6083 -OEChem-02210610212D 37 39 0 1 0 0 0 0 0999 V2000 2.0000 -0.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2619 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7523 2.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -2.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -0.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9423 1.8252 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9917 2.1358 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4025 1.3278 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9889 0.5178 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8660 -3.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -1.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -0.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -2.0422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -0.4327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6844 3.0874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4025 1.3296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2852 3.1760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0615 1.7796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8888 3.3997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9405 0.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6651 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4752 2.5896 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 1.4631 -0.4275 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 -1.2375 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0999 2.9250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3070 2.8430 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4942 1.5427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4309 2.5735 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1220 1.8807 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 0.0786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3291 -3.5475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -3.5475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1000 3.5475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0935 1.8670 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8512 2.9228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8084 1.2136 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 1 13 1 0 0 0 0 1 24 1 0 0 0 0 2 14 2 0 0 0 0 2 15 1 0 0 0 0 2 25 1 0 0 0 0 7 3 1 1 0 0 0 3 22 1 0 0 0 0 3 26 1 0 0 0 0 3 27 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 4 14 1 0 0 0 0 5 11 1 0 0 0 0 5 12 1 0 0 0 0 6 13 2 0 0 0 0 6 15 1 0 0 0 0 7 8 1 0 0 0 0 7 21 1 0 0 0 0 7 28 1 0 0 0 0 8 9 1 0 0 0 0 8 16 1 6 0 0 0 8 29 1 0 0 0 0 9 10 1 0 0 0 0 9 17 1 6 0 0 0 9 30 1 0 0 0 0 10 15 1 1 0 0 0 10 21 1 0 0 0 0 10 31 1 0 0 0 0 11 32 1 0 0 0 0 11 33 1 0 0 0 0 16 34 1 0 0 0 0 17 35 1 0 0 0 0 18 23 1 0 0 0 0 18 36 1 0 0 0 0 19 23 1 0 0 0 0 19 37 1 0 0 0 0 20 23 2 0 0 0 0 22 23 1 0 0 0 0 M END > 1 > 6083 > 12 > 5 > 4 > AAADcQK4c8AAAAAAAAAAAAAAAABAYgEAACwAAAAAAAABWAAAHgAA+CAIEADhHAgA8AUGlxAXTL9hBkGggICAZKAQES0oIFABWIMQVEDIQAIPCEQeANMCAAow8CAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxyphosphonic acid > [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxyphosphonic acid > [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid > [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxyphosphonic acid > InChI=1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1/f/h18-19H,11H2 > -1.453 > C10H14N5O7P > 347.221 > C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)O)O)O > C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O > 186.07 > 0 > 23 > 4 > 0 > 0 > 0 > 0 > 1 > 3 > 3322 > 2 > KEGG > C00020 > Is a reactant or product of enzyme EC 1.2.1.30 Is a reactant or product of enzyme EC 1.2.1.31 Is a reactant or product of enzyme EC 1.6.99.5 Is a reactant or product of enzyme EC 1.8.4.9 Is a reactant