR_spectrometer.Entry_ID bmse010171 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model WM _NMR_spectrometer.Field_strength 250 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010171 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010171 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010171 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010171 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010171 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010171 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010171 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010171 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010171 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010171 2 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010171 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010171 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010171 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C3 C 13 20.74 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010171 1 2 ? ? 1 1 ? 1 C2 C 13 20.82 ? ? 1 ? ? ? ? ? GAcMe ? bmse010171 1 3 ? ? 1 1 ? 1 C1 C 13 21.10 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010171 1 4 ? ? 1 1 ? 1 C4 C 13 55.84 ? ? 4 ? ? ? ? ? OMe ? bmse010171 1 5 ? ? 1 1 ? 1 C5 C 13 56.09 ? ? 4 ? ? ? ? ? OMe ? bmse010171 1 6 ? ? 1 1 ? 1 C6 C 13 56.13 ? ? 4 ? ? ? ? ? OMe ? bmse010171 1 7 ? ? 1 1 ? 1 C20 C 13 63.12 ? ? 1 ? ? ? ? ? G ? bmse010171 1 8 ? ? 1 1 ? 1 C15 C 13 65.17 ? ? 1 ? ? ? ? ? BG ? bmse010171 1 9 ? ? 1 1 ? 1 C34 C 13 79.98 ? ? 1 ? ? ? ? ? A ? bmse010171 1 10 ? ? 1 1 ? 1 C33 C 13 82.11 ? ? 1 ? ? ? ? ? B ? bmse010171 1 11 ? ? 1 1 ? 1 C16 C 13 109.93 ? ? 1 ? ? ? ? ? B2 ? bmse010171 1 12 ? ? 1 1 ? 1 C17 C 13 110.29 ? ? 1 ? ? ? ? ? C2 ? bmse010171 1 13 ? ? 1 1 ? 1 C18 C 13 111.14 ? ? 1 ? ? ? ? ? A2 ? bmse010171 1 14 ? ? 1 1 ? 1 C13 C 13 114.77 ? ? 1 ? ? ? ? ? C5 ? bmse010171 1 15 ? ? 1 1 ? 1 C12 C 13 119.31 ? ? 1 ? ? ? ? ? B5 ? bmse010171 1 16 ? ? 1 1 ? 1 C11 C 13 119.46 ? ? 1 ? ? ? ? ? A6 ? bmse010171 1 17 ? ? 1 1 ? 1 C9 C 13 119.93 ? ? 1 ? ? ? ? ? B6 ? bmse010171 1 18 ? ? 1 1 ? 1 C7 C 13 122.39 ? ? 1 ? ? ? ? ? BB ? bmse010171 1 19 ? ? 1 1 ? 1 C14 C 13 122.94 ? ? 1 ? ? ? ? ? A5 ? bmse010171 1 20 ? ? 1 1 ? 1 C10 C 13 126.32 ? ? 1 ? ? ? ? ? C6 ? bmse010171 1 21 ? ? 1 1 ? 1 C25 C 13 130.99 ? ? 1 ? ? ? ? ? C1 ? bmse010171 1 22 ? ? 1 1 ? 1 C24 C 13 132.03 ? ? 1 ? ? ? ? ? B1 ? bmse010171 1 23 ? ? 1 1 ? 1 C8 C 13 133.93 ? ? 1 ? ? ? ? ? BA ? bmse010171 1 24 ? ? 1 1 ? 1 C26 C 13 136.05 ? ? 1 ? ? ? ? ? A1 ? bmse010171 1 25 ? ? 1 1 ? 1 C27 C 13 139.89 ? ? 1 ? ? ? ? ? A4 ? bmse010171 1 26 ? ? 1 1 ? 1 C28 C 13 147.31 ? ? 1 ? ? ? ? ? B4 ? bmse010171 1 27 ? ? 1 1 ? 1 C31 C 13 150.68 ? ? 1 ? ? ? ? ? C3 ? bmse010171 1 28 ? ? 1 1 ? 1 C32 C 13 151.13 ? ? 1 ? ? ? ? ? A3 ? bmse010171 1 29 ? ? 1 1 ? 1 C30 C 13 151.43 ? ? 1 ? ? ? ? ? B3 ? bmse010171 1 30 ? ? 1 1 ? 1 C29 C 13 152.81 ? ? 1 ? ? ? ? ? C4 ? bmse010171 1 31 ? ? 1 1 ? 