data_bmse010447 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010447 _Entry.Title lignin_cw_compound_263 _Entry.Version_type original _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2013-01-09 _Entry.Last_release_date 2013-01-17 _Entry.Original_release_date 2013-01-17 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.31 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_263 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 John Ralph ? ? bmse010447 2 Sally Ralph ? ? bmse010447 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010447 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010447 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 41 bmse010447 "1H chemical shifts" 0 bmse010447 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2013-01-17 2009-05-26 original BMRB "Original spectra from MMC" bmse010447 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010447 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010447 1 2 John Ralph ? ? ? bmse010447 1 3 Larry Landucci ? L. ? bmse010447 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010447 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_263 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 lignin_cw_compound_263 1 $lignin_cw_compound_263 yes native no no ? ? ? bmse010447 1 stop_ save_ save_lignin_cw_compound_263 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_263 _Entity.Entry_ID bmse010447 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name lignin_cw_compound_263 _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010447 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010447 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_263 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010447 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010447 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_263 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010447 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010447 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_263 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code bmse010447 _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C38H42O14/c1-20(39)46-19-35(38(51-23(4)42)26-10-12-30(50-22(3)41)33(16-26)44-6)52-31-13-9-25(15-34(31)45-7)37-28-18-47-36(27(28)17-48-37)24-8-11-29(49-21(2)40)32(14-24)43-5/h8-16,27-28,35-38H,17-19H2,1-7H3 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C38 H42 O14' _Chem_comp.Formula_weight 722.73168 _Chem_comp.Formula_mono_iso_wt_nat 722.2574560576 _Chem_comp.Formula_mono_iso_wt_13C 760.384939894 _Chem_comp.Formula_mono_iso_wt_15N 722.2574560576 _Chem_comp.Formula_mono_iso_wt_13C_15N 760.384939894 _Chem_comp.Image_file_name standards/lignin_cw_compound_263/lit/jr_263.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_263/lit/jr_263.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID Unnamed synonym bmse010447 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical ; CC(=O)OCC(C(C1=CC(=C(C=C1)OC(C)=O)OC)OC(C)=O)OC2=C(C=C(C=C2)C5C4COC(C3=CC(=C(C=C3)OC(C)=O)OC)C4CO5)OC ; bmse010447 1 Isomeric ; CC(=O)OCC(C(C1=CC(=C(C=C1)OC(C)=O)OC)OC(C)=O)OC2=C(C=C(C=C2)C5C4COC(C3=CC(=C(C=C3)OC(C)=O)OC)C4CO5)OC ; bmse010447 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 ? C ? ? ? ? 