or product of enzyme EC 1.8.99.2 Is a reactant or product of enzyme EC 1.13.12.7 Is a reactant or product of enzyme EC 2.4.1.1 Is a reactant or product of enzyme EC 2.4.2.7 Is a reactant or product of enzyme EC 2.4.2.8 Is a reactant or product of enzyme EC 2.5.1.27 Is a reactant or product of enzyme EC 2.7.1.20 Is a reactant or product of enzyme EC 2.7.1.74 Is a reactant or product of enzyme EC 2.7.1.114 Is a reactant or product of enzyme EC 2.7.1.118 Is a reactant or product of enzyme EC 2.7.1.146 Is a reactant or product of enzyme EC 2.7.1.147 Is a reactant or product of enzyme EC 2.7.4.3 Is a reactant or product of enzyme EC 2.7.4.10 Is a reactant or product of enzyme EC 2.7.6.1 Is a reactant or product of enzyme EC 2.7.6.2 Is a reactant or product of enzyme EC 2.7.6.3 Is a reactant or product of enzyme EC 2.7.6.4 Is a reactant or product of enzyme EC 2.7.6.5 Is a reactant or product of enzyme EC 2.7.9.1 Is a reactant or product of enzyme EC 2.7.9.2 Is a reactant or product of enzyme EC 2.7.9.3 Is a reactant or product of enzyme EC 3.1.3.5 Is a reactant or product of enzyme EC 3.1.3.7 Is a reactant or product of enzyme EC 3.1.4.15 Is a reactant or product of enzyme EC 3.1.4.17 Is a reactant or product of enzyme EC 3.1.22.5 Is a reactant or product of enzyme EC 3.2.2.4 Is a reactant or product of enzyme EC 3.4.13.20 Is a reactant or product of enzyme EC 3.5.4.6 Is a reactant or product of enzyme EC 3.5.4.17 Is a reactant or product of enzyme EC 3.6.1.5 Is a reactant or product of enzyme EC 3.6.1.8 Is a reactant or product of enzyme EC 3.6.1.9 Is a reactant or product of enzyme EC 3.6.1.13 Is a reactant or product of enzyme EC 3.6.1.17 Is a reactant or product of enzyme EC 3.6.1.18 Is a reactant or product of enzyme EC 3.6.1.20 Is a reactant or product of enzyme EC 3.6.1.21 Is a reactant or product of enzyme EC 3.6.1.22 Is a reactant or product of enzyme EC 3.6.1.29 Is a reactant or product of enzyme EC 3.6.2.1 Is a reactant or product of enzyme EC 4.3.2.2 Is a reactant or product of enzyme EC 5.1.1.11 Is a reactant or product of enzyme EC 6.1.1.1 Is a reactant or product of enzyme EC 6.1.1.2 Is a reactant or product of enzyme EC 6.1.1.3 Is a reactant or product of enzyme EC 6.1.1.4 Is a reactant or product of enzyme EC 6.1.1.5 Is a reactant or product of enzyme EC 6.1.1.6 Is a reactant or product of enzyme EC 6.1.1.7 Is a reactant or product of enzyme EC 6.1.1.9 Is a reactant or product of enzyme EC 6.1.1.10 Is a reactant or product of enzyme EC 6.1.1.11 Is a reactant or product of enzyme EC 6.1.1.12 Is a reactant or product of enzyme EC 6.1.1.13 Is a reactant or product of enzyme EC 6.1.1.14 Is a reactant or product of enzyme EC 6.1.1.15 Is a reactant or product of enzyme EC 6.1.1.16 Is a reactant or product of enzyme EC 6.1.1.17 Is a reactant or product of enzyme EC 6.1.1.18 Is a reactant or product of enzyme EC 6.1.1.19 Is a reactant or product of enzyme EC 6.1.1.20 Is a reactant or product of enzyme EC 6.1.1.21 Is a reactant or product of enzyme EC 6.1.1.22 Is a reactant or product of enzyme EC 6.2.1.1 Is a reactant or product of enzyme EC 6.2.1.2 Is a reactant or product of enzyme EC 6.2.1.3 Is a reactant or product of enzyme EC 6.2.1.7 Is a reactant or product of enzyme EC 6.2.1.8 Is a reactant or product of enzyme EC 6.2.1.11 Is a reactant or product of enzyme EC 6.2.1.12 Is a reactant or product of enzyme EC 6.2.1.14 Is a reactant or product of enzyme EC 6.2.1.15 Is a reactant or product of enzyme EC 6.2.1.16 Is a reactant or product of enzyme EC 6.2.1.17 Is a reactant or product of enzyme EC 6.2.1.19 Is a reactant or product of enzyme EC 6.2.1.20 Is a reactant or product of enzyme EC 6.2.1.22 Is a reactant or product of enzyme EC 6.2.1.23 Is a reactant or product of enzyme EC 6.2.1.24 Is a reactant or product of enzyme EC 6.2.1.25 Is a reactant or product of enzyme EC 6.2.1.26 Is a reactant or product of enzyme EC 6.2.1.27 Is a reactant or product of enzyme EC 6.2.1.28 Is a reactant or product of enzyme EC 6.2.1.29 Is a reactant or product of enzyme EC 6.2.1.30 Is a reactant or product of enzyme EC 6.2.1.31 Is a reactant or product of enzyme EC 6.2.1.32 Is a reactant or product of enzyme EC 6.2.1.33 Is a reactant or product of enzyme EC 6.2.1.