1 C23 C 13 168.86 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010171 1 32 ? ? 1 1 ? 1 C21 C 13 170.82 ? ? 4 ? ? ? ? ? GAcC=O ? bmse010171 1 33 ? ? 1 1 ? 1 C22 C 13 170.95 ? ? 4 ? ? ? ? ? GAcC=O ? bmse010171 1 34 ? ? 1 1 ? 1 C19 C 13 190.96 ? ? 1 ? ? ? ? ? CA ? bmse010171 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 4 bmse010171 1 1 5 bmse010171 1 1 6 bmse010171 1 2 32 bmse010171 1 2 33 bmse010171 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010171 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010171 2 3 "1D 13C" 2 $sample_2 bmse010171 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010171 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C3 C 13 20.46 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010171 2 2 ? ? 1 1 ? 1 C2 C 13 20.62 ? ? 1 ? ? ? ? ? GAcMe ? bmse010171 2 3 ? ? 1 1 ? 1 C1 C 13 20.80 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010171 2 4 ? ? 1 1 ? 1 C4 C 13 56.24 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 5 ? ? 1 1 ? 1 C5 C 13 56.29 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 6 ? ? 1 1 ? 1 C6 C 13 56.51 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 7 ? ? 1 1 ? 1 C20 C 13 63.32 ? ? 1 ? ? ? ? ? G ? bmse010171 2 8 ? ? 1 1 ? 1 C15 C 13 65.38 ? ? 1 ? ? ? ? ? BG ? bmse010171 2 9 ? ? 1 1 ? 1 C34 C 13 80.55 ? ? 1 ? ? ? ? ? A ? bmse010171 2 10 ? ? 1 1 ? 1 C33 C 13 81.82 ? ? 1 ? ? ? ? ? B ? bmse010171 2 11 ? ? 1 1 ? 1 C16 C 13 111.36 ? ? 1 ? ? ? ? ? B2 ? bmse010171 2 12 ? ? 1 1 ? 1 C17 C 13 111.36 ? ? 1 ? ? ? ? ? C2 ? bmse010171 2 13 ? ? 1 1 ? 1 C18 C 13 112.68 ? ? 1 ? ? ? ? ? A2 ? bmse010171 2 14 ? ? 1 1 ? 1 C13 C 13 115.94 ? ? 1 ? ? ? ? ? C5 ? bmse010171 2 15 ? ? 1 1 ? 1 C12 C 13 119.62 ? ? 1 ? ? ? ? ? B5 ? bmse010171 2 16 ? ? 1 1 ? 1 C11 C 13 120.33 ? ? 1 ? ? ? ? ? A6 ? bmse010171 2 17 ? ? 1 1 ? 1 C9 C 13 120.53 ? ? 1 ? ? ? ? ? B6 ? bmse010171 2 18 ? ? 1 1 ? 1 C7 C 13 123.35 ? ? 1 ? ? ? ? ? BB ? bmse010171 2 19 ? ? 1 1 ? 1 C14 C 13 123.53 ? ? 1 ? ? ? ? ? A5 ? bmse010171 2 20 ? ? 1 1 ? 1 C10 C 13 126.04 ? ? 1 ? ? ? ? ? C6 ? bmse010171 2 21 ? ? 1 1 ? 1 C25 C 13 132.08 ? ? 1 ? ? ? ? ? C1 ? bmse010171 2 22 ? ? 1 1 ? 1 C24 C 13 132.61 ? ? 1 ? ? ? ? ? B1 ? bmse010171 2 23 ? ? 1 1 ? 1 C8 C 13 134.20 ? ? 1 ? ? ? ? ? BA ? bmse010171 2 24 ? ? 1 1 ? 1 C26 C 13 136.78 ? ? 1 ? ? ? ? ? A1 ? bmse010171 2 25 ? ? 1 1 ? 1 C27 C 13 140.85 ? ? 1 ? ? ? ? ? A4 ? bmse010171 2 26 ? ? 1 1 ? 1 C28 C 13 148.54 ? ? 1 ? ? ? ? ? B4 ? bmse010171 2 27 ? ? 1 1 ? 1 C31 C 13 151.58 ? ? 1 ? ? ? ? ? C3 ? bmse010171 2 28 ? ? 1 1 ? 1 C32 C 13 152.02 ? ? 1 ? ? ? ? ? A3 ? bmse010171 2 29 ? ? 1 1 ? 1 C30 C 13 152.28 ? ? 1 ? ? ? ? ? B3 ? bmse010171 2 30 ? ? 1 1 ? 1 C29 C 13 153.36 ? ? 1 ? ? ? ? ? C4 ? bmse010171 2 31 ? ? 1 1 ? 1 C23 C 13 168.87 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010171 2 32 ? ? 1 1 ? 1 C21 C 13 170.77 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010171 2 33 ? ? 1 1 ? 1 C22 C 13 170.77 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010171 2 34 ? ? 