5957 -OEChem-02210610242D 47 49 0 1 0 0 0 0 0999 V2000 2.0000 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2619 -1.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7523 2.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -2.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -2.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9423 1.5075 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9917 1.8182 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4025 1.0102 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9889 0.2002 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8660 -3.5551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -2.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -0.5551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -2.3598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -0.7504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6844 2.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4025 1.0119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7309 3.2145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5073 1.8181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0615 1.4619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6063 3.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3345 3.4381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8888 3.0820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7897 1.5372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9405 0.5075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6651 1.6856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1109 2.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2852 2.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9209 2.6281 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 8.4752 2.2720 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 10.1980 2.4500 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 1.4631 -0.7451 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 -1.5551 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0999 2.6073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3070 2.5254 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4942 1.2251 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4309 2.2558 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1220 1.5631 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 -0.2390 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3291 -3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1000 3.2298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0935 1.5494 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2969 2.9613 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2541 1.2521 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8084 0.8960 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2428 3.8651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 1 13 1 0 0 0 0 1 32 1 0 0 0 0 2 14 2 0 0 0 0 2 15 1 0 0 0 0 2 33 1 0 0 0 0 7 3 1 1 0 0 0 3 26 1 0 0 0 0 3 34 1 0 0 0 0 3 35 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 4 14 1 0 0 0 0 5 11 1 0 0 0 0 5 12 1 0 0 0 0 6 13 2 0 0 0 0 6 15 1 0 0 0 0 7 8 1 0 0 0 0 7 25 1 0 0 0 0 7 36 1 0 0 0 0 8 9 1 0 0 0 0 8 16 1 6 0 0 0 8 37 1 0 0 0 0 9 10 1 0 0 0 0 9 17 1 6 0 0 0 9 38 1 0 0 0 0 10 15 1 1 0 0 0 10 25 1 0 0 0 0 10 39 1 0 0 0 0 11 40 1 0 0 0 0 11 41 1 0 0 0 0 16 42 1 0 0 0 0 17 43 1 0 0 0 0 18 29 1 0 0 0 0 18 44 1 0 0 0 0 19 29 1 0 0 0 0 19 45 1 0 0 0 0 20 30 1 0 0 0 0 20 46 1 0 0 0 0 21 31 1 0 0 0 0 21 47 1 0 0 0 0 22 29 2 0 0 0 0 23 30 2 0 0 0 0 24 31 2 0 0 0 0 26 30 1 0 0 0 0 27 29 1 0 0 0 0 27 31 1 0 0 0 0 28 30 1 0 0 0 0 28 31 1 0 0 0 0 M END > 1 > 5957 > 18 > 7 > 8 > AAADcQO8c+AAAAAAAAAAAAAAAABAYgEAACwAAAAAAAABWAAAHgAA+CAIEADhHAgA8AUGlxAXTL9hBkGggICAZKAQES0oIFABWIMQVEDIQAIPCEQeANMCAAow8CAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > [[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid > [[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid > [[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid > [[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid > [[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid > InChI=1/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1/f/h18-19,21,23H,11H2 > -3.053 > C10H16N5O13P3 > 507.181 > C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O > C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O > 279.13 > 0 > 31 > 4 > 0 > 0 > 0 > 0 > 1 > 3 > 3304 > 2 > KEGG > C00002 > Is a reactant or product of enzyme EC 1.2.1.30 Is a reactant or product of enzyme EC 1.2.1.31 Is a reactant or product of enzyme EC 1.3.99.15 Is a reactant or product of enzyme EC 1.13.12.7 Is a reactant or product of enzyme EC 1.14.99.19 Is a reactant or product of enzyme EC 1.17.4.1 Is a reactant or product of enzyme EC 1.17.4.2 Is a reactant or product of enzyme EC 1.17.4.2 Is a reactant or product of enzyme EC 1.18.6.1 Is a reactant or product of enzyme EC 1.18.-.- Is a reactant or product of enzyme EC 1.19.6.1 Is a reactant or product of enzyme EC 2.1.1.45 Is a reactant or product of enzyme EC 2.1.2.- Is a reactant or product of enzyme EC 2.1.3.2 Is a reactant or product of enzyme EC 2.1.3.7 Is a reactant or product of enzyme EC 2.3.3.8 Is a reactant or product of enzyme EC 2.4.2.17 Is a reactant or product of enzyme EC 2.5.1.6 Is a reactant or product of enzyme EC 2.5.1.17 Is a reactant or product of enzyme EC 2.7.1.1 Is a reactant or product of enzyme EC 2.7.1.2 Is a reactant or product of enzyme EC 2.7.1.3 Is a reactant or product of enzyme EC 2.7.1.4 Is a reactant or product of enzyme EC 2.7.1.5 Is a reactant or product of enzyme EC 2.7.1.6 Is a reactant or product of enzyme EC 2.7.1.7 Is a reactant or product of enzyme EC 2.7.1.8 Is a reactant or product of enzyme EC 2.7.1.10 Is a reactant or product of enzyme EC 2.7.1.11 Is a reactant or product of enzyme EC 2.7.1.12 Is a reactant or product of enzyme EC 2.7.1.13 Is a reactant or product of enzyme EC 2.7.1.14 Is a reactant or product of enzyme EC 2.7.1.15 Is a reactant or product of enzyme EC 2.7.1.16 Is a reactant or product of enzyme EC 2.7.1.17 Is a reactant or product of enzyme EC 2.7.1.18 Is a reactant or product of enzyme EC 2.7.1.19 Is a reactant or product of enzyme EC 2.7.1.20 Is a reactant or product of enzyme EC 2.7.1.21 Is a reactant or product of enzyme EC 2.7.1.22 Is a reactant or product of enzyme EC 2.7.1.23 Is a reactant or product of enzyme EC 2.7.1.24 Is a reactant or product of enzyme EC 2.7.1.25 Is a reactant or product of enzyme EC 2.7.1.26 Is a reactant or product of enzyme EC 2.7.1.27 Is a reactant or product of enzyme EC 2.7.1.28 Is a reactant or product of enzyme EC 2.7.1.29 Is a reactant or product of enzyme EC 2.7.1.30 Is a reactant or product of enzyme EC 2.7.1.31 Is a reactant or product of enzyme EC 2.7.1.32 Is a reactant or product of enzyme EC 2.7.1.33 Is a reactant or product of enzyme EC 2.7.1.34 Is a reactant or product of enzyme EC 2.7.1.35 Is a reactant or product of enzyme EC 2.7.1.36 Is a reactant or product of enzyme EC 2.7.1.37 Is a reactant or product of enzyme EC 2.7.1.38 Is a reactant or product of enzyme EC 2.7.1.39 Is a reactant or product of enzyme EC 2.7.1.40 Is a reactant or product of enzyme EC 2.7.1.43 Is a reactant or product of enzyme EC 2.7.1.44 Is a reactant or product of enzyme EC 2.7.1.45 Is a reactant or product of enzyme EC 2.7.1.46 Is a reactant or product of enzyme EC 2.7.1.47 Is a reactant or product of enzyme EC 2.7.1.48 Is a reactant or product of enzyme EC 2.7.1.49 Is a reactant or product of enzyme EC 2.7.1.50 Is a reactant or product of enzyme EC 2.7.1.51 