data_bmse010267 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010267 _Entry.Title lignin_cw_compound_1013 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_1013 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010267 2 Richard Helm F. ? bmse010267 3 John Ralph ? ? bmse010267 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010267 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010267 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 6 bmse010267 "1H chemical shifts" 7 bmse010267 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010267 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010267 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010267 4 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010267 5 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010267 6 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010267 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010267 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010267 1 2 John Ralph ? ? ? bmse010267 1 3 Larry Landucci ? L. ? bmse010267 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010267 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_1013 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_1013 1 $lignin_cw_compound_1013 yes native no no ? ? ? bmse010267 1 stop_ save_ save_lignin_cw_compound_1013 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_1013 _Entity.Entry_ID bmse010267 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name lignin_cw_compound_1013 _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010267 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010267 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_1013 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010267 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010267 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_1013 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010267 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010267 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_1013 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C31H32O11/c1-19(32)40-25-13-10-21(16-27(25)37-4)11-15-30(34)39-18-29(42-24-9-7-6-8-23(24)36-3)31(35)22-12-14-26(41-20(2)33)28(17-22)38-5/h6-17,29,31,35H,18H2,1-5H3/b15-11+ ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C31 H32 O11' _Chem_comp.Formula_weight 580.57918 _Chem_comp.Formula_mono_iso_wt_nat 580.1944618703 _Chem_comp.Formula_mono_iso_wt_13C 611.2984618421 _Chem_comp.Formula_mono_iso_wt_15N 580.1944618703 _Chem_comp.Formula_mono_iso_wt_13C_15N 611.2984618421 _Chem_comp.Image_file_name standards/lignin_cw_compound_1013/lit/jr_1013.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_1013/lit/jr_1013.