- Is a reactant or product of enzyme EC 6.3.1.1 Is a reactant or product of enzyme EC 6.3.1.5 Is a reactant or product of enzyme EC 6.3.1.7 Is a reactant or product of enzyme EC 6.3.2.1 Is a reactant or product of enzyme EC 6.3.2.11 Is a reactant or product of enzyme EC 6.3.2.14 Is a reactant or product of enzyme EC 6.3.2.18 Is a reactant or product of enzyme EC 6.3.2.19 Is a reactant or product of enzyme EC 6.3.2.21 Is a reactant or product of enzyme EC 6.3.2.24 Is a reactant or product of enzyme EC 6.3.2.26 Is a reactant or product of enzyme EC 6.3.3.4 Is a reactant or product of enzyme EC 6.3.4.1 Is a reactant or product of enzyme EC 6.3.4.5 Is a reactant or product of enzyme EC 6.3.4.9 Is a reactant or product of enzyme EC 6.3.4.10 Is a reactant or product of enzyme EC 6.3.4.11 Is a reactant or product of enzyme EC 6.3.4.15 Is a reactant or product of enzyme EC 6.3.5.1 Is a reactant or product of enzyme EC 6.3.5.2 Is a reactant or product of enzyme EC 6.3.5.4 Is a reactant or product of enzyme EC 6.4.1.6 Is a reactant or product of enzyme EC 6.5.1.1 Is a reactant or product of enzyme EC 6.5.1.2 Is a reactant or product of enzyme EC 6.5.1.3 Is a reactant or product of enzyme EC 6.5.1.4 > 5'-AMP 5'-Adenosine monophosphate 5'-Adenylic acid 61-19-8 AMP Adenosine 5'-monophosphate Adenosine 5'-phosphate Adenylate Adenylic acid C00020 > 61-19-8 > C00020 > 229948 229949 229950 229951 229952 230542 230779 230801 230866 230940 231016 231099 231101 231141 231213 231257 231258 231259 231260 231300 231322 231323 231324 231325 442605 442606 442607 442608 442676 442677 442964 443121 443122 493809 493810 494494 494495 494496 494497 494615 494616 494688 494690 494692 494693 515247 515248 576003 576004 576267 576268 576269 576270 999529 999531 1064982 1064984 1064986 1064988 1065265 1065266 1065285 1065286 1127124 1127125 1310841 1310842 1310843 1310844 1311096 1311097 1311179 1311301 1311303 1311305 1421084 1421085 1421086 1421158 1421159 1421460 1421658 1421659 1431654 1431657 1431660 1633146 1633147 1633462 1633463 1633467 1633542 1827785 1827786 1827888 1827889 1827890 1827891 1942106 1942107 1942448 1942449 1942450 1942451 1942452 1942453 1942454 1942455 1942954 1942956 1942958 2098485 2194010 2194052 2392059 2392060 2392061 2392062 2392063 2392064 2392065 2392066 2392067 2392068 2392069 2392070 2392169 2392170 2392171 2392172 2392477 2392478 2392592 2392647 2392648 2392649 2624861 2624862 2781066 2781067 2781068 2781069 2781070 2781071 2781072 2781073 2781285 2781286 2914396 2981894 2981900 3114421 3114422 3114520 3114521 3114524 3114525 3212324 3212590 3318706 3318708 3318718 3318719 3318720 3318721 3318791 3318895 3659954 3659955 3659956 3891422 4139528 4139529 4139530 4139531 4139532 4139533 4139534 4139535 4139729 4139730 4139731 4139732 4139733 4139734 4388836 4388837 4388929 4388930 4388931 4388932 4388942 4389117 4389118 4558003 4558004 4929860 5107650 5107656 5542147 5542148 5542149 5542150 5542271 5542500 5542506 5542507 5542532 5542533 5821887 5821998 5821999 5822000 5822001 6137708 6137710 6435648 6435649 6435650 6435651 6435652 6435653 6435654 6435655 6435656 6435657 6435729 6435813 6435814 6573338 6573451 6573452 6573516 6573517 6573518 6573519 6729697 6729759 6729822 6729832 6729833 6729837 6729838 6729839 6730143 6730195 6730196 6730197 6730198 6730252 6730253 6730520 6980402 6980403 6980697 6980698 6980699 6980700 6980701 6980702 7245290 7245291 7245408 7245409 7245469 