Is a reactant or product of enzyme EC 2.7.1.52 Is a reactant or product of enzyme EC 2.7.1.53 Is a reactant or product of enzyme EC 2.7.1.54 Is a reactant or product of enzyme EC 2.7.1.55 Is a reactant or product of enzyme EC 2.7.1.56 Is a reactant or product of enzyme EC 2.7.1.58 Is a reactant or product of enzyme EC 2.7.1.59 Is a reactant or product of enzyme EC 2.7.1.60 Is a reactant or product of enzyme EC 2.7.1.64 Is a reactant or product of enzyme EC 2.7.1.65 Is a reactant or product of enzyme EC 2.7.1.66 Is a reactant or product of enzyme EC 2.7.1.67 Is a reactant or product of enzyme EC 2.7.1.68 Is a reactant or product of enzyme EC 2.7.1.71 Is a reactant or product of enzyme EC 2.7.1.72 Is a reactant or product of enzyme EC 2.7.1.73 Is a reactant or product of enzyme EC 2.7.1.74 Is a reactant or product of enzyme EC 2.7.1.76 Is a reactant or product of enzyme EC 2.7.1.78 Is a reactant or product of enzyme EC 2.7.1.82 Is a reactant or product of enzyme EC 2.7.1.83 Is a reactant or product of enzyme EC 2.7.1.84 Is a reactant or product of enzyme EC 2.7.1.85 Is a reactant or product of enzyme EC 2.7.1.86 Is a reactant or product of enzyme EC 2.7.1.87 Is a reactant or product of enzyme EC 2.7.1.88 Is a reactant or product of enzyme EC 2.7.1.89 Is a reactant or product of enzyme EC 2.7.1.91 Is a reactant or product of enzyme EC 2.7.1.92 Is a reactant or product of enzyme EC 2.7.1.93 Is a reactant or product of enzyme EC 2.7.1.94 Is a reactant or product of enzyme EC 2.7.1.95 Is a reactant or product of enzyme EC 2.7.1.99 Is a reactant or product of enzyme EC 2.7.1.100 Is a reactant or product of enzyme EC 2.7.1.101 Is a reactant or product of enzyme EC 2.7.1.102 Is a reactant or product of enzyme EC 2.7.1.103 Is a reactant or product of enzyme EC 2.7.1.105 Is a reactant or product of enzyme EC 2.7.1.107 Is a reactant or product of enzyme EC 2.7.1.109 Is a reactant or product of enzyme EC 2.7.1.110 Is a reactant or product of enzyme EC 2.7.1.112 Is a reactant or product of enzyme EC 2.7.1.113 Is a reactant or product of enzyme EC 2.7.1.115 Is a reactant or product of enzyme EC 2.7.1.116 Is a reactant or product of enzyme EC 2.7.1.117 Is a reactant or product of enzyme EC 2.7.1.119 Is a reactant or product of enzyme EC 2.7.1.120 Is a reactant or product of enzyme EC 2.7.1.122 Is a reactant or product of enzyme EC 2.7.1.123 Is a reactant or product of enzyme EC 2.7.1.124 Is a reactant or product of enzyme EC 2.7.1.125 Is a reactant or product of enzyme EC 2.7.1.126 Is a reactant or product of enzyme EC 2.7.1.127 Is a reactant or product of enzyme EC 2.7.1.128 Is a reactant or product of enzyme EC 2.7.1.129 Is a reactant or product of enzyme EC 2.7.1.130 Is a reactant or product of enzyme EC 2.7.1.131 Is a reactant or product of enzyme EC 2.7.1.132 Is a reactant or product of enzyme EC 2.7.1.134 Is a reactant or product of enzyme EC 2.7.1.135 Is a reactant or product of enzyme EC 2.7.1.136 Is a reactant or product of enzyme EC 2.7.1.137 Is a reactant or product of enzyme EC 2.7.1.138 Is a reactant or product of enzyme EC 2.7.1.140 Is a reactant or product of enzyme EC 2.7.1.141 Is a reactant or product of enzyme EC 2.7.1.144 Is a reactant or product of enzyme EC 2.7.1.145 Is a reactant or product of enzyme EC 2.7.1.148 Is a reactant or product of enzyme EC 2.7.1.149 Is a reactant or product of enzyme EC 2.7.1.150 Is a reactant or product of enzyme EC 2.7.1.151 Is a reactant or product of enzyme EC 2.7.1.153 Is a reactant or product of enzyme EC 2.7.1.154 Is a reactant or product of enzyme EC 2.7.1.156 Is a reactant or product of enzyme EC 2.7.1.- Is a reactant or product of enzyme EC 2.7.2.1 Is a reactant or product of enzyme EC 2.7.2.2 Is a reactant or product of enzyme EC 2.7.2.3 Is a reactant or product of enzyme EC 2.7.2.4 Is a reactant or product of enzyme EC 2.7.2.6 Is a reactant or product of enzyme EC 2.7.2.7 Is a reactant or product of enzyme EC 2.7.2.8 Is a reactant or product of enzyme EC 2.7.2.11 Is a reactant or product of enzyme EC 2.7.2.13 Is a reactant or product of enzyme EC 2.7.2.14 Is a reactant or product of enzyme EC 2.7.2.- Is a reactant or product of enzyme EC 2.7.3.1 Is a reactant or product of enzyme EC 2.7.3.2 Is a reactant or product of enzyme EC 2.7.3.3 Is a reactant or product of enzyme EC 2.7.3.4 Is a reactant or product of enzyme EC 2.7.3.5 Is a reactant or product of enzyme EC 2.7.3.6 Is a reactant or product of enzyme EC 2.7.3.7 Is a reactant or product of enzyme EC 2.7.3.8 Is a reactant or product of enzyme EC 2.7.3.10 Is a reactant or product of enzyme EC 2.7.3.11 Is a reactant or product of enzyme EC 2.7.3.12 Is a reactant or product of enzyme EC 2.7.4.1 Is a reactant or product of enzyme EC 2.7.4.2 Is a reactant or product of enzyme EC 2.7.4.3 Is a reactant or product of enzyme EC 2.7.4.4 Is a reactant or product of enzyme EC 2.7.4.6 Is a reactant or product of enzyme EC 2.7.4.7 Is a reactant or product of enzyme EC 2.7.4.8 Is a reactant or product of enzyme EC 2.7.4.9 Is a reactant or product of enzyme EC 2.7.4.11 Is a reactant or product of enzyme EC 2.7.4.12 Is a reactant or product of enzyme EC 2.7.4.13 Is a reactant or product of enzyme EC 2.7.4.14 Is a reactant or product of enzyme EC 2.7.4.15 Is a reactant or product of enzyme EC 2.7.4.16 Is a reactant or product of enzyme EC 2.7.4.18 Is a reactant or product of enzyme EC 2.7.4.19 Is a reactant or product of enzyme EC 2.7.4.21 Is a reactant or product of enzyme EC 2.7.6.1 Is a reactant or product of enzyme EC 2.7.6.2 Is a reactant or product of enzyme EC 2.7.6.3 Is a reactant or product of enzyme EC 2.7.6.4 Is a reactant or product of enzyme EC 2.7.6.5 Is a reactant or product of enzyme EC 2.7.7.1 Is a reactant or product of enzyme EC 2.7.7.2 Is a reactant or product of enzyme EC 2.7.7.3 Is a reactant or product of enzyme EC 2.7.7.4 Is a reactant or product of enzyme EC 2.7.7.6 Is a reactant or product of enzyme EC 2.7.7.18 Is a reactant or product of enzyme EC 2.7.7.19 Is a reactant or product of enzyme EC 2.7.7.27 Is a reactant or product of enzyme EC 2.7.7.42 Is a reactant or product of enzyme EC 2.7.7.47 Is a reactant or product of enzyme EC 2.7.7.48 Is a reactant or product of enzyme EC 2.7.7.53 Is a reactant or product of enzyme EC 2.7.7.54 Is a reactant or product of enzyme EC 2.7.7.55 Is a reactant or product of enzyme EC 2.7.7.58 Is a reactant or product of enzyme EC 2.7.7.- Is a reactant or product of enzyme EC 2.7.9.1 Is a reactant or product of enzyme EC 2.7.9.2 Is a reactant or product of enzyme EC 2.7.9.3 Is a reactant or product of enzyme EC 2.7.-.- Is a reactant or product of enzyme EC 3.1.2.4 Is a reactant or product of enzyme EC 3.1.11.5 Is a reactant or product of enzyme EC 3.1.21.5 Is a reactant or product of enzyme EC 3.1.22.5 Is a reactant or product of enzyme EC 3.4.13.20 Is a reactant or product of enzyme EC 3.5.2.9 Is a reactant or product of enzyme EC 3.5.2.14 Is a reactant or product of enzyme EC 3.5.4.9 Is a reactant or product of enzyme EC 3.5.4.18 Is a reactant or product of enzyme EC 3.6.1.3 Is a reactant or product of enzyme EC 3.6.1.5 Is a reactant or product of enzyme EC 3.6.1.8 Is a reactant or product of enzyme EC 3.6.1.14 Is a reactant or product of enzyme EC 3.6.1.15 Is a reactant or product of enzyme EC 3.6.1.17 Is a reactant or product of enzyme EC 3.6.1.