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID ; 3-(4-Acetoxy-3-methoxyphenyl) acrylic acid 3-(4-acetoxy-3-methoxyphenyl)-3-hydroxy-2-(2-methoxyphenoxy) propyl ester ; synonym bmse010267 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "To be defined" Beilstein bmse010267 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OC1=C(C=C(C=C1)C=CC(=O)OCC(C(C2=CC(=C(C=C2)OC(C)=O)OC)O)OC3=CC=CC=C3OC)OC bmse010267 1 Isomeric CC(=O)OC1=C(C=C(C=C1)C=CC(=O)OCC(C(C2=CC(=C(C=C2)OC(C)=O)OC)O)OC3=CC=CC=C3OC)OC bmse010267 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 ? C ? ? ? ? 482.8464 270.0000 ? ? ? bmse010267 1 C2 ? C ? ? ? ? 178.0048 30.0000 ? ? ? bmse010267 1 C3 ? C ? ? ? ? 178.0048 350.0000 ? ? ? bmse010267 1 C4 ? C ? ? ? ? 399.7072 318.0000 ? ? ? bmse010267 1 C5 ? C ? ? ? ? 67.1536 126.0000 ? ? ? bmse010267 1 C6 ? C ? ? ? ? 261.1440 302.0000 ? ? ? bmse010267 1 C7 ? C ? ? ? ? 261.1440 270.0000 ? ? ? bmse010267 1 C8 ? C ? ? ? ? 233.4320 318.0000 ? ? ? bmse010267 1 C9 ? C ? ? ? ? 233.4320 254.0000 ? ? ? bmse010267 1 C10 ? C ? ? ? ? 371.9952 206.0000 ? ? ? bmse010267 1 C11 CA C ? ? ? ? 316.5680 206.0000 ? ? ? bmse010267 1 C12 ? C ? ? ? ? 178.0048 158.0000 ? ? ? bmse010267 1 C13 ? C ? ? ? ? 399.7072 222.0000 ? ? ? bmse010267 1 C14 ? C ? ? ? ? 178.0048 126.0000 ? ? ? bmse010267 1 C15 CB C ? ? ? ? 288.8560 222.0000 ? ? ? bmse010267 1 C16 ? C ? ? ? ? 344.2832 254.0000 ? ? ? bmse010267 1 C17 ? C ? ? ? ? 122.5808 158.0000 ? ? ? bmse010267 1 C18 G C ? ? ? ? 205.7168 206.0000 ? ? ? bmse010267 1 C19 ? C ? ? ? ? 455.1344 254.0000 ? ? ? bmse010267 1 C20 ? C ? ? ? ? 178.0048 62.0000 ? ? ? bmse010267 1 C21 ? C ? ? ? ? 344.2832 222.0000 ? ? ? bmse010267 1 C22 ? C ? ? ? ? 150.2928 174.0000 ? ? ? bmse010267 1 C23 ? C ? ? ? ? 205.7168 302.0000 ? ? ? bmse010267 1 C24 ? C ? ? ? ? 205.7168 270.0000 ? ? ? bmse010267 1 C25 ? C ? ? ? ? 399.7072 254.0000 ? ? ? bmse010267 1 C26 ? C ? ? ? ? 150.2928 110.0000 ? ? ? bmse010267 1 C27 ? C ? ? ? ? 371.9952 270.0000 ? ? ? bmse010267 1 C28 ? C ? ? ? ? 122.5808 126.0000 ? ? ? bmse010267 1 C29 B C ? ? ? ? 178.0048 222.0000 ? ? ? bmse010267 1 C30 CG C ? ? ? ? 261.1440 206.0000 ? ? ? bmse010267 1 C31 A C ? ? ? ? 150.2928 206.0000 ? ? ? bmse010267 1 O32 ? O ? ? ? ? 455.1344 222.0000 ? ? ? bmse010267 1 O33 ? O ? ? ? ? 205.7168 78.0000 ? ? ? bmse010267 1 O34 ? O ? ? ? ? 261.1440 174.0000 ? ? ? bmse010267 1 O35 ? O ? ? ? ? 122.5808 222.0000 ? ? ? bmse010267 1 O36 ? O ? ? ? ? 178.0048 318.0000 ? ? ? bmse010267 1 O37 ? O ? ? ? ? 371.9952 302.0000 ? ? ? bmse010267 1 O38 ? O ? ? ? ? 94.8656 110.0000 ? ? ? bmse010267 1 O39 ? O ? ? ? ? 233.4320 222.0000 ? ? ? bmse010267 1 O40 ? O ? ? ? ? 427.4192 270.0000 ? ? ? bmse010267 1 O41 ? O ? ? ? ? 150.2928 78.0000 ? ? ? bmse010267 1 O42 ? O ? ? ? ? 178.0048 254.0000 ? ? ? bmse010267 1 H43 ? H ? ? ? ? 492.7666 252.8182 ? ? ? bmse010267 1 H44 ? H ? ? ? ? 500.0282 279.9202 ? ? ? bmse010267 1 H45 ? H ? ? ? ? 472.9262 287.1818 ? ? ? bmse010267 1 H46 ? H ? ? ? ? 158.1648 30.0000 ? ? ? bmse010267 1 H47 ? H ? ? ? ? 178.0048 10.1600 ? ? ? bmse010267 1 H48 ? H ? ? ? ? 197.8448 30.0000 ? ? ? bmse010267 1 H49 ? H ? ? ? ? 197.8448 350.0000 ? ? ? bmse010267 1 H50 ? H ? ? ? ? 