208.0968 224.4370 ? ? ? bmse010447 1 C2 ? C ? ? ? ? 433.0150 7.1992 ? ? ? bmse010447 1 C3 ? C ? ? ? ? 107.6978 314.8364 ? ? ? bmse010447 1 C4 ? C ? ? ? ? 279.0144 370.4998 ? ? ? bmse010447 1 C5 ? C ? ? ? ? 323.1728 53.3596 ? ? ? bmse010447 1 C6 ? C ? ? ? ? 159.8902 372.8008 ? ? ? bmse010447 1 C7 ? C ? ? ? ? 328.5496 290.9112 ? ? ? bmse010447 1 C8 ? C ? ? ? ? 400.7048 106.0538 ? ? ? bmse010447 1 C9 ? C ? ? ? ? 284.3912 208.2182 ? ? ? bmse010447 1 C10 ? C ? ? ? ? 209.4254 293.2122 ? ? ? bmse010447 1 C11 ? C ? ? ? ? 408.7830 81.3408 ? ? ? bmse010447 1 C12 ? C ? ? ? ? 183.9922 298.6176 ? ? ? bmse010447 1 C13 ? C ? ? ? ? 276.3572 232.9468 ? ? ? bmse010447 1 C14 ? C ? ? ? ? 357.9010 92.0632 ? ? ? bmse010447 1 C15 ? C ? ? ? ? 327.2210 222.1360 ? ? ? bmse010447 1 C16 ? C ? ? ? ? 218.7880 337.2614 ? ? ? bmse010447 1 C17 ? C ? ? ? ? 317.8584 136.0162 ? ? ? bmse010447 1 C18 ? C ? ? ? ? 367.1882 177.9750 ? ? ? bmse010447 1 C19 ? C ? ? ? ? 242.8926 263.0808 ? ? ? bmse010447 1 C20 ? C ? ? ? ? 200.0628 249.1630 ? ? ? bmse010447 1 C21 ? C ? ? ? ? 424.9368 31.9122 ? ? ? bmse010447 1 C22 ? C ? ? ? ? 133.1284 309.4310 ? ? ? bmse010447 1 C23 ? C ? ? ? ? 261.6178 351.1792 ? ? ? bmse010447 1 C24 ? C ? ? ? ? 375.2638 111.4150 ? ? ? bmse010447 1 C25 ? C ? ? ? ? 309.8244 202.8128 ? ? ? bmse010447 1 C26 ? C ? ? ? ? 226.8220 312.5354 ? ? ? bmse010447 1 C27 ? C ? ? ? ? 342.5870 144.0502 ? ? ? bmse010447 1 C28 ? C ? ? ? ? 342.5870 170.0502 ? ? ? bmse010447 1 C29 ? C ? ? ? ? 391.4202 61.9890 ? ? ? bmse010447 1 C30 ? C ? ? ? ? 175.9582 323.3462 ? ? ? bmse010447 1 C31 ? C ? ? ? ? 293.7538 252.2674 ? ? ? bmse010447 1 C32 ? C ? ? ? ? 365.9792 67.3502 ? ? ? bmse010447 1 C33 ? C ? ? ? ? 193.3574 342.6668 ? ? ? bmse010447 1 C34 ? C ? ? ? ? 319.1870 246.8620 ? ? ? bmse010447 1 C35 ? C ? ? ? ? 260.2892 282.4014 ? ? ? bmse010447 1 C36 ? C ? ? ? ? 367.1882 136.1280 ? ? ? bmse010447 1 C37 ? C ? ? ? ? 317.8584 178.0868 ? ? ? bmse010447 1 C38 ? C ? ? ? ? 252.2552 307.1300 ? ? ? bmse010447 1 O39 ? O ? ? ? ? 174.6296 254.5684 ? ? ? bmse010447 1 O40 ? O ? ? ? ? 442.3022 51.2640 ? ? ? bmse010447 1 O41 ? O ? ? ? ? 141.1650 284.7024 ? ? ? bmse010447 1 O42 ? O ? ? ? ? 236.1846 356.5846 ? ? ? bmse010447 1 O43 ? O ? ? ? ? 348.6138 47.9984 ? ? ? bmse010447 1 O44 ? O ? ? ? ? 185.3208 367.3954 ? ? ? bmse010447 1 O45 ? O ? ? ? ? 336.5836 266.1852 ? ? ? bmse010447 1 O46 ? O ? ? ? ? 217.4594 268.4862 ? ? ? bmse010447 1 O47 ? O ? ? ? ? 382.3618 157.0502 ? ? ? bmse010447 1 O48 ? O ? ? ? ? 302.5756 157.0502 ? ? ? bmse010447 1 O49 ? O ? ? ? ? 399.4958 37.2734 ? ? ? bmse010447 1 O50 ? O ? ? ? ? 150.5276 328.7516 ? ? ? bmse010447 1 O51 ? O ? ? ? ? 269.6518 326.4506 ? ? ? bmse010447 1 O52 ? O ? ? ? ? 285.7198 276.9960 ? ? ? bmse010447 1 H53 ? H ? ? ? ? 192.7658 219.4556 ? ? ? bmse010447 1 H54 ? H ? ? ? ? 213.0782 209.1060 ? ? ? bmse010447 1 H55 ? H ? ? ? ? 