- Is a reactant or product of enzyme EC 3.6.3.1 Is a reactant or product of enzyme EC 3.6.3.6 Is a reactant or product of enzyme EC 3.6.3.8 Is a reactant or product of enzyme EC 3.6.3.9 Is a reactant or product of enzyme EC 3.6.3.10 Is a reactant or product of enzyme EC 3.6.3.14 Is a reactant or product of enzyme EC 3.6.3.15 Is a reactant or product of enzyme EC 3.6.3.46 Is a reactant or product of enzyme EC 3.6.3.49 Is a reactant or product of enzyme EC 3.6.3.50 Is a reactant or product of enzyme EC 3.6.3.51 Is a reactant or product of enzyme EC 3.6.3.52 Is a reactant or product of enzyme EC 3.6.4.1 Is a reactant or product of enzyme EC 3.6.4.2 Is a reactant or product of enzyme EC 3.6.4.3 Is a reactant or product of enzyme EC 3.6.4.4 Is a reactant or product of enzyme EC 3.6.4.5 Is a reactant or product of enzyme EC 3.6.4.6 Is a reactant or product of enzyme EC 3.6.4.7 Is a reactant or product of enzyme EC 3.6.4.8 Is a reactant or product of enzyme EC 3.6.4.9 Is a reactant or product of enzyme EC 3.6.4.10 Is a reactant or product of enzyme EC 3.6.4.11 Is a reactant or product of enzyme EC 4.1.1.33 Is a reactant or product of enzyme EC 4.1.1.42 Is a reactant or product of enzyme EC 4.1.1.49 Is a reactant or product of enzyme EC 4.2.1.93 Is a reactant or product of enzyme EC 4.6.1.1 Is a reactant or product of enzyme EC 4.6.1.- Is a reactant or product of enzyme EC 5.1.1.11 Is a reactant or product of enzyme EC 5.1.3.8 Is a reactant or product of enzyme EC 5.4.3.6 Is a reactant or product of enzyme EC 6.1.1.1 Is a reactant or product of enzyme EC 6.1.1.2 Is a reactant or product of enzyme EC 6.1.1.3 Is a reactant or product of enzyme EC 6.1.1.4 Is a reactant or product of enzyme EC 6.1.1.5 Is a reactant or product of enzyme EC 6.1.1.6 Is a reactant or product of enzyme EC 6.1.1.7 Is a reactant or product of enzyme EC 6.1.1.9 Is a reactant or product of enzyme EC 6.1.1.10 Is a reactant or product of enzyme EC 6.1.1.11 Is a reactant or product of enzyme EC 6.1.1.12 Is a reactant or product of enzyme EC 6.1.1.13 Is a reactant or product of enzyme EC 6.1.1.14 Is a reactant or product of enzyme EC 6.1.1.15 Is a reactant or product of enzyme EC 6.1.1.16 Is a reactant or product of enzyme EC 6.1.1.17 Is a reactant or product of enzyme EC 6.1.1.18 Is a reactant or product of enzyme EC 6.1.1.19 Is a reactant or product of enzyme EC 6.1.1.20 Is a reactant or product of enzyme EC 6.1.1.21 Is a reactant or product of enzyme EC 6.1.1.22 Is a reactant or product of enzyme EC 6.2.1.1 Is a reactant or product of enzyme EC 6.2.1.2 Is a reactant or product of enzyme EC 6.2.1.3 Is a reactant or product of enzyme EC 6.2.1.5 Is a reactant or product of enzyme EC 6.2.1.6 Is a reactant or product of enzyme EC 6.2.1.7 Is a reactant or product of enzyme EC 6.2.1.8 Is a reactant or product of enzyme EC 6.2.1.9 Is a reactant or product of enzyme EC 6.2.1.11 Is a reactant or product of enzyme EC 6.2.1.12 Is a reactant or product of enzyme EC 6.2.1.13 Is a reactant or product of enzyme EC 6.2.1.14 Is a reactant or product of enzyme EC 6.2.1.15 Is a reactant or product of enzyme EC 6.2.1.16 Is a reactant or product of enzyme EC 6.2.1.17 Is a reactant or product of enzyme EC 6.2.1.18 Is a reactant or product of enzyme EC 6.2.1.19 Is a reactant or product of enzyme EC 6.2.1.20 Is a reactant or product of enzyme EC 6.2.1.22 Is a reactant or product of enzyme EC 6.2.1.23 Is a reactant or product of enzyme EC 6.2.1.24 Is a reactant or product of enzyme EC 6.2.1.25 Is a reactant or product of enzyme EC 6.2.1.26 Is a reactant or product of enzyme EC 6.2.1.27 Is a reactant or product of enzyme EC 6.2.1.28 Is a reactant or product of enzyme EC 6.2.1.29 Is a reactant or product of enzyme EC 6.2.1.30 Is a reactant or product of enzyme EC 6.2.1.31 Is a reactant or product of enzyme EC 6.2.1.32 Is a reactant or product of enzyme EC 6.2.1.33 Is a reactant or product of enzyme EC 6.2.1.34 Is a reactant or product of enzyme EC 6.2.1.- Is a reactant or product of enzyme EC 6.3.1.1 Is a reactant or product of enzyme EC 6.3.1.2 Is a reactant or product of enzyme EC 6.3.1.4 Is a reactant or product of enzyme EC 6.3.1.5 Is a reactant or product of enzyme EC 6.3.1.6 Is a reactant or product of enzyme EC 6.3.1.7 Is a reactant or product of enzyme EC 6.3.1.8 Is a reactant or product of enzyme EC 6.3.1.9 Is a reactant or product of enzyme EC 6.3.1.10 Is a reactant or product of enzyme EC 6.3.1.- Is a reactant or product of enzyme EC 6.3.2.1 Is a reactant or product of enzyme EC 6.3.2.2 Is a reactant or product of enzyme EC 6.3.2.3 Is a reactant or product of enzyme EC 6.3.2.4 Is a reactant or product of enzyme EC 6.3.2.5 Is a reactant or product of enzyme EC 6.3.2.6 Is a reactant or product of enzyme EC 6.3.2.7 Is a reactant or product of enzyme EC 6.3.2.8 Is a reactant or product of enzyme EC 6.3.2.9 Is a reactant or product of enzyme EC 6.3.2.10 Is a reactant or product of enzyme EC 6.3.2.11 Is a reactant or product of enzyme EC 6.3.2.12 Is a reactant or product of enzyme EC 6.3.2.13 Is a reactant or product of enzyme EC 6.3.2.14 Is a reactant or product of enzyme EC 6.3.2.16 Is a reactant or product of enzyme EC 6.3.2.17 Is a reactant or product of enzyme EC 6.3.2.18 Is a reactant or product of enzyme EC 6.3.2.19 Is a reactant or product of enzyme EC 6.3.2.20 Is a reactant or product of enzyme EC 6.3.2.21 Is a reactant or product of enzyme EC 6.3.2.22 Is a reactant or product of enzyme EC 6.3.2.23 Is a reactant or product of enzyme EC 6.3.2.24 Is a reactant or product of enzyme EC 6.3.2.25 Is a reactant or product of enzyme EC 6.3.2.26 Is a reactant or product of enzyme EC 6.3.2.27 Is a reactant or product of enzyme EC 6.3.2.- Is a reactant or product of enzyme EC 6.3.3.1 Is a reactant or product of enzyme EC 6.3.3.2 Is a reactant or product of enzyme EC 6.3.3.3 Is a reactant or product of enzyme EC 6.3.3.4 Is a reactant or product of enzyme EC 6.3.4.1 Is a reactant or product of enzyme EC 6.3.4.2 Is a reactant or product of enzyme EC 6.3.4.3 Is a reactant or product of enzyme EC 6.3.4.5 Is a reactant or product of enzyme EC 6.3.4.6 Is a reactant or product of enzyme EC 6.3.4.7 Is a reactant or product of enzyme EC 6.3.4.8 Is a reactant or product of enzyme EC 6.3.4.9 Is a reactant or product of enzyme EC 6.3.4.10 Is a reactant or product of enzyme EC 6.3.4.11 Is a reactant or product of enzyme EC 6.3.4.12 Is a reactant or product of enzyme EC 6.3.4.13 Is a reactant or product of enzyme EC 6.3.4.14 Is a reactant or product of enzyme EC 6.3.4.15 Is a reactant or product of enzyme EC 6.3.4.16 Is a reactant or product of enzyme EC 6.3.4.17 Is a reactant or product of enzyme EC 6.3.4.- Is a reactant or product of enzyme EC 6.3.5.1 Is a reactant or product of enzyme EC 6.3.5.2 Is a reactant or product of enzyme EC 6.3.5.3 Is a reactant or product of enzyme EC 6.3.5.4 Is a reactant or product of enzyme EC 6.3.5.5 Is a reactant or product of enzyme EC 6.3.5.6 Is a reactant or product of enzyme EC 6.3.5.7 Is a reactant or product of enzyme EC 6.3.5.9 Is a reactant or product of enzyme EC 6.3.5.10 Is a reactant or product of enzyme EC 6.4.1.1 Is a reactant or product of enzyme EC 6.4.1.2 Is a reactant or product of enzyme EC 6.4.1.3 Is a reactant or product of enzyme EC 6.4.1.4 Is a reactant or product of enzyme EC 6.4.1.5 Is a reactant or product of enzyme EC 6.4.1.6 Is a reactant or product of enzyme EC 6.5.1.1 Is a reactant or product of enzyme EC 6.5.1.3 Is a reactant or product of enzyme EC 6.5.1.4 Is a reactant or product of enzyme EC 6.6.1.1 Is a reactant or product of enzyme EC 6.6.1.2 > 56-65-5 ATP Adenosine 5'-triphosphate C00002 > 56-65-5 > C00002 > 229664 229665 229666 229667 229685 229687 229993 230242 230243 230264 230425 230426 230427 230428 230430 230462 230463 230658 230659 230660 230661 230662 230779 230780 230781 230790 230801 230808 230809 230810 230811 230908 230909 230934 230940 