178.0048 369.8400 ? ? ? bmse010267 1 H51 ? H ? ? ? ? 158.1648 350.0000 ? ? ? bmse010267 1 H52 ? H ? ? ? ? 409.6274 300.8182 ? ? ? bmse010267 1 H53 ? H ? ? ? ? 416.8890 327.9202 ? ? ? bmse010267 1 H54 ? H ? ? ? ? 389.7870 335.1818 ? ? ? bmse010267 1 H55 ? H ? ? ? ? 77.0738 143.1818 ? ? ? bmse010267 1 H56 ? H ? ? ? ? 49.9718 135.9202 ? ? ? bmse010267 1 H57 ? H ? ? ? ? 57.2334 108.8182 ? ? ? bmse010267 1 H58 ? H ? ? ? ? 278.3260 311.9199 ? ? ? bmse010267 1 H59 ? H ? ? ? ? 278.3260 260.0801 ? ? ? bmse010267 1 H60 ? H ? ? ? ? 233.4325 337.8400 ? ? ? bmse010267 1 H61 ? H ? ? ? ? 233.4325 234.1600 ? ? ? bmse010267 1 H62 ? H ? ? ? ? 371.9952 186.1600 ? ? ? bmse010267 1 H63 CA H ? ? ? ? 316.5675 186.1600 ? ? ? bmse010267 1 H64 ? H ? ? ? ? 195.1868 167.9199 ? ? ? bmse010267 1 H65 ? H ? ? ? ? 416.8892 212.0801 ? ? ? bmse010267 1 H66 ? H ? ? ? ? 195.1868 116.0801 ? ? ? bmse010267 1 H67 CB H ? ? ? ? 288.8560 241.8400 ? ? ? bmse010267 1 H68 ? H ? ? ? ? 327.1012 263.9199 ? ? ? bmse010267 1 H69 ? H ? ? ? ? 105.3988 167.9199 ? ? ? bmse010267 1 H70 G1 H ? ? ? ? 192.9636 190.8019 ? ? ? bmse010267 1 H71 G2 H ? ? ? ? 218.4693 190.8013 ? ? ? bmse010267 1 H72 B H ? ? ? ? 195.1868 231.9199 ? ? ? bmse010267 1 H73 A H ? ? ? ? 133.1108 196.0801 ? ? ? bmse010267 1 H74 AOH H ? ? ? ? 122.5811 241.8400 ? ? ? bmse010267 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010267 1 C2 C2 BMRB bmse010267 1 C3 C3 BMRB bmse010267 1 C4 C4 BMRB bmse010267 1 C5 C5 BMRB bmse010267 1 C6 C6 BMRB bmse010267 1 C7 C7 BMRB bmse010267 1 C8 C8 BMRB bmse010267 1 C9 C9 BMRB bmse010267 1 C10 C10 BMRB bmse010267 1 C11 C11 BMRB bmse010267 1 C12 C12 BMRB bmse010267 1 C13 C13 BMRB bmse010267 1 C14 C14 BMRB bmse010267 1 C15 C15 BMRB bmse010267 1 C16 C16 BMRB bmse010267 1 C17 C17 BMRB bmse010267 1 C18 C18 BMRB bmse010267 1 C19 C19 BMRB bmse010267 1 C20 C20 BMRB bmse010267 1 C21 C21 BMRB bmse010267 1 C22 C22 BMRB bmse010267 1 C23 C23 BMRB bmse010267 1 C24 C24 BMRB bmse010267 1 C25 C25 BMRB bmse010267 1 C26 C26 BMRB bmse010267 1 C27 C27 BMRB bmse010267 1 C28 C28 BMRB bmse010267 1 C29 C29 BMRB bmse010267 1 C30 C30 BMRB bmse010267 1 C31 C31 BMRB bmse010267 1 O32 O32 BMRB bmse010267 1 O33 O33 BMRB bmse010267 1 O34 O34 BMRB bmse010267 1 O35 O35 BMRB bmse010267 1 O36 O36 BMRB bmse010267 1 O37 O37 BMRB bmse010267 1 O38 O38 BMRB bmse010267 1 O39 O39 BMRB bmse010267 1 O40 O40 BMRB bmse010267 1 O41 O41 BMRB bmse010267 1 O42 O42 BMRB bmse010267 1 H43 H43 BMRB bmse010267 1 H44 H44 BMRB bmse010267 1 H45 H45 BMRB bmse010267 1 H46 H46 BMRB bmse010267 1 H47 H47 BMRB bmse010267 1 H48 H48 BMRB bmse010267 1 H49 H49 BMRB bmse010267 1 H50 H50 BMRB bmse010267 1 H51 H51 BMRB bmse010267 1 H52 H52 BMRB bmse010267 1 H53 H53 BMRB bmse010267 1 H54 H54 BMRB bmse010267 1 H55 H55 BMRB bmse010267 1 H56 H56 BMRB bmse010267 1 H57 H57 BMRB bmse010267 1 H58 H58 BMRB bmse010267 1 H59 H59 BMRB bmse010267 1 H60 H60 BMRB bmse010267 1 H61 H61 BMRB bmse010267 1 