data_bmse010126 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010126 _Entry.Title S_b_S_r_S_acetate _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2009-09-01 _Entry.Last_release_date 2012-09-13 _Entry.Original_release_date 2010-02-08 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name S_b_S_r_S_acetate loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.First_initial _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Susana Luque S. ? ? bmse010126 2 John Ralph ? ? ? bmse010126 3 Sally Ralph ? ? ? bmse010126 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010126 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010126 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 123 bmse010126 "1H chemical shifts" 11 bmse010126 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2010-02-08 2009-05-26 original Author "Original spectra from USDA" bmse010126 2 2010-12-01 2010-12-01 update BMRB "Set correct NMR STAR version" bmse010126 3 2011-04-04 2011-04-04 update BMRB "Added Provenance tag to chem_comp" bmse010126 4 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010126 5 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010126 6 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010126 7 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010126 8 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010126 9 2012-09-13 2012-09-13 update BMRB "Added PubChem SID 111678003 to database loop" bmse010126 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010126 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010126 1 2 John Ralph ? ? ? bmse010126 1 3 Larry Landucci ? L. ? bmse010126 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010126 _Assembly.ID 1 _Assembly.Name 'S-b-S-r-S (acetate)' _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 S-b-S-r-S-(acetate) 1 $S-b-S-r-S-(acetate) yes native no no ? ? ? bmse010126 1 stop_ save_ save_S-b-S-r-S-(acetate) _Entity.Sf_category entity _Entity.Sf_framecode S-b-S-r-S-(acetate) _Entity.Entry_ID bmse010126 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'S-b-S-r-S (acetate)' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010126 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010126 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $S-b-S-r-S-(acetate) . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010126 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010126 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $S-b-S-r-S-(acetate) . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010126 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010126 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name 'S-b-S-r-S (acetate)' _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C41H48O17/c1-20(42)52-19-35(38(55-21(2)43)26-15-31(48-7)40(57-23(4)45)32(16-26)49-8)58-41-33(50-9)13-25(14-34(41)51-10)37-28-18-53-36(27(28)17-54-37)24-11-29(46-5)39(56-22(3)44)30(12-24)47-6/h11-16,27-28,35-38H,17-19H2,1-10H3 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C41 H48 O17' _Chem_comp.Formula_weight 812.80962 _Chem_comp.Formula_mono_iso_wt_nat 812.2891501165 _Chem_comp.Formula_mono_iso_wt_13C 853.4266984663 _Chem_comp.Formula_mono_iso_wt_15N 812.2891501165 _Chem_comp.Formula_mono_iso_wt_13C_15N 853.4266984663 _Chem_comp.Image_file_name standards/S_b_S_r_S_acetate/lit/jr_199.