230953 230954 230955 230956 231058 231091 231099 231101 231113 231115 231193 231194 231195 231196 231243 231244 231245 231246 231282 231284 231286 231288 349816 349817 349839 349840 442639 442640 442676 442677 442945 442946 442947 442948 443121 443122 443144 443259 443260 443261 443262 443263 443264 443271 443272 443273 443282 443284 443438 493790 493809 493810 493956 493957 494043 494047 494379 494380 494498 494499 494500 494501 494502 494503 494504 494505 494506 494507 494508 494509 494510 494511 494512 494513 494514 494515 494516 494517 494518 494519 494520 494521 494522 494523 494524 494525 494526 494527 494528 494529 494530 494531 494532 494533 494553 494554 494560 494561 494615 494616 494688 494690 494692 494693 494729 494730 494731 494741 494742 494821 494822 494831 494832 515218 515219 515220 515221 515222 515247 515248 515256 576003 576004 576052 576053 576073 576074 576075 576076 576125 576126 576127 576128 576129 576130 576200 576201 576202 576239 576240 576241 576267 576268 576269 576270 576320 576418 576419 576424 576425 640095 640324 640325 640326 640327 640329 640330 640331 640332 640333 640334 809198 809199 809209 809241 809310 999529 999531 999572 999853 999854 1064980 1064982 1064984 1064986 1064988 1065085 1065086 1065087 1065088 1065227 1065329 1065359 1065360 1065369 1065372 1065373 1065374 1127124 1127125 1127198 1127199 1127205 1127264 1310775 1310776 1310777 1310778 1310841 1310842 1310843 1310844 1310978 1310979 1310980 1310981 1311096 1311097 1311179 1311190 1311281 1311287 1311288 1311289 1311290 1311291 1311292 1311301 1311303 1311305 1311313 1311314 1311315 1311316 1311317 1311318 1311319 1311382 1311383 1311384 1311385 1311409 1311410 1311411 1311412 1311413 1421084 1421085 1421086 1421158 1421159 1421234 1421235 1421238 1421242 1421243 1421282 1421289 1421290 1421443 1421460 1421465 1421466 1421467 1421468 1421609 1421610 1421611 1421612 1421613 1421614 1421658 1421659 1431654 1431657 1431660 1633050 1633051 1633052 1633053 1633150 1633151 1633152 1633153 1633158 1633159 1633160 1633219 1633394 1633419 1633420 1633421 1633422 1633423 1633424 1633462 1633463 1633467 1633520 1633542 1827621 1827725 1827741 1827907 1827908 1827931 1941986 1941987 1942061 1942062 1942063 1942064 1942065 1942079 1942080 1942106 1942107 1942130 1942131 1942280 1942281 1942448 1942449 1942450 1942451 1942452 1942453 1942454 1942455 1942473 1942474 1942475 1942476 1942527 1942693 1942708 1942709 1942710 1942711 1942717 1942718 1942719 1942720 1942749 1942775 1942776 1942954 1942956 1942958 1942960 1942964 1942965 1943031 1943032 1943033 1943034 1943490 1943494 1943495 1943496 1943515 1943516 1943517 1943528 1943539 1943540 1943551 1943552 1943553 1943554 2098340 2098341 2098342 2098345 2098346 2098375 2098376 2098377 2098378 2098399 2098400 2098401 2098402 2098410 2098411 2098412 2098413 2098418 2098419 2098485 2194010 2194091 2194103 2194104 2194106 2194107 2392059 2392060 2392061 2392062 2392063 2392064 2392065 2392066 2392067 2392068 2392069 2392070 2392169 2392170 2392171 2392172 2392190 2392191 2392237 2392238 2392239 2392240 2392334 2392335 2392337 2392444 2392445 2392446 2392477 2392478 2392565 2392566 2392581 2392592 2392647 2392648 2392649 2392650 2392651 2392698 2392699 2392719 2554644 2554650 2554651 2554652 2554658 2554681 2554754 2554755 2554778 2554779 2624429 2624430 2624431 2624432 2624433 2624434 2624435 2624436 2624499 2624566 2624567 2624585 2624601 2624649 2624651 2624653 2624693 2780855 2780856 2780916 2781023 2781024 2781025 2781026 2781066 2781067 2781068 2781069 2781070 2781071 2781072 2781073 2781151 2781155 2781156 2781157 2781285 2781286 2781311 2781312 2914218 2914219 2914220 2914221 2914222 2914223 2914224 2914234 2914235 2914236 2914237 2914238 2914239 2914240 2914260 2914261 2914262 2914263 2914264 2914265 2914266 2914271 2914272 2914273 2914311 2914312 2914313 2914314 2914315 2914316 2914317 2914342 2914343 2914344 2914345 2914378 2914581 2914582 2914653 2914654 2914655 2914656 2914663 2981777 2981818 2981894 2981900 2981911 2981912 2981913 2981914 2981915 2981916 2981917 2981919 2981920 2981921 2981922 2981923 2981924 2981925 2981928 2981929 2981930 2981931 2981932 2981933 2981934 2981958 2981959 2981960 2981961 2981962 2981963 2981964 2981965 2981966 2981967 2981974 2982011 2982012 2982062 2982072 2982073 2982075 2982076 2982077 2982086 2982122 2982123 2982124 3114379 3114380 3114385 3114386 3114421 3114422 3114436 3114437 3114438 3114439 3114440 3114441 3114442 3114446 3114447 3114448 3114449 3114450 3114451 3114452 3114453 3114525 3114534 3114535 3114541 3114542 3114543 3212324 3212328 3212329 3212330 3212331 3212553 3212554 3212590 3212623 3212729 3212820 3212828 3318670 3318671 3318685 3318686 3318687 3318718 3318719 3318720 3318721 3318724 3318725 3318728 3318746 3318747 3318768 3318769 3318817 3318818 3318819 3318820 3318821 3318822 3318823 3318824 3318825 3318826 3318827 3318828 3318829 3318830 3318831 3318832 3318847 3318848 3318851 3318852 3318871 3319009 3319075 3319076 3402101 3402102 3659945 3659946 3659947 3659948 3659949 3659950 3659951 3659952 3659954 3659955 3659956 3660219 3660220 3660221 3660222 3660261 3660262 3660263 3660264 3660265 3660266 3660267 3660268 3660269 3660274 3660290 3660291 3660292 3745771 3745772 3891308 3891309 3891376 3891422 3891430 3891431 3891434 3891548 3891564 3891565 3891570 3891571 3891582 3891583 3891613 3891614 3891671 3891672 3891686 3891687 3891688 3891689 3891720 3891722 3891724 3891726 3891728 3891730 3891867 3891868 3891869 3891870 3891948 3891949 3891953 3891993 3892005 4139528 4139529 4139530 4139531 4139532 4139533 4139534 4139535 4139569 4139570 4139633 4139634 4139729 4139730 4139731 4139732 4139733 4139734 4139832 4139833 4139834 4139835 4139840 4139841 4139842 4139843 4139900 4139965 4139966 4139970 4139971 4140014 4140015 4140019 4140020 4140021 4140022 4140023 4140024 4388836 4388837 4388862 4388863 4388864 4388865 4388866 4388867 4388929 4388930 4388931 4388932 4388942 4389105 4389106 4389108 4389109 4389117 4389118 4389155 4389156 4389210 4389211 4389212 4389213 4389215 4389227 4389228 4389237 4389238 4389239 4389249 4389250 4389291 4389292 4389317 4389318 4389319 4389449 4389450 4557901 4557921 4557922 4557923 4557924 4557925 4557926 4557927 4557928 4558116 4558117 4558118 4558119 4558120 4558121 4558131 4558132 4558189 4558190 4558226 4558227 4558228 4558229 4558230 4558231 4558232 4558233 4558234 4558235 4558236 4558237 4558256 4558257 4699532 4699586 4699624 4699874 4699875 4929839 4929840 4929841 4929842 4929843 4929844 4929845 4929846 4929860 4929927 4929929 4929930 4929931 4929932 4929935 4929936 4929937 4929938 4929939 4929940 4929941 4929942 4930039 4930156 4930157 4930173 4930213 5107421 5107487 5107488 5107489 5107490 5107491 5107510 5107511 5107526 5107527 5107544 5107582 5107583 5107584 5107585 5107601 5107602 5107650 5107656 5107739 5107740 5107741 5542068 5542069 5542070 5542071 5542072 5542074 5542075 5542076 5542077 5542078 5542079 5542080 5542081 5542091 5542092 5542093 5542094 5542095 5542096 5542103 5542104 5542141 5542142 5542146 5542224 5542271 5542439 5542519 5821788 5821843 5821887 5821946 5821947 5821948 5821949 5821950 5821951 5821976 5821977 5821978 5821979 5821980 5821981 5821982 5821983 5822058 5822263 5822278 5822279 5822393 5822394 5822395 5822396 5822495 5822496 5822497 5822498 5822499 5822515 5822517 5822566 5822578 5822587 5822588 6137337 6137338 6137339 6137340 6137441 6137462 6137471 6137568 6137569 6137655 6137656 6137658 6137659 6137661 6137662 6137664 6137665 6137708 6137710 6137732 6137733 6435531 6435532 6435533 6435534 