223.4278 229.4184 ? ? ? bmse010447 1 H56 ? H ? ? ? ? 417.6928 2.1907 ? ? ? bmse010447 1 H57 ? H ? ? ? ? 438.0236 -8.1230 ? ? ? bmse010447 1 H58 ? H ? ? ? ? 448.3372 12.2077 ? ? ? bmse010447 1 H59 ? H ? ? ? ? 111.0493 330.6041 ? ? ? bmse010447 1 H60 ? H ? ? ? ? 91.9301 318.1879 ? ? ? bmse010447 1 H61 ? H ? ? ? ? 104.3463 299.0687 ? ? ? bmse010447 1 H62 ? H ? ? ? ? 290.9938 359.7133 ? ? ? bmse010447 1 H63 ? H ? ? ? ? 289.8009 382.4792 ? ? ? bmse010447 1 H64 ? H ? ? ? ? 267.0350 381.2863 ? ? ? bmse010447 1 H65 ? H ? ? ? ? 326.4968 69.1332 ? ? ? bmse010447 1 H66 ? H ? ? ? ? 307.3992 56.6836 ? ? ? bmse010447 1 H67 ? H ? ? ? ? 319.8488 37.5860 ? ? ? bmse010447 1 H68 ? H ? ? ? ? 163.2417 388.5685 ? ? ? bmse010447 1 H69 ? H ? ? ? ? 144.1225 376.1523 ? ? ? bmse010447 1 H70 ? H ? ? ? ? 156.5387 357.0331 ? ? ? bmse010447 1 H71 ? H ? ? ? ? 343.8806 295.8926 ? ? ? bmse010447 1 H72 ? H ? ? ? ? 323.5682 306.2422 ? ? ? bmse010447 1 H73 ? H ? ? ? ? 313.2186 285.9298 ? ? ? bmse010447 1 H74 ? H ? ? ? ? 411.4701 118.0523 ? ? ? bmse010447 1 H75 ? H ? ? ? ? 273.6048 196.2387 ? ? ? bmse010447 1 H76 ? H ? ? ? ? 214.4074 277.8813 ? ? ? bmse010447 1 H77 ? H ? ? ? ? 424.5566 78.0171 ? ? ? bmse010447 1 H78 ? H ? ? ? ? 173.2058 286.6382 ? ? ? bmse010447 1 H79 ? H ? ? ? ? 260.5895 236.2986 ? ? ? bmse010447 1 H80 ? H ? ? ? ? 342.1273 95.3869 ? ? ? bmse010447 1 H81 ? H ? ? ? ? 342.9889 218.7849 ? ? ? bmse010447 1 H82 ? H ? ? ? ? 229.5744 349.2409 ? ? ? bmse010447 1 H83 ? H ? ? ? ? 303.8981 127.9561 ? ? ? bmse010447 1 H84 ? H ? ? ? ? 324.4148 121.2898 ? ? ? bmse010447 1 H85 ? H ? ? ? ? 381.1602 186.0148 ? ? ? bmse010447 1 H86 ? H ? ? ? ? 360.6609 192.7144 ? ? ? bmse010447 1 H87 ? H ? ? ? ? 236.8541 248.1345 ? ? ? bmse010447 1 H88 ? H ? ? ? ? 256.5631 254.5385 ? ? ? bmse010447 1 H89 ? H ? ? ? ? 342.6079 127.9302 ? ? ? bmse010447 1 H90 ? H ? ? ? ? 342.6079 186.1702 ? ? ? bmse010447 1 H91 ? H ? ? ? ? 265.2705 267.0703 ? ? ? bmse010447 1 H92 ? H ? ? ? ? 383.1129 133.6264 ? ? ? bmse010447 1 H93 ? H ? ? ? ? 301.9368 180.6082 ? ? ? bmse010447 1 H94 ? H ? ? ? ? 247.2737 322.4610 ? ? ? bmse010447 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 ? bmse010447 1 C2 C2 ? bmse010447 1 C3 C3 ? bmse010447 1 C4 C4 ? bmse010447 1 C5 C5 ? bmse010447 1 C6 C6 ? bmse010447 1 C7 C7 ? bmse010447 1 C8 C8 ? bmse010447 1 C9 C9 ? bmse010447 1 C10 C10 ? bmse010447 1 C11 C11 ? bmse010447 1 C12 C12 ? bmse010447 1 C13 C13 ? bmse010447 1 C14 C14 ? bmse010447 1 C15 C15 ? bmse010447 1 C16 C16 ? bmse010447 1 C17 C17 ? bmse010447 1 C18 C18 ? bmse010447 1 C19 C19 ? bmse010447 1 C20 C20 ? bmse010447 1 C21 C21 ? bmse010447 1 C22 C22 ? bmse010447 1 C23 C23 ? bmse010447 1 C24 C24 ? bmse010447 1 C25 C25 ? bmse010447 1 C26 C26 ? bmse010447 1 C27 C27 ? bmse010447 1 C28 C28 ? bmse010447 1 C29 C29 ? bmse010447 1 C30 C30 ? bmse010447 1 C31 C31 ? bmse010447 1 C32 C32 ? bmse010447 1 C33 C33 ? bmse010447 1 C34 C34 ? bmse010447 1 C35 C35 ? bmse010447 1 C36 C36 ? bmse010447 1 C37 C37 ? bmse010447 1 C38 C38 ? bmse010447 1 O39 O39 ? bmse010447 1 O40 O40 ? bmse010447 1 O41 O41 ? bmse010447 1 O42 O42 ? bmse010447 1 O43 O43 ? bmse010447 1 O44 O44 ? bmse010447 1 O45 O45 ? bmse010447 1 O46 O46 ? bmse010447 1 O47 O47 ? bmse010447 1 O48 O48 ? bmse010447 1 O49 O49 ? bmse010447 1 O50 O50 ? bmse010447 1 O51 O51 ? bmse010447 1 O52 O52 ? bmse010447 1 H53 H53 ? bmse010447 1 H54 H54 ? bmse010447 1 H55 H55 ? bmse010447 1 H56 H56 ? bmse010447 1 H57 H57 ? bmse010447 1 H58 H58 ? bmse010447 1 H59 H59 ? bmse010447 1 H60 H60 ? bmse010447 1 H61 H61 ? bmse010447 1 H62 H62 ? bmse010447 1 H63 H63 ? bmse010447 1 H64 H64 ? bmse010447 1 H65 H65 ? bmse010447 1 H66 H66 ? bmse010447 1 H67 H67 ? bmse010447 1 H68 H68 ? bmse010447 1 H69 H69 ? bmse010447 1 H70 H70 ? bmse010447 1 H71 H71 ? bmse010447 1 H72 H72 ? bmse010447 1 H73 H73 ? bmse010447 1 H74 H74 ? bmse010447 1 H75 H75 ? bmse010447 1 H76 H76 ? bmse010447 1 H77 H77 ? bmse010447 1 H78 H78 ? bmse010447 1 H79 H79 ? bmse010447 1 H80 H80 ? bmse010447 1 H81 H81 ? bmse010447 1 H82 H82 ? bmse010447 1 H83 H83 ? bmse010447 1 H84 H84 ? bmse010447 1 H85 H85 ? bmse010447 1 H86 H86 ? bmse010447 1 H87 H87 ? bmse010447 1 H88 H88 ? bmse010447 1 H89 H89 ? bmse010447 1 H90 H90 ? bmse010447 1 H91 H91 ? bmse010447 1 H92 H92 ? bmse010447 1 H93 H93 ? bmse010447 1 H94 H94 ? bmse010447 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C20 ? bmse010447 1 2 covalent SING C2 C21 ? bmse010447 1 3 covalent SING C3 C22 ? bmse010447 1 4 covalent SING C4 C23 ? bmse010447 1 5 covalent SING C5 O43 ? bmse010447 1 6 covalent SING C6 O44 ? bmse010447 1 7 covalent SING C7 O45 ? bmse010447 1 8 covalent DOUB C8 C11 ? bmse010447 1 9 covalent SING C8 C24 ? bmse010447 1 10 covalent DOUB C9 C13 ? bmse010447 1 11 covalent SING C9 C25 ? bmse010447 1 12 covalent DOUB C10 C12 ? bmse010447 1 13 covalent SING C10 C26 ? bmse010447 1 14 covalent SING C11 C29 ? bmse010447 1 15 covalent SING C12 C30 ? bmse010447 1 16 covalent SING C13 C31 ? bmse010447 1 17 covalent DOUB C14 C24 ? bmse010447 1 18 covalent SING C14 C32 ? bmse010447 1 19 covalent DOUB C15 C25 ? bmse010447 1 20 covalent SING C15 C34 ? bmse010447 1 21 covalent DOUB C16 C26 ? bmse010447 1 22 covalent SING C16 C33 ? bmse010447 1 23 covalent SING C17 C27 ? bmse010447 1 24 covalent SING C17 O48 ? bmse010447 1 25 covalent SING C18 C28 ? bmse010447 1 26 covalent SING C18 O47 ? bmse010447 1 27 covalent SING C19 C35 ? bmse010447 1 28 covalent SING C19 O46 ? bmse010447 1 29 covalent DOUB C20 O39 ? bmse010447 1 30 covalent SING C20 O46 ? bmse010447 1 31 covalent DOUB C21 O40 ? bmse010447 1 32 covalent SING C21 O49 ? bmse010447 1 33 covalent DOUB C22 O41 ? bmse010447 1 34 covalent SING C22 O50 ? bmse010447 1 35 covalent DOUB C23 O42 ? bmse010447 1 36 covalent SING C23 O51 ? bmse010447 1 37 covalent SING C24 C36 ? bmse010447 1 38 covalent SING C25 C37 ? bmse010447 1 39 covalent SING C26 C38 ? bmse010447 1 40 covalent SING C27 C28 ? bmse010447 1 41 covalent SING C27 C36 ? bmse010447 1 42 covalent SING C28 C37 ? bmse010447 1 43 covalent DOUB C29 C32 ? bmse010447 1 44 covalent SING C29 O49 ? bmse010447 1 45 covalent DOUB C30 C33 ? bmse010447 1 46 covalent SING C30 O50 ? bmse010447 1 47 covalent DOUB C31 C34 ? bmse010447 1 48 covalent SING C31 O52 ? bmse010447 1 49 covalent SING C32 O43 ? bmse010447 1 50 covalent SING C33 O44 ? bmse010447 1 51 covalent SING C34 O45 ? bmse010447 1 52 covalent SING C35 C38 ? bmse010447 1 53 covalent SING C35 O52 ? bmse010447 1 54 covalent SING C36 O47 ? bmse010447 1 55 covalent SING C37 O48 ? bmse010447 1 56 covalent SING C38 O51 ? bmse010447 1 57 covalent SING C1 H53 ? bmse010447 1 58 covalent SING C1 H54 ? bmse010447 1 59 covalent SING C1 H55 ? bmse010447 1 60 covalent SING C2 H56 ? bmse010447 1 61 covalent SING C2 H57 ? bmse010447 1 62 covalent SING C2 H58 ? bmse010447 1 63 covalent SING C3 H59 ? bmse010447 1 64 covalent SING C3 H60 ? bmse010447 1 65 covalent SING C3 H61 ? bmse010447 1 66 covalent SING C4 H62 ? bmse010447 1 67 covalent SING C4 H63 ? bmse010447 1 68 covalent SING C4 H64 ? bmse010447 1 69 covalent SING C5 H65 ? bmse010447 1 70 covalent SING C5 H66 ? bmse010447 1 71 covalent SING C5 H67 ? bmse010447 1 72 covalent SING C6 H68 ? bmse010447 1 73 covalent SING C6 H69 ? bmse010447 1 74 covalent SING C6 H70 ? bmse010447 1 75 covalent SING C7 H71 ? bmse010447 1 76 covalent SING C7 H72 ? bmse010447 1 77 covalent SING C7 H73 ? bmse010447 1 78 covalent SING C8 H74 ? bmse010447 1 79 covalent SING C9 H75 ? bmse010447 1 80 covalent SING C10 H76 ? bmse010447 1 81 covalent SING C11 H77 ? bmse010447 1 82 covalent SING C12 H78 ? bmse010447 1 83 covalent SING C13 H79 ? bmse010447 1 84 covalent SING C14 H80 ? bmse010447 1 85 covalent SING C15 H81 ? bmse010447 1 86 covalent SING C16 H82 ? bmse010447 1 87 covalent SING C17 H83 ? bmse010447 1 88 covalent SING C17 H84 ? bmse010447 1 89 covalent SING C18 H85 ? bmse010447 1 90 covalent SING C18 H86 ? bmse010447 1 91 covalent SING C19 H87 ? bmse010447 1 92 covalent SING C19 H88 ? bmse010447 1 93 covalent SING C27 H89 ? bmse010447 1 94 covalent SING C28 H90 ? bmse010447 1 95 covalent SING C35 H91 ? bmse010447 1 96 covalent SING C36 H92 ? bmse010447 1 97 covalent SING C37 H93 ? bmse010447 1 98 covalent SING C38 H94 ? bmse010447 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 263 "Compound Number" ? Unnamed ? "matching entry" ? bmse010447 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010447 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010447 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 Unnamed "natural abundance" 1 $lignin_cw_compound_263 ? Solute Saturated ? ? 1 ? "John Ralph Lab" Unnamed n/a bmse010447 1 2 Acetone ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010447 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010447 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID 1 297 ? K bmse010447 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010447 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010447 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010447 1 stop_ save_ save_Bruker_250 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_250 _NMR_spectrometer.Entry_ID bmse010447 