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/S_b_S_r_S_acetate/lit/jr_199.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "S-b-S-r-S (acetate)" synonym bmse010126 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "S-b-S-r-S (acetate)" "Lignin abbreviation" bmse010126 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical ; CC(=O)OCC(C(C1=CC(=C(C(=C1)OC)OC(C)=O)OC)OC(C)=O)OC2=C(C=C(C=C2OC)C5C4COC(C3=CC(=C(C(=C3)OC)OC(C)=O)OC)C4CO5)OC ; bmse010126 1 Isomeric ; CC(=O)OCC(C(C1=CC(=C(C(=C1)OC)OC(C)=O)OC)OC(C)=O)OC2=C(C=C(C=C2OC)C5C4COC(C3=CC(=C(C(=C3)OC)OC(C)=O)OC)C4CO5)OC ; bmse010126 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 AcMe C ? ? ? ? 201.7050 216.4225 ? ? ? bmse010126 1 C2 AcMe C ? ? ? ? 269.8950 356.8675 ? ? ? bmse010126 1 C3 AcMe C ? ? ? ? 417.9725 7.5400 ? ? ? bmse010126 1 C4 AcMe C ? ? ? ? 114.1700 345.7000 ? ? ? bmse010126 1 C5 OMe C ? ? ? ? 435.8300 92.2800 ? ? ? bmse010126 1 C6 OMe C ? ? ? ? 312.3550 51.9250 ? ? ? bmse010126 1 C7 OMe C ? ? ? ? 137.3475 274.3700 ? ? ? bmse010126 1 C8 OMe C ? ? ? ? 196.5350 372.4600 ? ? ? bmse010126 1 C9 OMe C ? ? ? ? 226.1575 211.2225 ? ? ? bmse010126 1 C10 OMe C ? ? ? ? 349.7050 251.3650 ? ? ? bmse010126 1 C11 C2 C ? ? ? ? 386.9050 102.5925 ? ? ? bmse010126 1 C12 C6 C ? ? ? ? 345.7475 89.1400 ? ? ? bmse010126 1 C13 B2 C ? ? ? ? 275.0650 200.8275 ? ? ? bmse010126 1 C14 B6 C ? ? ? ? 316.2475 214.2075 ? ? ? bmse010126 1 C15 A2 C ? ? ? ? 202.9825 282.5525 ? ? ? bmse010126 1 C16 A6 C ? ? ? ? 211.9850 324.9075 ? ? ? bmse010126 1 C17 CG C ? ? ? ? 307.2450 131.4025 ? ? ? bmse010126 1 C18 BG C ? ? ? ? 354.6775 171.7475 ? ? ? bmse010126 1 C19 G C ? ? ? ? 235.1600 253.5775 ? ? ? bmse010126 1 C20 AcC=O C ? ? ? ? 193.9800 240.1975 ? ? ? bmse010126 1 C21 AcC=O C ? ? ? ? 253.1675 338.2875 ? ? ? bmse010126 1 C22 AcC=O C ? ? ? ? 410.2050 31.3025 ? ? ? bmse010126 1 C23 AcC=O C ? ? ? ? 138.6225 340.5000 ? ? ? bmse010126 1 C24 C1 C ? ? ? ? 362.4425 107.7475 ? ? ? bmse010126 1 C25 B1 C ? ? ? ? 299.5200 195.6300 ? ? ? bmse010126 1 C26 A1 C ? ? ? ? 219.7100 301.1325 ? ? ? bmse010126 1 C27 CB C ? ? ? ? 331.0200 139.1275 ? ? ? bmse010126 1 C28 BB C ? ? ? ? 331.0200 164.1275 ? ? ? bmse010126 1 C29 C3 C ? ? ? ? 394.6725 78.8275 ? ? ? bmse010126 1 C30 C5 C ? ? ? ? 353.5125 65.3775 ? ? ? bmse010126 1 C31 A3 C ? ? ? ? 178.5275 287.7500 ? ? ? bmse010126 1 C32 A5 C ? ? ? ? 187.5300 330.1050 ? ? ? bmse010126 1 C33 B3 C ? ? ? ? 267.3400 224.6050 ? ? ? bmse010126 1 C34 B5 C ? ? ? ? 308.5225 237.9850 ? ? ? bmse010126 1 C35 B C ? ? ? ? 251.8900 272.1575 ? ? ? bmse010126 1 C36 CA C ? ? ? ? 