6435535 6435536 6435537 6435538 6435671 6435729 6435742 6435816 6435822 6573338 6573489 6573490 6573491 6573492 6573516 6573517 6573518 6573519 6573580 6573639 6573640 6573649 6573650 6573672 6573676 6573677 6573678 6573679 6573698 6573699 6573700 6573701 6729730 6729731 6729732 6729776 6729803 6729828 6729847 6729850 6729892 6729893 6729902 6729903 6729904 6729905 6729954 6729955 6729992 6729993 6730014 6730116 6730117 6730118 6730119 6730120 6730121 6730122 6730123 6730126 6730127 6730128 6730129 6730130 6730131 6730132 6730133 6730187 6730188 6730189 6730190 6730191 6730192 6730193 6730194 6730195 6730196 6730197 6730198 6730455 6730456 6730463 6730486 6730520 6980398 6980399 6980400 6980401 6980402 6980403 6980643 6980644 6980697 6980698 6980699 6980700 6980701 6980702 6980727 6980728 6980729 6980730 6980731 6980732 6980733 6980734 6980786 6980787 6980788 6980789 6980894 7245352 7245424 7245469 7245470 7245651 7245652 7245663 7245664 7245814 7245815 7245830 7245831 7245970 7546187 7546188 7546192 7546193 7546194 7546195 7546196 7546197 7546199 7546200 7546201 7546202 7546569 7546574 7546637 7766821 7766822 7766859 7766860 7766861 7766862 7767003 7767004 7767026 7767027 7767097 7767098 7767133 7767134 7767135 7767136 7767137 7767138 7767139 7767140 7767148 7767149 8569293 8569295 8569365 8569366 8569440 8569441 8569477 8569478 8569508 8569509 8569569 8569590 8569591 8569592 9256854 9256855 9256856 9256857 9256858 9256859 9256904 9256905 9256906 9256961 9256962 9256963 9256964 9256965 9256966 9256967 9256968 9256969 9256970 9256971 9256972 9257011 9257012 9257013 9257014 9257015 9257016 9257017 9257018 9257019 9257020 9257044 9257069 9257070 9257102 9257123 9257124 9257125 9257126 9257127 9257128 9954996 9954997 9954998 9954999 9955004 9955156 9955157 9955215 9955216 9955217 9955218 9955219 9955220 9955267 9955268 9955318 9955319 9955320 9955367 9955368 9955369 9955370 9955371 9955372 9955373 9955374 10120664 10120665 10120668 10120669 10120670 10120800 10120801 10120853 10120854 10120863 10120871 10120872 10120992 10120993 10120994 10120995 10121009 10121010 10121011 10121012 10121013 10121014 10121057 10121071 10121072 10121073 10121074 10835611 10835631 10835632 10835679 10835680 10835681 10835682 10835685 10835731 10835732 10835829 10835830 10835831 10835833 10835834 10835835 10835836 11513296 11513487 11513488 11513489 11513490 11513494 11513495 11513496 11513497 11513541 11513542 11513599 11513600 11513657 11513658 11513659 11513660 11513667 11513668 11513669 11513670 11513774 11513776 11513943 11513944 11513946 11513947 11513949 11513950 11514023 11514054 12084202 12084203 12084262 12084263 12084384 12084385 12084386 12084387 12084388 12084389 12084390 12084391 12084392 12084393 12084697 12084698 12084715 12084716 12084791 13096153 13096176 13096177 13096178 13096179 13096180 13096247 13096248 13096249 13096250 13096251 13096252 13096253 13096254 13096255 13096256 13096257 13096258 13096259 13096260 13096261 13096262 13096263 13096264 13096265 13096266 13096294 13096295 13096296 13096297 13096382 13096383 13096424 13096425 13096498 13096555 13096556 13096557 13096558 13096582 13096583 13096584 13096585 13096586 13096677 13096678 13096679 13096680 13096681 13096682 13096719 13096720 13096721 13096722 13096723 13096724 13096734 13096755 13096756 13096757 13096758 13096759 13096760 13096761 13096762 13096763 13096764 13399500 13399573 13399574 13399612 13399644 13399857 13399858 13399902 13399903 13786640 13786641 13786642 13786643 13786644 13786645 13786646 13786647 13786648 13786649 13786650 13786651 13786668 13786669 13786670 13786671 13786672 13786673 13786674 13786675 13786676 13786677 13786678 13786679 13786748 13786749 13786784 13786785 13786786 13786787 13786936 13786940 13786942 13787040 13787041 13787042 13787044 13787073 13787123 14277876 14277877 14277914 14277915 14277916 14277917 14277958 14277959 14277960 14277961 14277962 14277963 14277964 14277965 14277966 14277967 14277968 14277969 14277970 14277971 14277972 14277973 14278212 14278213 14278214 14278215 14278239 14278246 14278287 14278288 14278324 14278325 14278326 14278327 14278328 14278329 14278330 14278331 14278332 14278333 14278335 14278336 14278337 14278338 14278339 14278340 14278341 14278342 14278343 14278344 14278354 14278355 14278365 14278366 14278367 14278368 14278369 14278370 14278371 14278372 14278373 14278374 14278481 14278482 14278483 14278484 14278485 14278498 14278499 14278699 14488432 14488433 14488434 14488435 14488436 14488437 14488439 14488453 14488454 14488515 14488516 14488517 14488518 14488519 14488520 14488548 14488549 14488550 14488551 14488646 14488651 14488652 14488653 14488656 14488657 14488672 14488673 14488684 14488685 14488734 14488735 14488739 14488754 14488755 14488756 14488757 14488758 14488796 14488797 14488798 14488799 14488800 14719542 14719544 14719567 14719578 14719579 14719581 14719582 14719632 14719633 14719681 14719682 14719686 14719687 14719688 14719689 14719699 14719700 14719702 14719703 14719709 14719710 14719711 14719712 14719713 14719777 15825694 15825695 15825810 15825811 15825812 15825814 15825815 15825816 15825817 15825990 15825991 15826362 15826363 15826364 15826569 15826570 15826583 15826584 15826589 15826590 15826591 15826592 15826771 15826772 15826826 15826833 15826834 15826835 15826836 15987970 15987971 15987972 15987973 15987974 15987975 15987976 15987977 15987978 15987979 15987980 15987981 15987982 15987983 15987984 15987985 15988007 15988008 15988009 15988010 15988011 15988142 15988143 15988250 15988251 15988306 15988307 15988332 15988333 15988334 15988335 15988336 15988337 15988338 15988339 15988342 15988343 15988344 15988345 15988346 15988347 15988387 15988388 15988389 15988455 16974796 16974811 16974812 16974813 16974898 16974899 16974935 16974936 16975033 16975034 16975035 16975036 16975072 16975130 16975131 16975219 16975313 16975314 16975315 16975316 16975317 16975318 16975319 16975320 16975321 16975322 16975323 16975327 16975328 16975360 16975361 16975362 16975363 16975401 16975402 17942558 17942559 17942560 17942561 17942562 17942825 17942832 17942837 17942838 17942839 17942840 17942879 17942987 17943043 17943044 17943105 17943106 17943107 17943108 17943109 17943110 17943111 17943112 17943123 17943124 17943125 17943194 17943198 17943287 17943304 17943305 17943306 17943307 17943325 18158777 18158778 18158854 18158855 18158860 18158903 18158904 18158905 18158906 18158907 18158908 18158909 18158910 18158988 18158989 18159010 18655410 18655411 18655412 18655417 18655418 18655420 18655421 18655422 18655423 18655472 18655515 18655523 18655524 18655525 18655526 18655527 18655528 18655529 18655530 18655536 18655537 18655538 18655539 18655547 18655548 18655578 18655579 18655580 18655581 18655698 18655699 18655700 18655701 18655702 18655703 18655704 18655705 18655706 18655707 18655708 18655709 18655710 18655777 18655778 18655779 18655780 18655781 18655782 18655783 18655784 18655796 18655797 18655895 18655896 18655897 18655898 20149891 20149899 20149900 20149999 20150000 20150001 20150422 20150423 20150424 20150449 20150571 20150572 20150573 20150574 20150577 20150578 20150579 20150580 20150713 20150714 20150715 20150716 20150717 20150718 20150719 20150720 20150721 20150722 20150723 20150729 20150730 20150731 20150732 20150733 20150734 20150774 20150775 20150776 20150777 20150778 20150779 20150780 20150781 20150886 20150950 20150951 20150952 20150953 20150955 20150956 20150957 20150958 20151029 20151052 20151053 20151083 20151171 20151172 20151205 20151206 20151213 20151214 20663763 20663766 20663854 20663866 20663867 20663909 20663951 