1 1 ? 1 C19 C 13 191.26 ? ? 1 ? ? ? ? ? CA ? bmse010171 2 35 ? ? 1 1 ? 1 H47 H 1 1.91 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 36 ? ? 1 1 ? 1 H48 H 1 1.91 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 37 ? ? 1 1 ? 1 H49 H 1 1.91 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 38 ? ? 1 1 ? 1 H50 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 39 ? ? 1 1 ? 1 H51 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 40 ? ? 1 1 ? 1 H52 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 41 ? ? 1 1 ? 1 H53 H 1 2.07 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 42 ? ? 1 1 ? 1 H54 H 1 2.07 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 43 ? ? 1 1 ? 1 H55 H 1 2.07 ? ? 4 ? ? ? ? ? AcMe ? bmse010171 2 44 ? ? 1 1 ? 1 H56 H 1 3.81 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 45 ? ? 1 1 ? 1 H57 H 1 3.81 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 46 ? ? 1 1 ? 1 H58 H 1 3.81 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 47 ? ? 1 1 ? 1 H59 H 1 3.83 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 48 ? ? 1 1 ? 1 H60 H 1 3.83 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 49 ? ? 1 1 ? 1 H61 H 1 3.83 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 50 ? ? 1 1 ? 1 H62 H 1 3.97 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 51 ? ? 1 1 ? 1 H63 H 1 3.97 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 52 ? ? 1 1 ? 1 H64 H 1 3.97 ? ? 4 ? ? ? ? ? OMe ? bmse010171 2 53 ? ? 1 1 ? 1 H79 H 1 4.45 ? ? 1 ? ? ? ? ? G1 ? bmse010171 2 54 ? ? 1 1 ? 1 H80 H 1 4.56 ? ? 1 ? ? ? ? ? G2 ? bmse010171 2 55 ? ? 1 1 ? 1 H73 H 1 4.67 ? ? 1 ? ? ? ? ? BG ? bmse010171 2 56 ? ? 1 1 ? 1 H74 H 1 4.91 ? ? 1 ? ? ? ? ? B ? bmse010171 2 57 ? ? 1 1 ? 1 H82 H 1 5.84 ? ? 1 ? ? ? ? ? A ? bmse010171 2 58 ? ? 1 1 ? 1 H65 H 1 6.27 ? ? 1 ? ? ? ? ? BB ? bmse010171 2 59 ? ? 1 1 ? 1 H66 H 1 6.63 ? ? 1 ? ? ? ? ? BA ? bmse010171 2 60 ? ? 1 1 ? 1 H67 H 1 6.93 ? ? 1 ? ? ? ? ? B6 ? bmse010171 2 61 ? ? 1 1 ? 1 H70 H 1 7.01 ? ? 1 ? ? ? ? ? B5 ? bmse010171 2 62 ? ? 1 1 ? 1 H72 H 1 7.03 ? ? 1 ? ? ? ? ? A5 ? bmse010171 2 63 ? ? 1 1 ? 1 H69 H 1 7.14 ? ? 1 ? ? ? ? ? A6 ? bmse010171 2 64 ? ? 1 1 ? 1 H75 H 1 7.15 ? ? 1 ? ? ? ? ? B2 ? bmse010171 2 65 ? ? 1 1 ? 1 H71 H 1 7.15 ? ? 1 ? ? ? ? ? C5 ? bmse010171 2 66 ? ? 1 1 ? 1 H77 H 1 7.36 ? ? 1 ? ? ? ? ? A2 ? bmse010171 2 67 ? ? 1 1 ? 1 H68 H 1 7.39 ? ? 1 ? ? ? ? ? C6 ? bmse010171 2 68 ? ? 1 1 ? 1 H76 H 1 7.46 ? ? 1 ? ? ? ? ? C2 ? bmse010171 2 69 ? ? 1 1 ? 1 H78 H 1 9.81 ? ? 1 ? ? ? ? ? CA ? bmse010171 2 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 3 bmse010171 2 1 4 bmse010171 2 1 5 bmse010171 2 2 35 bmse010171 2 2 36 bmse010171 2 2 37 bmse010171 2 2 38 bmse010171 2 2 39 bmse010171 2 2 40 bmse010171 2 2 41 bmse010171 2 2 42 bmse010171 2 2 43 bmse010171 2 3 44 bmse010171 2 3 45 bmse010171 2 3 46 bmse010171 2 3 47 bmse010171 2 3 48 bmse010171 2 3 49 bmse010171 2 3 50 bmse010171 2 3 51 bmse010171 2 3 52 bmse010171 2 stop_ save_