354.6775 131.5100 ? ? ? bmse010126 1 C37 BA C ? ? ? ? 307.2450 171.8525 ? ? ? bmse010126 1 C38 A C ? ? ? ? 244.1650 295.9325 ? ? ? bmse010126 1 C39 C4 C ? ? ? ? 377.9775 60.2200 ? ? ? bmse010126 1 C40 A4 C ? ? ? ? 170.8025 311.5275 ? ? ? bmse010126 1 C41 B4 C ? ? ? ? 284.0675 243.1825 ? ? ? bmse010126 1 O42 ? O ? ? ? ? 169.5250 245.3950 ? ? ? bmse010126 1 O43 ? O ? ? ? ? 228.7125 343.4875 ? ? ? bmse010126 1 O44 ? O ? ? ? ? 426.9025 49.9100 ? ? ? bmse010126 1 O45 ? O ? ? ? ? 155.3525 359.0800 ? ? ? bmse010126 1 O46 ? O ? ? ? ? 419.1350 73.6725 ? ? ? bmse010126 1 O47 ? O ? ? ? ? 336.8175 46.7700 ? ? ? bmse010126 1 O48 ? O ? ? ? ? 161.8000 269.1725 ? ? ? bmse010126 1 O49 ? O ? ? ? ? 179.8050 353.8825 ? ? ? bmse010126 1 O50 ? O ? ? ? ? 242.8875 229.8025 ? ? ? bmse010126 1 O51 ? O ? ? ? ? 325.2500 256.5625 ? ? ? bmse010126 1 O52 ? O ? ? ? ? 210.7075 258.7775 ? ? ? bmse010126 1 O53 ? O ? ? ? ? 369.2675 151.6275 ? ? ? bmse010126 1 O54 ? O ? ? ? ? 292.5500 151.6275 ? ? ? bmse010126 1 O55 ? O ? ? ? ? 260.8925 314.5125 ? ? ? bmse010126 1 O56 ? O ? ? ? ? 385.7425 36.4575 ? ? ? bmse010126 1 O57 ? O ? ? ? ? 146.3500 316.7250 ? ? ? bmse010126 1 O58 ? O ? ? ? ? 276.3425 266.9600 ? ? ? bmse010126 1 H59 ? H ? ? ? ? 186.9636 211.6327 ? ? ? bmse010126 1 H60 ? H ? ? ? ? 206.4948 201.6811 ? ? ? bmse010126 1 H61 ? H ? ? ? ? 216.4464 221.2123 ? ? ? bmse010126 1 H62 ? H ? ? ? ? 281.4143 346.4966 ? ? ? bmse010126 1 H63 ? H ? ? ? ? 280.2658 368.3868 ? ? ? bmse010126 1 H64 ? H ? ? ? ? 258.3756 367.2383 ? ? ? bmse010126 1 H65 ? H ? ? ? ? 403.2397 2.7241 ? ? ? bmse010126 1 H66 ? H ? ? ? ? 422.7884 -7.1929 ? ? ? bmse010126 1 H67 ? H ? ? ? ? 432.7054 12.3559 ? ? ? bmse010126 1 H68 ? H ? ? ? ? 117.3941 360.8610 ? ? ? bmse010126 1 H69 ? H ? ? ? ? 99.0090 348.9241 ? ? ? bmse010126 1 H70 ? H ? ? ? ? 110.9459 330.5390 ? ? ? bmse010126 1 H71 ? H ? ? ? ? 447.3670 81.9288 ? ? ? bmse010126 1 H72 ? H ? ? ? ? 446.1812 103.8170 ? ? ? bmse010126 1 H73 ? H ? ? ? ? 424.2930 102.6312 ? ? ? bmse010126 1 H74 ? H ? ? ? ? 315.5511 67.0919 ? ? ? bmse010126 1 H75 ? H ? ? ? ? 297.1881 55.1211 ? ? ? bmse010126 1 H76 ? H ? ? ? ? 309.1589 36.7581 ? ? ? bmse010126 1 H77 ? H ? ? ? ? 140.5701 289.5313 ? ? ? bmse010126 1 H78 ? H ? ? ? ? 122.1862 277.5926 ? ? ? bmse010126 1 H79 ? H ? ? ? ? 134.1249 259.2087 ? ? ? bmse010126 1 H80 ? H ? ? ? ? 208.0529 362.0875 ? ? ? bmse010126 1 H81 ? H ? ? ? ? 206.9075 383.9779 ? ? ? bmse010126 1 H82 ? H ? ? ? ? 185.0171 382.8325 ? ? ? bmse010126 1 H83 ? H ? ? ? ? 214.6389 221.5942 ? ? ? bmse010126 1 H84 ? H ? ? ? ? 215.7858 199.7039 ? ? ? bmse010126 1 H85 ? H ? ? ? ? 237.6761 200.8508 ? ? ? bmse010126 1 H86 ? H ? ? ? ? 346.4827 236.2036 ? ? ? bmse010126 1 H87 ? H ? ? ? ? 364.8663 248.1427 ? ? ? bmse010126 1 H88 ? H ? ? ? ? 352.9273 266.5264 ? ? ? bmse010126 1 H89 2 H ? ? ? ? 397.2564 114.1293 ? ? ? bmse010126 1 H90 6 H ? ? ? ? 330.5807 92.3365 ? ? ? bmse010126 1 H91 2 H ? ? ? ? 264.6935 189.3088 ? ? ? bmse010126 1 H92 6 H ? ? ? ? 