20663952 20663953 20663967 20663968 20663969 20663970 20663971 20663972 20664077 20664078 20664135 20664136 20664137 20664138 20664139 20664140 20664141 20664142 20664153 20664156 20664248 20664249 20664250 20664251 20664283 20664284 20664375 20664376 20664379 20664380 21465503 21465504 21465693 21465694 21465698 21465772 21465773 21465774 21465775 21465776 21465777 21465779 21465780 21465781 21465782 21465783 21465784 21465788 21465789 21465819 21465820 21465821 21465822 21465823 21465827 21465828 21465829 21465830 21465831 21465832 21465833 21465834 21465883 21465884 21465885 21465886 21465887 21465888 21465889 21465890 21465891 21465892 21465893 21465894 21465912 21465913 21465914 21466003 21466004 21466005 21466006 21466007 21466008 21466009 21466010 21466011 21466012 21466013 21466014 21466016 21466017 21466018 21466019 21466020 21466021 21466089 21466090 21466091 21466135 21466137 21466141 21730329 21730337 21730338 21730339 21730340 21730341 21730342 21730343 21730344 21730345 21730346 21730347 21730348 21730412 21730413 21730493 21730519 21730520 21730588 21730589 21730590 21730591 21730592 21730593 21730594 21730595 21730653 21730654 21730689 21730690 21730738 21730903 21730904 21730905 21730906 21730907 21730908 21730909 21730910 21730911 21730912 21730913 21730914 21730915 21730916 22218646 22218688 22218689 22218690 22218698 22218699 22218700 22218701 22218702 22218703 22218704 22218713 22218714 22218715 22218716 22218717 22218718 22218719 22218720 22218721 22218722 22218723 22218724 22218725 22218726 22218727 22218728 22218729 22218730 22218731 22218732 22218733 22218734 22218735 22218736 22218737 22218738 22218739 22218740 22218741 22218742 22218743 22218744 22218745 22218746 22218747 22218748 22218749 22218750 22218751 22218752 22218753 22218754 22218755 22218756 22218757 22218758 22218759 22218760 22218786 22218787 22218825 22218826 22218875 22218876 22218877 22218984 22218985 22218986 22218987 22218988 22218989 22218990 22218991 22218992 22218993 22219037 22219316 22219397 22219398 22219401 22219402 22219403 22219404 22219405 22219406 22219407 22219408 23200290 23200291 23200417 23200418 24158608 24158659 24158660 24158832 24158833 24158834 24158845 24158846 24158847 24158848 24158849 24158850 24158851 24158852 24158853 24158854 24158855 24158856 24158857 24158858 24158859 24158860 24158900 24158918 24158919 24158920 24158921 24158922 24158923 24158924 24158925 24158942 24158943 24159070 24159071 24159112 24159113 24987247 24987248 24987249 24987250 24987338 24987353 24987354 24987355 24987356 24987359 24987360 24987361 24987362 24987363 24987384 24987410 24987411 24987412 24987436 24987437 24987438 24987439 24987440 24987441 24987442 24987619 24987639 24987739 24987740 24987885 24987886 27064988 27064989 27064990 27064991 27065010 27065011 27065012 27065076 27065077 27065078 27065079 27065119 27065120 27065452 27065453 27065454 27065458 27065465 27065466 27065467 27065468 27065469 27065470 27065506 27065600 27065601 27065602 27065603 27065605 27065606 27065607 27065608 27065625 27065626 27065627 27065724 27065790 27065791 27065792 27065793 27065983 27066378 27066379 27066381 27066382 27573692 27573693 27573759 27573800 27573834 27573835 27573836 27573837 27573856 27573857 27573858 27573982 27573983 27573984 27573985 27573986 27573987 27573988 27573989 27574165 27574166 28373465 28373466 28373467 28373468 28373469 28373470 28373471 28373472 28373473 28373474 28373475 28373476 28373477 28373478 28373479 28373480 28373481 28373482 28373496 28373614 28373615 28373622 28373623 28373624 28373625 28373626 28373627 28373628 28373629 28373630 28373631 28373632 28373633 28373634 28373694 28373781 28373782 28373853 28373854 28373855 28374107 28948386 28948387 28948411 28948416 28948417 28948482 28948483 28948484 28948485 28948540 28948541 28948542 28948543 28948544 28948545 28948546 28948547 28948548 28948549 28948550 28948551 28948552 28948553 28948554 28948555 28948556 28948557 28948558 28948559 28948560 28948561 28948562 28948563 28948564 28948565 28948566 28948567 28948568 28948569 28948570 28948571 28948651 28948694 28948695 28948696 28948697 28948698 28948699 28948700 28948733 28948734 28948735 28948740 28948742 28948743 28948746 28948747 28948772 28948773 28948774 28948854 28948855 28948883 28948884 28948885 28948886 28948887 28948888 28948889 28948890 28949039 29726270 29726284 29726285 29726286 29726287 29726300 29726395 29726471 29726472 29726473 29726476 29726477 29726528 29726529 29726587 29726589 29726590 29726591 29726592 29726593 29726594 29726597 29726690 29726691 29726692 29726693 29726714 29726715 29726716 29726717 29726718 29726719 29726720 29726919 29726920 29726926 30749235 30749236 30749237 30749238 30749255 30749261 30749317 30749318 30749319 30749320 30749321 30749322 30749323 30749324 30749325 30749326 30749327 30749328 30749342 30749343 30749344 30749345 30749346 30749347 30749348 30749349 30749350 30749351 30749352 30749353 30749368 30749369 30749370 30749371 30749372 30749431 30749432 30749433 30749542 30749543 30749544 30749545 30749546 30749547 30749548 30749549 30749550 30749551 30749552 30749553 30749554 30749555 30749563 30749564 30749565 30749566 30749567 30749568 30749604 30749616 30749617 30749618 30749619 30749620 30749621 30749622 30749623 30749624 30749625 30749626 30749627 30749737 30749738 30749739 30749740 30749741 30749742 30749743 30749744 30749745 30749746 30749747 30749748 30749799 30749800 30749801 30749802 30749803 30749804 30749806 30749808 30749873 30749874 30749875 30749876 30749877 30749932 30749933 30749934 30749935 30749936 30750130 30750131 30750140 31615439 31615467 31615468 31615469 31615470 31615471 31615472 31615591 31615708 31615709 31615710 31615711 31615810 31615811 31615812 31615910 31615911 31615912 31615913 31615914 31615915 31615916 31615917 31615984 31616027 31616028 31616029 31616030 33356936 33356937 33356938 33356939 33356961 33356977 33356978 33356998 33356999 33357000 33357001 33357002 33357003 33357004 33357005 33357006 33357007 33357008 33357009 33357010 33357011 33357071 33357072 33357107 33357108 33357109 33357307 33357308 33357309 33357513 33357514 33357753 33357754 33357757 33357776 33357777 33357778 33357779 33357863 33357864 33357874 33357875 33357876 33357877 33357878 33358114 33358115 33358116 33358117 33358120 33358180 33358183 33358184 33358197 33358198 34809571 34809625 34809626 34809858 34809859 34809861 34809862 34809868 34809869 34809870 34810054 34810055 34810056 34810057 34810065 34810066 34810067 34810081 34810082 34810132 34810211 34810364 34810519 34810520 34810521 34810522 34810553 34810554 34810555 34810556 34810557 34810558 34810559 34810560 34810561 34810562 34810563 34810564 34810565 34810567 34810568 34810589 34810590 34810606 34810607 34810716 34810717 34810718 34810719 34810720 34810721 34810722 34810723 34810893 34810894 34810895 34810913 34810914 34810915 34810932 34810933 34810934 34811267 34811307 34811348 34811400 34811403 34811404 34811405 34811406 34811407 34811408 34811495 34811496 34811497 34811498 34811649 34811650 34811713 37926399 37926794 37926795 37926796 37926797 37926803 37926807 37926808 37926890 37926891 37927282 37927357 37927469 37927502 37927861 37927862 37927864 37927865 37928127 37928137 37928159 37928160 37928161 38492559 38492560 38492561 38492562 38492608 38492609 38492610 38492611 38492658 38492659 38492660 38492661 38492688 38492689 38492690 38492691 38492692 38492693 38492694 38492695 38492696 38492697 38492698 38492699 38492700 38492701 38492702 38492703 38492740 38492741 38492742 38492743 38492744 38492745 38492746 38492747 38492748 