H62 H62 BMRB bmse010267 1 H63 H63 BMRB bmse010267 1 H64 H64 BMRB bmse010267 1 H65 H65 BMRB bmse010267 1 H66 H66 BMRB bmse010267 1 H67 H67 BMRB bmse010267 1 H68 H68 BMRB bmse010267 1 H69 H69 BMRB bmse010267 1 H70 H70 BMRB bmse010267 1 H71 H71 BMRB bmse010267 1 H72 H72 BMRB bmse010267 1 H73 H73 BMRB bmse010267 1 H74 H74 BMRB bmse010267 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C19 ? bmse010267 1 2 covalent SING C2 C20 ? bmse010267 1 3 covalent SING C3 O36 ? bmse010267 1 4 covalent SING C4 O37 ? bmse010267 1 5 covalent SING C5 O38 ? bmse010267 1 6 covalent DOUB C6 C7 ? bmse010267 1 7 covalent SING C6 C8 ? bmse010267 1 8 covalent SING C7 C9 ? bmse010267 1 9 covalent DOUB C8 C23 ? bmse010267 1 10 covalent DOUB C9 C24 ? bmse010267 1 11 covalent DOUB C10 C13 ? bmse010267 1 12 covalent SING C10 C21 ? bmse010267 1 13 covalent DOUB C11 C15 ? bmse010267 1 14 covalent SING C11 C21 ? bmse010267 1 15 covalent DOUB C12 C14 ? bmse010267 1 16 covalent SING C12 C22 ? bmse010267 1 17 covalent SING C13 C25 ? bmse010267 1 18 covalent SING C14 C26 ? bmse010267 1 19 covalent SING C15 C30 ? bmse010267 1 20 covalent DOUB C16 C21 ? bmse010267 1 21 covalent SING C16 C27 ? bmse010267 1 22 covalent DOUB C17 C22 ? bmse010267 1 23 covalent SING C17 C28 ? bmse010267 1 24 covalent SING C18 C29 ? bmse010267 1 25 covalent SING C18 O39 ? bmse010267 1 26 covalent DOUB C19 O32 ? bmse010267 1 27 covalent SING C19 O40 ? bmse010267 1 28 covalent DOUB C20 O33 ? bmse010267 1 29 covalent SING C20 O41 ? bmse010267 1 30 covalent SING C22 C31 ? bmse010267 1 31 covalent SING C23 C24 ? bmse010267 1 32 covalent SING C23 O36 ? bmse010267 1 33 covalent SING C24 O42 ? bmse010267 1 34 covalent DOUB C25 C27 ? bmse010267 1 35 covalent SING C25 O40 ? bmse010267 1 36 covalent DOUB C26 C28 ? bmse010267 1 37 covalent SING C26 O41 ? bmse010267 1 38 covalent SING C27 O37 ? bmse010267 1 39 covalent SING C28 O38 ? bmse010267 1 40 covalent SING C29 C31 ? bmse010267 1 41 covalent SING C29 O42 ? bmse010267 1 42 covalent DOUB C30 O34 ? bmse010267 1 43 covalent SING C30 O39 ? bmse010267 1 44 covalent SING C31 O35 ? bmse010267 1 45 covalent SING C1 H43 ? bmse010267 1 46 covalent SING C1 H44 ? bmse010267 1 47 covalent SING C1 H45 ? bmse010267 1 48 covalent SING C2 H46 ? bmse010267 1 49 covalent SING C2 H47 ? bmse010267 1 50 covalent SING C2 H48 ? bmse010267 1 51 covalent SING C3 H49 ? bmse010267 1 52 covalent SING C3 H50 ? bmse010267 1 53 covalent SING C3 H51 ? bmse010267 1 54 covalent SING C4 H52 ? bmse010267 1 55 covalent SING C4 H53 ? bmse010267 1 56 covalent SING C4 H54 ? bmse010267 1 57 covalent SING C5 H55 ? bmse010267 1 58 covalent SING C5 H56 ? bmse010267 1 59 covalent SING C5 H57 ? bmse010267 1 60 covalent SING C6 H58 ? bmse010267 1 61 covalent SING C7 H59 ? bmse010267 1 62 covalent SING C8 H60 ? bmse010267 1 63 covalent SING C9 H61 ? bmse010267 1 64 covalent SING C10 H62 ? bmse010267 1 65 covalent SING C11 H63 ? bmse010267 1 66 covalent