331.4087 210.9846 ? ? ? bmse010126 1 H93 ? H ? ? ? ? 207.7729 267.8113 ? ? ? bmse010126 1 H94 2 H ? ? ? ? 222.3564 336.4264 ? ? ? bmse010126 1 H95 6 H ? ? ? ? 293.8217 123.6523 ? ? ? bmse010126 1 H96 ? H ? ? ? ? 313.5495 117.2426 ? ? ? bmse010126 1 H97 ? H ? ? ? ? 368.1122 179.4779 ? ? ? bmse010126 1 H98 ? H ? ? ? ? 348.4015 185.9201 ? ? ? bmse010126 1 H99 ? H ? ? ? ? 229.3526 239.2065 ? ? ? bmse010126 1 H100 ? H ? ? ? ? 248.3044 245.3632 ? ? ? bmse010126 1 H101 CB H ? ? ? ? 331.0406 123.6275 ? ? ? bmse010126 1 H102 BB H ? ? ? ? 331.0398 179.6275 ? ? ? bmse010126 1 H103 ? H ? ? ? ? 256.6797 257.4161 ? ? ? bmse010126 1 H104 CA H ? ? ? ? 369.9897 129.1046 ? ? ? bmse010126 1 H105 BA H ? ? ? ? 291.9359 174.2776 ? ? ? bmse010126 1 H106 A H ? ? ? ? 259.3264 292.7103 ? ? ? bmse010126 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010126 1 C2 C2 BMRB bmse010126 1 C3 C3 BMRB bmse010126 1 C4 C4 BMRB bmse010126 1 C5 C5 BMRB bmse010126 1 C6 C6 BMRB bmse010126 1 C7 C7 BMRB bmse010126 1 C8 C8 BMRB bmse010126 1 C9 C9 BMRB bmse010126 1 C10 C10 BMRB bmse010126 1 C11 C11 BMRB bmse010126 1 C12 C12 BMRB bmse010126 1 C13 C13 BMRB bmse010126 1 C14 C14 BMRB bmse010126 1 C15 C15 BMRB bmse010126 1 C16 C16 BMRB bmse010126 1 C17 C17 BMRB bmse010126 1 C18 C18 BMRB bmse010126 1 C19 C19 BMRB bmse010126 1 C20 C20 BMRB bmse010126 1 C21 C21 BMRB bmse010126 1 C22 C22 BMRB bmse010126 1 C23 C23 BMRB bmse010126 1 C24 C24 BMRB bmse010126 1 C25 C25 BMRB bmse010126 1 C26 C26 BMRB bmse010126 1 C27 C27 BMRB bmse010126 1 C28 C28 BMRB bmse010126 1 C29 C29 BMRB bmse010126 1 C30 C30 BMRB bmse010126 1 C31 C31 BMRB bmse010126 1 C32 C32 BMRB bmse010126 1 C33 C33 BMRB bmse010126 1 C34 C34 BMRB bmse010126 1 C35 C35 BMRB bmse010126 1 C36 C36 BMRB bmse010126 1 C37 C37 BMRB bmse010126 1 C38 C38 BMRB bmse010126 1 C39 C39 BMRB bmse010126 1 C40 C40 BMRB bmse010126 1 C41 C41 BMRB bmse010126 1 O42 O42 BMRB bmse010126 1 O43 O43 BMRB bmse010126 1 O44 O44 BMRB bmse010126 1 O45 O45 BMRB bmse010126 1 O46 O46 BMRB bmse010126 1 O47 O47 BMRB bmse010126 1 O48 O48 BMRB bmse010126 1 O49 O49 BMRB bmse010126 1 O50 O50 BMRB bmse010126 1 O51 O51 BMRB bmse010126 1 O52 O52 BMRB bmse010126 1 O53 O53 BMRB bmse010126 1 O54 O54 BMRB bmse010126 1 O55 O55 BMRB bmse010126 1 O56 O56 BMRB bmse010126 1 O57 O57 BMRB bmse010126 1 O58 O58 BMRB bmse010126 1 H59 H59 BMRB bmse010126 1 H60 H60 BMRB bmse010126 1 H61 H61 BMRB bmse010126 1 H62 H62 BMRB bmse010126 1 H63 H63 BMRB bmse010126 1 H64 H64 BMRB bmse010126 1 H65 H65 BMRB bmse010126 1 H66 H66 BMRB bmse010126 1 H67 H67 BMRB bmse010126 1 H68 H68 BMRB bmse010126 1 H69 H69 BMRB bmse010126 1 H70 H70 BMRB bmse010126 1 H71 H71 BMRB bmse010126 1 H72 H72 BMRB bmse010126 1 H73 H73 BMRB bmse010126 1 H74 H74 BMRB bmse010126 1 H75 H75 BMRB bmse010126 1 H76 H76 BMRB bmse010126 1 H77 H77 BMRB bmse010126 1 H78 H78 BMRB bmse010126 1 H79 H79 BMRB bmse010126 1 H80 H80 BMRB bmse010126 1 H81 H81 BMRB bmse010126 1 H82 H82 BMRB bmse010126 1 H83 H83 BMRB