38492749 38492750 38492751 38492753 38492754 38492874 38492875 38492892 38492893 38492894 38492895 38492896 38492897 38492899 38492900 38493067 38493068 38493069 38493070 39654046 39654047 39654302 39654303 39654304 39654305 39654326 39654456 39654756 39654757 39654758 39654759 39654760 39654828 39655044 40889048 40889049 40889054 40889055 40889056 40889057 40889209 40889210 40889211 40889212 40889213 40889214 40889215 40889216 40889217 40889218 40889219 40889220 40889221 40889222 40889223 40889224 40889225 40889226 40889227 40889228 40889229 40889230 40889231 40889232 40889233 40889234 40889235 40889236 40889309 40889349 40889422 40889423 40889424 40889425 40889426 40889427 40889446 40889610 40889611 40889612 40889613 40889699 40889700 40889701 40889702 40889703 40889704 40889712 40889713 40889714 40889715 40889881 40889882 40889941 40889942 40889943 40889952 40889953 40889954 40889995 40889996 40889997 40889998 40889999 40890000 40890012 40890021 40890022 40890023 42543246 42543283 42543284 42543285 42543286 42543287 42543288 42543289 42543290 42543295 42543296 42543350 42543351 42543352 42543353 42543361 42543362 42543363 42543364 42543365 42543366 42543367 42543368 42543369 42543370 42543371 42543372 42543373 42543374 42543375 42543376 42543472 42543473 42543503 42543504 42543505 42543506 42543507 42543565 42543699 42543730 42543731 42543881 42543904 42543909 42543910 46014981 46014982 46014983 46014984 46014985 46014986 46014987 46014988 46014989 46014990 46014991 46014992 46014993 46014994 46014995 46014996 46014997 46014998 46014999 46015000 46015001 46015002 46015003 46015004 46015005 46015006 46015007 46015030 46015188 46015189 46015190 46015191 46015192 46015201 46015202 46015203 46015204 46015205 46015206 46015211 46015212 46015213 46015214 46015215 46015216 46015322 46015370 46015415 46015416 46015417 46015418 46015419 46015420 46015421 46015422 46015423 46015424 46015425 46015454 46015457 46015458 46015459 46015496 46015497 46015498 46015499 46015523 46015542 46015558 46015559 46015560 46015561 46015618 46015619 46015620 46015621 46015750 46015751 46015780 46015781 46015782 46015783 46015784 46015785 46015786 46015787 46015788 46015789 46015797 46015820 47168572 47168712 47168786 47168787 47168789 47168887 47168898 47168960 47168961 47168962 47168963 47169015 47169016 47169017 47169018 47169019 47169020 47169021 47169022 47169023 47169080 47169084 47169137 47169138 47169139 47169140 47169141 47169156 47169157 47169158 47169159 47169234 47169235 47169236 47169237 47169244 47169263 47169264 47169285 47169286 47169287 47169288 47169307 47169340 47169341 47169342 47169343 47169395 47169396 47169397 47169398 47169399 47169400 47169401 47169402 47169403 47169404 47169405 47169422 47169423 47169424 47169425 47169448 47169449 48425192 48425293 48425310 48425311 48425314 48425315 48425316 48425317 48425318 48425319 48425320 48425321 48425322 48425323 48425324 48425325 48425326 48425327 48425328 48425401 48425402 48425403 48425525 48425526 48425527 48425528 48425529 48425530 48425544 48425583 48425584 48425585 48425586 48425587 48425588 48425717 48425784 48425785 48425786 48425787 48425788 48425789 48425790 48425791 48425792 48425793 48425799 48425800 48425837 48425885 48425924 48425925 49258343 49258344 49258467 49258468 49258469 49258470 49258477 49258478 49258494 49258570 49258571 49258572 49258573 49258574 49258575 49258576 49258577 49258578 49258579 49258580 49258581 49258605 49258606 49258607 49258608 49258609 49258610 49258611 49258612 49258613 49258614 49258615 49258616 49258617 49258618 49258619 49258620 49258756 49258778 49258971 49258972 49258973 49258974 49258975 49259037 49259038 49259039 49259040 49259041 49259042 49259055 49259056 49259057 49259058 49259059 49259060 49259061 49259062 49259063 49259064 49259065 49259066 49259182 49259183 49259229 49259230 49259231 49259316 49259331 49259332 49259333 49259334 49259382 49259383 49259391 49259392 49259449 49259486 49259562 50513261 50513424 50513425 50513587 50513588 50513600 50513700 50513701 50513708 50513709 50513735 50513737 50513738 50513739 50513740 50513741 50513742 50513743 50513744 50513745 50513746 50513748 50513749 50513750 50513751 50513752 50513753 50513784 50513785 50513992 50513993 50514017 50514018 50514019 50514020 50514021 50514024 50514075 50514076 51247099 51247100 51247101 51247102 51247103 51247104 51247105 51247106 51247107 51247108 51247109 51247110 51247135 51247136 51247205 51247222 51247223 51247250 51247251 51247290 51247346 51247402 51247403 51247418 51247419 51247420 51247421 51247460 51247551 51247552 51247564 51247565 51247626 51247627 51247732 51247733 51247734 51247735 51247738 51247739 51247740 51247741 51247746 51247747 51247748 51247749 51247751 51247752 51247848 51247849 51247853 51247854 51247866 51247867 51247868 51247878 51247879 51247880 51247881 51247897 51247969 51247970 51247971 51247972 51247973 51247974 51247975 51247976 51247977 51247978 51247979 51247980 51247981 51247982 51248010 52695345 52695346 52695377 52695378 52695379 52695433 52695434 52695435 52695436 52695451 52695452 52695523 52695524 52695525 52695526 52695527 52695528 52695575 52695576 52695577 52695578 52695849 52695852 52695958 52695960 52695961 52695962 52695963 52695966 52695967 52695995 52695996 52695997 52695998 52696004 52696005 52696010 52696045 52696047 52696067 52696104 52696105 52696106 52696111 52696112 52696121 52696133 52696134 52696139 52696140 52696141 52696142 52696203 52696204 52696205 52696206 52696207 52696208 52696260 52696261 52696270 55669560 55669561 55669630 55669667 55669668 55669669 55669670 55669671 55669672 55669673 55669674 55669675 55669676 55669677 55669678 55669679 55669680 55669760 55669761 55669762 55669763 55669821 55669822 55669823 55669824 55669825 55669826 55669827 55669828 55669841 55669913 55670081 55670082 55670331 55670332 55670333 55670334 55670356 55670357 55670358 55670359 55670402 55670403 55670404 55670405 55670416 55670417 55670426 55670460 55670461 55670489 55670575 55670576 55670577 55670734 55670735 55670736 55670737 55670738 56553615 56553624 56553625 56553644 56553645 56554050 56554051 56554060 56554061 56554062 56554063 56554162 56554232 56554233 56554234 56554235 56554236 56554237 56554321 56554363 56554364 56554365 56554366 56554367 56554368 56554454 56554455 56554456 56554463 56554566 56554567 56554568 56554569 56554570 56554571 56554677 56554678 56554679 56554680 56554699 56554702 56554725 56554726 56965911 56965912 56965913 56965914 56965915 56965916 56965917 56965918 56965919 56965920 56965923 56965924 56965925 56965926 56965927 56965928 56965929 56965930 56965931 56965932 56965937 56965938 56965987 56965988 56965989 56965990 56965991 56965992 56965993 56965994 56965995 56965996 56965997 56965998 56966000 56966001 56966002 56966012 56966013 56966069 56966071 56966072 56966073 56966107 56966108 56966109 56966110 56966111 56966112 56966113 56966114 56966115 56966116 56966121 56966122 56966123 56966124 56966125 56966126 56966127 56966128 56966129 56966130 56966131 56966132 56966133 56966134 56966135 56966136 56966137 56966138 56966139 56966140 56966141 56966142 56966143 56966144 56966145 56966146 56966147 56966148 56966149 56966150 56966151 56966152 56966153 56966154 56966155 56966156 56966157 56966158 56966159 56966160 56966182 56966213 56966214 56966215 56966216 56966217 56966218 56966219 56966220 56966221 56966222 56966223 56966225 56966226 56966227 56966228 56966229 56966230 56966314 56966315 56966316 56966612 56966613 56966614 56966615 56966616 56966617 56966626 56966627 56966628 56966629 56966630 56966631 56966680 56966856 