7245470 7245814 7245815 7245816 7245817 7245969 7246003 7246004 7546192 7546193 7546194 7546195 7546196 7546197 7546199 7546200 7546201 7546202 7546637 8569293 8569295 8569323 8569398 8569507 8569569 9256904 9256905 9256906 9257069 9257070 9954996 9954997 9954998 9954999 9955085 9955086 9955087 9955088 9955111 9955112 9955129 9955215 9955216 9955217 9955218 9955219 9955220 9955267 9955268 10120668 10120669 10120670 10120741 10120742 10120743 10120835 10120863 10120893 10120894 10121057 10121071 10121072 10121073 10121074 10835439 10835441 10835442 10835443 10835444 10835445 10835446 10835611 10835850 11513296 11513386 11513387 11513774 11513776 11514023 11514054 11514105 11514106 11514121 11514122 12084202 12084203 12084528 12084671 12084672 12084697 12084698 12084715 12084716 13096685 13096686 13096687 13096688 13096694 13096734 13399564 13399565 13399566 13399567 13399568 13786748 13786749 13786940 13787073 14278167 14278168 14278187 14278188 14278189 14278190 14278246 14278354 14278355 14278699 14488432 14488433 14488439 14488453 14488454 14488548 14488549 14488550 14488551 14488672 14488673 14488684 14488685 14488734 14488735 14719514 14719542 14719544 14719681 14719682 14719686 14719687 14719688 14719689 14719699 14719700 14719702 14719703 14719709 14719710 14719711 14719712 14719713 15825810 15825811 15825834 15826113 15826583 15826584 15826833 15826834 15826835 15826836 15988099 15988100 15988142 15988143 16974796 16974811 16974812 16974813 16974874 16974875 16974876 16974877 16974898 16974899 16975033 16975034 16975035 16975036 16975185 16975327 16975328 16975401 16975402 17942825 17942832 17943123 17943124 17943125 17943167 17943168 17943169 17943194 17943198 18158855 18158860 18655417 18655418 18655547 18655548 18655557 20150067 20150068 20150069 20150070 20150071 20150072 20150073 20150424 20150449 20150473 20150474 20150475 20150476 20150477 20150478 20150479 20150480 20150774 20150775 20150776 20150777 20150778 20150779 20150780 20150781 20150950 20150951 20150952 20150953 20150955 20150956 20150957 20150958 20151171 20151172 20663866 20663867 20664135 20664136 20664137 20664138 20664139 20664140 20664141 20664142 20664153 20664156 20664287 20664288 20664291 20664292 20664295 20664296 20664375 20664376 20664379 20664380 21465599 21465600 21465601 21465602 21465603 21465604 21465605 21465606 21465906 21465907 21465908 21465909 21465910 21465911 21465912 21465913 21465914 21466089 21466090 21466091 21730329 21730519 21730520 21730738 21730869 21730870 22218825 22218826 23200063 23200064 23200065 23200066 24158659 24158660 24987338 24987472 24987473 24987754 27065273 27065274 27065325 27065326 27065354 27065355 27065983 27573597 27573598 27573858 28373622 28373623 28373624 28373625 28373626 28373627 28373628 28373629 28373630 28373631 28373632 28373633 28373634 28373694 28948386 28948387 28948411 28948639 28948640 28948641 28948642 28948643 28948644 28948645 28948646 28948647 28948648 28948649 28948650 28948740 28948742 28948743 28948746 28948747 28948883 28948884 28948885 28948886 28948887 28948888 28948889 28948890 28949039 29726300 29726476 29726477 30749235 30749236 30749237 30749238 30749255 30749261 30749317 30749318 30749319 30749320 30749321 30749322 30749323 30749324 30749325 30749326 30749327 30749328 30749368 30749369 30749370 30749371 30749372 30749542 30749543 30749544 30749545 30749546 30749547 30749548 30749549 30749550 30749551 30749552 30749553 30749554 30749555 30749806 30749808 31615439 31615467 31615468 31615469 31615470 31615471 31615472 31615700 31615701 31615708 31615709 31615710 31615711 31616027 31616028 31616029 31616030 33357071 33357072 33357874 33357875 33357876 33357877 33357878 33358183 33358184 34809571 34810068 34810069 34810070 34810071 34810094 34810095 34810096 34810097 34810364 34810769 34810770 34810771 34810777 34810778 