bmse010126 1 H84 H84 BMRB bmse010126 1 H85 H85 BMRB bmse010126 1 H86 H86 BMRB bmse010126 1 H87 H87 BMRB bmse010126 1 H88 H88 BMRB bmse010126 1 H89 H89 BMRB bmse010126 1 H90 H90 BMRB bmse010126 1 H91 H91 BMRB bmse010126 1 H92 H92 BMRB bmse010126 1 H93 H93 BMRB bmse010126 1 H94 H94 BMRB bmse010126 1 H95 H95 BMRB bmse010126 1 H96 H96 BMRB bmse010126 1 H97 H97 BMRB bmse010126 1 H98 H98 BMRB bmse010126 1 H99 H99 BMRB bmse010126 1 H100 H100 BMRB bmse010126 1 H101 H101 BMRB bmse010126 1 H102 H102 BMRB bmse010126 1 H103 H103 BMRB bmse010126 1 H104 H104 BMRB bmse010126 1 H105 H105 BMRB bmse010126 1 H106 H106 BMRB bmse010126 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C20 ? bmse010126 1 2 covalent SING C2 C21 ? bmse010126 1 3 covalent SING C3 C22 ? bmse010126 1 4 covalent SING C4 C23 ? bmse010126 1 5 covalent SING C5 O46 ? bmse010126 1 6 covalent SING C6 O47 ? bmse010126 1 7 covalent SING C7 O48 ? bmse010126 1 8 covalent SING C8 O49 ? bmse010126 1 9 covalent SING C9 O50 ? bmse010126 1 10 covalent SING C10 O51 ? bmse010126 1 11 covalent DOUB C11 C24 ? bmse010126 1 12 covalent SING C11 C29 ? bmse010126 1 13 covalent SING C12 C24 ? bmse010126 1 14 covalent DOUB C12 C30 ? bmse010126 1 15 covalent DOUB C13 C25 ? bmse010126 1 16 covalent SING C13 C33 ? bmse010126 1 17 covalent SING C14 C25 ? bmse010126 1 18 covalent DOUB C14 C34 ? bmse010126 1 19 covalent DOUB C15 C26 ? bmse010126 1 20 covalent SING C15 C31 ? bmse010126 1 21 covalent SING C16 C26 ? bmse010126 1 22 covalent DOUB C16 C32 ? bmse010126 1 23 covalent SING C17 C27 ? bmse010126 1 24 covalent SING C17 O54 ? bmse010126 1 25 covalent SING C18 C28 ? bmse010126 1 26 covalent SING C18 O53 ? bmse010126 1 27 covalent SING C19 C35 ? bmse010126 1 28 covalent SING C19 O52 ? bmse010126 1 29 covalent DOUB C20 O42 ? bmse010126 1 30 covalent SING C20 O52 ? bmse010126 1 31 covalent DOUB C21 O43 ? bmse010126 1 32 covalent SING C21 O55 ? bmse010126 1 33 covalent DOUB C22 O44 ? bmse010126 1 34 covalent SING C22 O56 ? bmse010126 1 35 covalent DOUB C23 O45 ? bmse010126 1 36 covalent SING C23 O57 ? bmse010126 1 37 covalent SING C24 C36 ? bmse010126 1 38 covalent SING C25 C37 ? bmse010126 1 39 covalent SING C26 C38 ? bmse010126 1 40 covalent SING C27 C28 ? bmse010126 1 41 covalent SING C27 C36 ? bmse010126 1 42 covalent SING C28 C37 ? bmse010126 1 43 covalent DOUB C29 C39 ? bmse010126 1 44 covalent SING C29 O46 ? bmse010126 1 45 covalent SING C30 C39 ? bmse010126 1 46 covalent SING C30 O47 ? bmse010126 1 47 covalent DOUB C31 C40 ? bmse010126 1 48 covalent SING C31 O48 ? bmse010126 1 49 covalent SING C32 C40 ? bmse010126 1 50 covalent SING C32 O49 ? bmse010126 1 51 covalent DOUB C33 C41 ? bmse010126 1 52 covalent SING C33 O50 ? bmse010126 1 53 covalent SING C34 C41 ? bmse010126 1 54 covalent SING C34 O51 ? bmse010126 1 55 covalent SING C35 C38 ? bmse010126 1 56 covalent SING C35 O58 ? bmse010126 1 57 covalent SING C36 O53 ? bmse010126 1 58 covalent SING C37 O54 ? bmse010126 1 