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model WM _NMR_spectrometer.Field_strength 250 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010447 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" yes ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010447 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010447 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010447 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010447 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010447 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010447 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010447 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 1 1 1 C2 C 13 20.48 ? ? 1 ? ? ? C4AcMe ? bmse010447 1 2 1 1 1 C3 C 13 20.48 ? ? 1 ? ? ? A4AcMe ? bmse010447 1 3 1 1 1 C4 C 13 20.63 ? ? 1 ? ? ? AAAcMe ? bmse010447 1 4 1 1 1 C1 C 13 20.89 ? ? 1 ? ? ? AGAcMe ? bmse010447 1 5 1 1 1 C28 C 13 55.27 ? ? 1 ? ? ? BB ? bmse010447 1 6 1 1 1 C27 C 13 55.41 ? ? 1 ? ? ? CB ? bmse010447 1 7 1 1 1 C5 C 13 56.21 ? ? 4 ? ? ? OMe ? bmse010447 1 8 1 1 1 C6 C 13 56.26 ? ? 4 ? ? ? OMe ? bmse010447 1 9 1 1 1 C7 C 13 56.28 ? ? 4 ? ? ? OMe ? bmse010447 1 10 1 1 1 C19 C 13 63.03 ? ? 1 ? ? ? AG ? bmse010447 1 11 1 1 1 C18 C 13 72.50 ? ? 1 ? ? ? BG ? bmse010447 1 12 1 1 1 C17 C 13 72.62 ? ? 1 ? ? ? CG ? bmse010447 1 13 1 1 1 C38 C 13 74.54 ? ? 1 ? ? ? AA ? bmse010447 1 14 1 1 1 C35 C 13 80.31 ? ? 1 ? ? ? AB ? bmse010447 1 15 1 1 1 C37 C 13 86.17 ? ? 1 ? ? ? BA ? bmse010447 1 16 1 1 1 C36 C 13 86.17 ? ? 1 ? ? ? CA ? bmse010447 1 17 1 1 1 C14 C 13 111.08 ? ? 1 ? ? ? C2 ? bmse010447 1 18 1 1 1 C15 C 13 111.58 ? ? 1 ? ? ? B2 ? bmse010447 1 19 1 1 1 C16 C 13 112.74 ? ? 1 ? ? ? A2 ? bmse010447 1 20 1 1 1 C8 C 13 118.61 ? ? 1 ? ? ? C6 ? bmse010447 1 21 1 1 1 C13 C 13 119.03 ? ? 1 ? ? ? B5 ? bmse010447 1 22 1 1 1 C9 C 13 119.42 ? ? 1 ? ? ? B6 ? bmse010447 1 23 1 1 1 C10 C 13 120.48 ? ? 1 ? ? ? A6 ? bmse010447 1 24 1 1 1 C12 C 13 123.33 ? ? 1 ? ? ? A5 ? bmse010447 1 25 1 1 1 C11 C 13 123.47 ? ? 1 ? ? ? C5 ? bmse010447 1 26 1 1 1 C26 C 13 136.69 ? ? 1 ? ? ? A1 ? bmse010447 1 27 1 1 1 C25 C 13 136.69 ? ? 1 ? ? ? B1 ? bmse010447 1 28 1 1 1 C29 C 13 140.12 ? ? 1 ? ? ? C4 ? bmse010447 1 29 1 1 1 C30 C 13 141.08 ? ? 1 ? ? ? A4 ? bmse010447 1 30 1 1 1 C24 C 13 141.88 ? ? 1 ? ? ? C1 ? bmse010447 1 31 1 1 1 C31 C 13 147.48 ? ? 1 ? ? ? B4 ? bmse010447 1 32 1 1 1 C34 C 13 151.88 ? ? 1 ? ? ? B3 ? bmse010447 1 33 1 1 1 C32 C 13 152.27 ? ? 1 ? ? ? C3 ? bmse010447 1 34 1 1 1 C33 C 13 152.27 ? ? 1 ? ? ? A3 ? bmse010447 1 35 1 1 1 C22 C 13 168.92 ? ? 1 ? ? ? A4AcC=O ? bmse010447 1 36 1 1 1 C21 C 13 169.05 ? ? 1 ? ? ? C4AcC=O ? bmse010447 1 37 1 1 1 C23 C 13 169.91 ? ? 1 ? ? ? AAAcC=O ? bmse010447 1 38 1 1 1 C20 C 13 170.77 ? ? 1 ? ? ? AGAcC=O ? bmse010447 1 39 1 1 1 C19 C 13 63.58 ? ? 1 ? ? ? AG ? bmse010447 1 40 1 1 1 C38 C 13 75.33 ? ? 1 ? ? ? AA ? bmse010447 1 41 1 1 1 C35 C 13 80.74 ? ? 1 ? ? ? AB ? bmse010447 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 7 bmse010447 1 1 8 bmse010447 1 1 9 bmse010447 1 stop_ save_