34810893 34810894 34810895 34810925 34810926 34811307 34811479 34811480 34811481 34811482 37926542 37927771 37928061 38492453 38492559 38492560 38492561 38492562 39654555 39654556 39654557 39654558 40889349 40889610 40889611 40889612 40889613 40890009 40890010 40890011 42543246 42543730 42543731 42543909 42543910 46015192 46015201 46015202 46015203 46015204 46015205 46015206 46015558 46015559 46015560 46015561 47168476 47168789 47168795 47168898 47168960 47168961 47168962 47168963 47169234 47169235 47169236 47169237 47169263 47169264 47169437 47169438 48425192 48425254 48425255 48425544 48425924 48425925 49258400 49258401 49258402 49258403 49258404 49258405 49258406 49258407 49258408 49258409 49258414 49258415 49258416 49258778 49259070 49259071 49259072 49259073 49259084 49259085 49259086 49259087 49259088 49259089 49259090 49259091 49259092 49259093 49259094 49259095 49259326 49259327 49259328 49259382 49259383 49259424 50513261 50513263 50513264 50513265 50513266 51247209 51247210 51247564 51247565 51247611 51247612 51247613 51247616 51247617 51247618 51247619 51247620 51247621 51247622 51247623 51247819 51247848 51247849 51247878 51247879 51247880 51247881 51248010 52695314 52695675 52695676 52695677 52695678 52695679 52695680 52695681 52695682 52695683 52695684 52695685 52695686 52695691 52695692 52695693 52695694 52695695 52695696 52695697 52695698 52695699 52695700 52695701 52695702 52695852 52696067 52696139 52696140 52696141 52696142 55670153 55670154 56553634 56553635 56554259 56554260 56554261 56554262 56554263 56554264 56554265 56554266 56554267 56554268 56965937 56965938 56966057 56966058 56966059 56966060 56966061 56966069 56966071 56966072 56966073 56966182 56966314 56966315 56966316 56966680 56967028 58176633 58176634 58176635 58176636 58176637 58176638 58177391 58177392 58177393 58177394 58177395 58177396 58177397 58177398 58177452 58177453 58177455 58177456 58177457 58177458 58177531 58177532 58177533 58177534 58177535 58177536 58177537 58177538 58177539 58177540 58177541 58177544 58177545 58177583 58177584 58177585 60593714 60593715 60593716 60593717 60593916 60593917 60593980 60594134 60594135 60594136 60594334 60594335 60594336 60594337 60594338 60594346 60594392 60594411 60594412 61680105 61680214 61680276 61680277 61680278 61680279 61680280 61680365 61680488 61680489 61680490 61680491 61680492 61680493 61680494 61680495 61680499 61680500 61680501 61680502 61680503 61680504 61680508 61680545 61680546 61680639 61680640 61680681 61680682 61680683 61680864 61680866 61680867 62738111 62738112 62738116 62738117 62738118 62738119 62738120 62738371 62738372 62738373 62738462 62738463 62738464 62738501 62738502 62738503 62738746 62738886 62738896 66360287 66360405 66360406 66360407 66360408 66360545 66360546 66360564 66360565 66360566 66361339 66361340 66361347 66361348 66361358 66361359 66361360 66361475 66361476 67463836 67463837 67464162 67464163 67464380 67464393 67464394 67464395 67464396 67464480 67464481 71041608 71041609 71041610 71041828 71041829 71041977 71042145 71042176 71042177 71042178 71042179 71042246 71042333 71042368 71042509 71042510 73535478 73536113 73536318 73536319 73536320 73536321 73536322 73536323 > 1421154 1421157 1421595 1421596 1421597 1421598 1431736 1942955 1942957 1942959 3212591 5107657 6137709 6137711 6573339 7245471 8569294 8569296 8569570 9257071 9257072 10121058 12084717 12084718 14719543 14719545 14719701 14719704 15826585 15826586 15988144 15988145 20664143 20664144 20664145 20664146 20664147 20664148 20664149 20664150 24987339 28948388 28948389 28948744 28948745 28948748 28948749 30749807 30749809 31615440 56966181 56967029 56967030 56967031 71042334 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00020 > 6083 1 > 1 12 8 1 13 8 10 15 5 2 14 8 2 15 8 7 3 5 4 14 8 4 5 8 4 6 8 5 12 8 6 13 8 6 15 8 8 16 6 9 17 6 $$$$