59 covalent SING C38 O55 ? bmse010126 1 60 covalent SING C39 O56 ? bmse010126 1 61 covalent SING C40 O57 ? bmse010126 1 62 covalent SING C41 O58 ? bmse010126 1 63 covalent SING C1 H59 ? bmse010126 1 64 covalent SING C1 H60 ? bmse010126 1 65 covalent SING C1 H61 ? bmse010126 1 66 covalent SING C2 H62 ? bmse010126 1 67 covalent SING C2 H63 ? bmse010126 1 68 covalent SING C2 H64 ? bmse010126 1 69 covalent SING C3 H65 ? bmse010126 1 70 covalent SING C3 H66 ? bmse010126 1 71 covalent SING C3 H67 ? bmse010126 1 72 covalent SING C4 H68 ? bmse010126 1 73 covalent SING C4 H69 ? bmse010126 1 74 covalent SING C4 H70 ? bmse010126 1 75 covalent SING C5 H71 ? bmse010126 1 76 covalent SING C5 H72 ? bmse010126 1 77 covalent SING C5 H73 ? bmse010126 1 78 covalent SING C6 H74 ? bmse010126 1 79 covalent SING C6 H75 ? bmse010126 1 80 covalent SING C6 H76 ? bmse010126 1 81 covalent SING C7 H77 ? bmse010126 1 82 covalent SING C7 H78 ? bmse010126 1 83 covalent SING C7 H79 ? bmse010126 1 84 covalent SING C8 H80 ? bmse010126 1 85 covalent SING C8 H81 ? bmse010126 1 86 covalent SING C8 H82 ? bmse010126 1 87 covalent SING C9 H83 ? bmse010126 1 88 covalent SING C9 H84 ? bmse010126 1 89 covalent SING C9 H85 ? bmse010126 1 90 covalent SING C10 H86 ? bmse010126 1 91 covalent SING C10 H87 ? bmse010126 1 92 covalent SING C10 H88 ? bmse010126 1 93 covalent SING C11 H89 ? bmse010126 1 94 covalent SING C12 H90 ? bmse010126 1 95 covalent SING C13 H91 ? bmse010126 1 96 covalent SING C14 H92 ? bmse010126 1 97 covalent SING C15 H93 ? bmse010126 1 98 covalent SING C16 H94 ? bmse010126 1 99 covalent SING C17 H95 ? bmse010126 1 100 covalent SING C17 H96 ? bmse010126 1 101 covalent SING C18 H97 ? bmse010126 1 102 covalent SING C18 H98 ? bmse010126 1 103 covalent SING C19 H99 ? bmse010126 1 104 covalent SING C19 H100 ? bmse010126 1 105 covalent SING C27 H101 ? bmse010126 1 106 covalent SING C28 H102 ? bmse010126 1 107 covalent SING C35 H103 ? bmse010126 1 108 covalent SING C36 H104 ? bmse010126 1 109 covalent SING C37 H105 ? bmse010126 1 110 covalent SING C38 H106 ? bmse010126 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID no PubChem 111678003 sid ? "S-b-S-r-S (acetate)" ? "matching entry" ? bmse010126 1 yes USDA_NMR_database 199 "Compound Number" ? "S-b-S-r-S (acetate)" ? "matching entry" ? bmse010126 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010126 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010126 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "S-b-S-r-S (acetate)" "natural abundance" 1 $S-b-S-r-S-(acetate) ? Solute 30 ? ? mg/ml ? "Susana Luque" "S-b-S-r-S (acetate)" n/a bmse010126 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010126 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010126 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "S-b-S-r-S (acetate)" "natural abundance" 1 $S-b-S-r-S-(acetate) ? Solute 30 ? ? mg/ml ? "Susana Luque" "S-b-S-r-S (acetate)" n/a bmse010126 