56967028 56967138 56967139 56967140 56967141 56967142 56967143 56967174 56967175 56967176 56967177 56967178 56967179 56967180 56967181 56967182 56967183 56967184 56967185 56967186 56967187 56967188 56967189 56967197 56967198 56967199 56967200 56967222 56967223 56967239 56967283 58176820 58176821 58176822 58176848 58176870 58176871 58176872 58176878 58176879 58176880 58176911 58176912 58176913 58176914 58176936 58176937 58176938 58176939 58176940 58176941 58176942 58176943 58177056 58177057 58177058 58177059 58177144 58177145 58177146 58177147 58177148 58177149 58177150 58177151 58177152 58177153 58177154 58177155 58177156 58177157 58177158 58177159 58177164 58177165 58177166 58177167 58177168 58177169 58177170 58177171 58177172 58177173 58177174 58177175 58177184 58177185 58177238 58177239 58177240 58177241 58177292 58177293 58177294 58177295 58177296 58177297 58177298 58177299 58177366 58177447 58177448 58177449 58177450 58177547 58177583 58177584 58177585 60593446 60593465 60593466 60593467 60593468 60593469 60593470 60593548 60593549 60593551 60593552 60593714 60593715 60593716 60593717 60593733 60593734 60593775 60593791 60593792 60593793 60593794 60593823 60593826 60593827 60593828 60593867 60593882 60593908 60593909 60593910 60593911 60593912 60593913 60593916 60593917 60593980 60594102 60594103 60594104 60594105 60594134 60594135 60594136 60594334 60594335 60594336 60594337 60594338 60594346 60594373 60594374 60594375 60594411 60594412 60594475 60594476 61679444 61679445 61679446 61679447 61679448 61679449 61679450 61679451 61679452 61679453 61679454 61679455 61679461 61679462 61679463 61679464 61679465 61679466 61679467 61679468 61679469 61679470 61679471 61679472 61679502 61679503 61679504 61679505 61679506 61679507 61679508 61679509 61679510 61679511 61679512 61679513 61679514 61679515 61679516 61679517 61679518 61679519 61679520 61679521 61679522 61679523 61679524 61679525 61679526 61679527 61679565 61679566 61679567 61679568 61679618 61679619 61679782 61679783 61679784 61679785 61679786 61679787 61679788 61679789 61679790 61679791 61679792 61679793 61680034 61680035 61680155 61680156 61680157 61680158 61680159 61680160 61680161 61680162 61680167 61680168 61680173 61680174 61680175 61680176 61680193 61680194 61680214 61680276 61680277 61680278 61680279 61680280 61680370 61680371 61680372 61680373 61680374 61680375 61680404 61680405 61680508 61680545 61680546 61680547 61680548 61680571 61680572 61680573 61680574 61680575 61680576 61680577 61680578 61680624 61680625 61680639 61680640 61680681 61680682 61680683 61680692 61680693 61680730 61680864 61680866 61680867 61680889 61680890 61680891 61680895 62737945 62737992 62737993 62737994 62737995 62737996 62737997 62738111 62738112 62738130 62738131 62738152 62738153 62738154 62738155 62738156 62738157 62738177 62738371 62738372 62738373 62738384 62738385 62738401 62738402 62738403 62738404 62738501 62738502 62738503 62738505 62738506 62738645 62738646 62738647 62738648 62738649 62738650 62738651 62738652 62738653 62738680 62738681 62738682 62738683 62738684 62738685 62738686 62738687 62738688 62738689 62738690 62738691 62738704 62738705 62738706 62738707 62738708 62738709 62738710 62738711 62738712 62738713 62738714 62738715 62738746 62738751 62738752 62738753 62738754 62738886 62738896 62738911 62738958 62738959 62739016 62739017 62739018 62739019 62739020 62739021 66360233 66360234 66360235 66360236 66360237 66360238 66360239 66360240 66360241 66360242 66360243 66360244 66360287 66360309 66360310 66360405 66360406 66360407 66360408 66360451 66360452 66360453 66360454 66360455 66360456 66360457 66360458 66360459 66360460 66360461 66360462 66360465 66360466 66360467 66360468 66360469 66360470 66360471 66360472 66360473 66360474 66360475 66360476 66360479 66360480 66360481 66360482 66360483 66360484 66360485 66360486 66360487 66360488 66360489 66360490 66360493 66360494 66360495 66360496 66360497 66360498 66360499 66360500 66360501 66360502 66360503 66360504 66360507 66360508 66360509 66360510 66360511 66360512 66360513 66360514 66360515 66360516 66360517 66360518 66360519 66360520 66360521 66360522 66360523 66360524 66360525 66360526 66360527 66360528 66360529 66360530 66360564 66360565 66360566 66360631 66360632 66360633 66360634 66360635 66360636 66360637 66360638 66360639 66360640 66360641 66360642 66361120 66361141 66361211 66361219 66361235 66361238 66361239 66361240 66361241 66361242 66361243 66361246 66361251 66361252 66361253 66361279 66361280 66361281 66361282 66361285 66361286 66361289 66361290 66361291 66361292 66361317 66361318 66361347 66361348 66361358 66361359 66361360 66361367 66361407 66361475 66361476 66361544 66361545 66361546 66361547 66361548 66361549 66361550 66361551 66361552 66361553 66361575 66361576 66361579 66361580 66361773 66361774 67463836 67463837 67463838 67463839 67463840 67463870 67463871 67463872 67463873 67463876 67463877 67463878 67463879 67463880 67463893 67463894 67463897 67463898 67463899 67463900 67463908 67463909 67463918 67463976 67464020 67464021 67464022 67464023 67464024 67464025 67464026 67464027 67464135 67464136 67464162 67464163 67464173 67464392 67464401 67464402 67464403 67464404 67464423 67464428 67464429 67464430 67464431 67464432 67464433 67464490 67464491 67464618 71041608 71041609 71041610 71041612 71041613 71041614 71041615 71041770 71041771 71041828 71041829 71041879 71041942 71041945 71041946 71041947 71041948 71041977 71041981 71041982 71041983 71042030 71042031 71042032 71042033 71042057 71042058 71042059 71042060 71042061 71042063 71042064 71042065 71042066 71042067 71042068 71042163 71042176 71042177 71042178 71042179 71042230 71042231 71042232 71042233 71042234 71042235 71042236 71042237 71042333 71042461 71042462 71042463 71042509 71042510 71042541 71042542 71042543 71042544 71042545 71042546 71042556 71042557 71042558 71042559 71042560 71042561 71042562 71042563 71042564 71042565 71042755 71042756 71042798 71042799 73535259 73535260 73535278 73535279 73535280 73535281 73535366 73535399 73535400 73535478 73535489 73535682 73535726 73535727 73536113 73536172 73536173 73536195 73536196 73536291 73536292 73536296 73536297 73536298 73536299 73536300 73536301 73536302 73536303 73536308 73536309 73536310 73536311 73536318 73536319 73536320 73536321 73536322 73536323 75766453 75766454 > 1421154 1421157 1421595 1421596 1421597 1421598 1431736 1942955 1942957 1942959 3212591 4389477 5107545 5107546 5107657 6137709 6137711 6573339 7245471 7245971 7245972 8569294 8569296 8569570 9257071 9257072 10121058 12084717 12084718 14278375 14278376 14719543 14719545 14719701 14719704 15826585 15826586 15988144 15988145 20664143 20664144 20664145 20664146 20664147 20664148 20664149 20664150 21466022 21466023 24158835 24158836 24987339 27065080 27065081 27065082 27065083 27065084 27065085 27065086 27065087 27065088 27065089 27065090 27065091 27065725 27065726 27065727 28948388 28948389 28948744 28948745 28948748 28948749 29726595 29726596 30749807 30749809 31615440 46015455 46015524 46015543 46015622 46015623 46015624 46015625 46015626 46015627 46015628 46015629 46015630 46015631 46015632 46015633 46015790 46015791 47169081 47169082 47169083 47169085 47169086 47169087 52696113 52696114 52696271 52696272 56554700 56554701 56965921 56965922 56965933 56965934 56965935 56966181 56966632 56966633 56967029 56967030 56967031 61679456 61679457 61679458 61679473 61679474 61679475 61679528 61679529 71042334 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00002 > 5957 1 > 1 12 8 1 13 8 10 15 5 2 14 8 2 15 8 7 3 5 4 14 8 4 5 8 4 6 8 5 12 8 6 13 8 6 15 8 8 16 6 9 17 6 $$$$