SING C12 H64 ? bmse010267 1 67 covalent SING C13 H65 ? bmse010267 1 68 covalent SING C14 H66 ? bmse010267 1 69 covalent SING C15 H67 ? bmse010267 1 70 covalent SING C16 H68 ? bmse010267 1 71 covalent SING C17 H69 ? bmse010267 1 72 covalent SING C18 H70 ? bmse010267 1 73 covalent SING C18 H71 ? bmse010267 1 74 covalent SING C29 H72 ? bmse010267 1 75 covalent SING C31 H73 ? bmse010267 1 76 covalent SING O35 H74 ? bmse010267 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 1013 "Compound Number" ? lignin_cw_compound_1013 ? "matching entry" ? bmse010267 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010267 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010267 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_1013 "natural abundance" 1 $lignin_cw_compound_1013 ? Solute Saturated ? ? 1 ? "Richard F. Helm" ; 3-(4-Acetoxy-3-methoxyphenyl) acrylic acid 3-(4-acetoxy-3-methoxyphenyl)-3-hydroxy-2-(2-methoxyphenoxy) propyl ester ; n/a bmse010267 1 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010267 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010267 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010267 1 temperature 297 ? K bmse010267 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010267 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010267 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010267 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010267 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010267 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 1H" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010267 1 2 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010267 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010267 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010267 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010267 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010267 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 1H" 1 $sample_1 bmse010267 1 2 "1D 13C" 1 $sample_1 bmse010267 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010267 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C18 C 13 64.27 ? ? 1 ? ? ? ? ? G ? bmse010267 1 2 ? 1 1 1 1 1 C31 C 13 73.56 ? ? 1 ? ? ? ? ? A ? bmse010267 1 3 ? 1 1 1 1 1 C29 C 13 83.73 ? ? 1 ? ? ? ? ? B ? bmse010267 1 4 ? 1 1 1 1 1 C15 C 13 118.81 ? ? 1 ? ? ? ? ? CB ? bmse010267 1 5 ? 1 1 1 1 1 C11 C 13 144.94 ? ? 1 ? ? ? ? ? CA ? bmse010267 1 6 ? 1 1 1 1 1 C30 C 13 166.72 ? ? 1 ? ? ? ? ? CG ? bmse010267 1 7 ? 1 1 1 1 1 H73 H 1 5.08 ? ? 1 ? ? ? ? ? A ? bmse010267 1 8 ? 1 1 1 1 1 H74 H 1 4.75 ? ? 1 ? ? ? ? ? AOH ? bmse010267 1 9 ? 1 1 1 1 1 H72 H 1 4.64 ? ? 1 ? ? ? ? ? B ? bmse010267 1 10 ? 1 1 1 1 1 H70 H 1 4.17 ? ? 1 ? ? ? ? ? G1 ? bmse010267 1 11 ? 1 1 1 1 1 H71 H 1 4.44 ? ? 1 ? ? ? ? ? G2 ? bmse010267 1 12 ? 1 1 1 1 1 H67 H 1 6.49 ? ? 1 ? ? ? ? ? CB ? bmse010267 1 13 ? 1 1 1 1 1 H63 H 1 7.51 ? ? 1 ? ? ? ? ? CA ? bmse010267 1 stop_ save_