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010126 2 stop_ save_ save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010126 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "S-b-S-r-S (acetate)" "natural abundance" 1 $S-b-S-r-S-(acetate) ? Solute 30 ? ? mg/ml ? "Susana Luque" "S-b-S-r-S (acetate)" n/a bmse010126 3 2 DMSO "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010126 3 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010126 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010126 1 temperature 297 ? K bmse010126 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010126 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010126 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010126 1 stop_ save_ save_Bruker_250 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_250 _NMR_spectrometer.Entry_ID bmse010126 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model WM _NMR_spectrometer.Field_strength 250 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010126 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010126 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010126 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010126 1 4 "1D 13C" no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010126 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010126 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010126 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010126 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010126 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010126 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010126 2 stop_ save_ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010126 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 "residual solvent methyl proton" ppm 2.49 internal direct 1.000000000 ? ? ? bmse010126 3 C 13 DMSO-d6 "solvent methyl carbon" ppm 39.50 internal direct ? ? ? ? bmse010126 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010126 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010126 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010126 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C1 C 13 20.53 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 1 2 ? ? 1 1 ? 1 C2 C 13 20.53 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 1 3 ? ? 1 1 ? 1 C3 C 13 20.86 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 1 4 ? ? 1 1 ? 1 C4 C 13 21.16 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 1 5 ? ? 1 1 ? 1 C28 C 13 54.39 ? ? 1 ? ? ? ? ? BB ? bmse010126 1 6 ? ? 1 1 ? 1 C27 C 13 54.52 ? ? 1 ? ? ? ? ? CB ? bmse010126 1 7 ? ? 1 1 ? 1 C5 C 13 56.17 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 8 ? ? 1 1 ? 1 C6 C 13 56.17 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 9 ? ? 1 1 ? 1 C7 C 13 56.23 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 10 ? ? 1 1 ? 1 C8 C 13 56.23 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 11 ? ? 1 1 ? 1 C9 C 13 56.29 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 12 ? ? 1 1 ? 1 C10 C 13 56.29 ? ? 4 ? ? ? ? ? OMe ? bmse010126 1 13 ? ? 1 1 ? 1 C19 C 13 62.81 ? ? 1 ? ? ? ? ? G ? bmse010126 1 14 ? ? 1 1 ? 1 C17 C 13 72.07 ? ? 1 ? ? ? ? ? CG ? bmse010126 1 15 ? ? 1 1 ? 1 C18 C 13 72.19 ? ? 1 ? ? ? ? ? BG ? bmse010126 1 16 ? ? 1 1 ? 1 C38 C 13 74.25 ? ? 1 ? ? ? ? ? A ? bmse010126 1 17 ? ? 1 1 ? 1 C35 C 13 80.78 ? ? 1 ? ? ? ? ? B ? bmse010126 1 18 ? ? 1 1 ? 1 C37 C 13 85.82 ? ? 1 ? ? ? ? ? BA ? bmse010126 1 19 ? ? 1 1 ? 1 C36 C 13 85.98 ? ? 1 ? ? ? ? ? CA ? bmse010126 1 20 ? ? 1 1 ? 1 C11 C 13 102.30 ? ? 1 ? ? ? ? ? C2 ? bmse010126 1 21 ? ? 1 1 ? 1 C12 C 13 102.30 ? ? 1 ? ? ? ? ? C6 ? bmse010126 1 22 ? ? 1 1 ? 1 C13 C 13 102.84 ? ? 1 ? ? ? ? ? B2 ? bmse010126 1 23 ? ? 1 1 ? 1 C14 C 13 102.84 ? ? 1 ? ? ? ? ? B6 ? bmse010126 1 24 ? ? 1 1 ? 1 C15 C 13 104.07 ? ? 1 ? ? ? ? ? A2 ? bmse010126 1 25 ? ? 1 1 ? 1 C16 C 13 104.07 ? ? 1 ? ? ? ? ? A6 ? bmse010126 1 26 ? ? 1 1 ? 1 C24 C 13 128.05 ? ? 1 ? ? ? ? ? C1 ? bmse010126 1 27 ? ? 1 1 ? 1 C40 C 13 128.51 ? ? 1 ? ? ? ? ? A4 ? bmse010126 1 28 ? ? 1 1 ? 1 C41 C 13 134.67 ? ? 1 ? ? ? ? ? B4 ? bmse010126 1 29 ? ? 1 1 ? 1 C26 C 13 135.66 ? ? 1 ? ? ? ? ? A1 ? bmse010126 1 30 ? ? 1 1 ? 1 C25 C 13 137.27 ? ? 1 ? ? ? ? ? B1 ? bmse010126 1 31 ? ? 1 1 ? 1 C39 C 13 139.74 ? ? 1 ? ? ? ? ? C4 ? bmse010126 1 32 ? ? 1 1 ? 1 C31 C 13 151.92 ? ? 1 ? ? ? ? ? A3 ? bmse010126 1 33 ? ? 1 1 ? 1 C32 C 13 151.92 ? ? 1 ? ? ? ? ? A5 ? bmse010126 1 34 ? ? 1 1 ? 1 C29 C 13 152.34 ? ? 1 ? ? ? ? ? C3 ? bmse010126 1 35 ? ? 1 1 ? 1 C30 C 13 152.34 ? ? 1 ? ? ? ? ? C5 ? bmse010126 1 36 ? ? 1 1 ? 1 C33 C 13 153.35 ? ? 1 ? ? ? ? ? B3 ? bmse010126 1 37 ? ? 1 1 ? 1 C34 C 13 153.35 ? ? 1 ? ? ? ? ? B5 ? bmse010126 1 38 ? ? 1 1 ? 1 C20 C 13 168.63 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 1 39 ? ? 1 1 ? 1 C21 C 13 168.85 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 1 40 ? ? 1 1 ? 1 C22 C 13 169.53 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 1 41 ? ? 1 1 ? 1 C23 C 13 170.94 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010126 1 1 2 bmse010126 1 1 3 bmse010126 1 1 4 bmse010126 1 2 7 bmse010126 1 2 8 bmse010126 1 2 9 bmse010126 1 2 10 bmse010126 1 2 11 bmse010126 1 2 12 bmse010126 1 3 38 bmse010126 1 3 39 bmse010126 1 3 40 bmse010126 1 3 41 bmse010126 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010126 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010126 2 3 "1D 13C" 2 $sample_2 bmse010126 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010126 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C1 C 13 20.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 2 2 ? ? 1 1 ? 1 C2 C 13 20.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 2 3 ? ? 1 1 ? 1 C3 C 13 20.63 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 2 4 ? ? 1 1 ? 1 C4 C 13 20.94 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 2 5 ? ? 1 1 ? 1 C28 C 13 55.33 ? ? 1 ? ? ? ? ? BB ? bmse010126 2 6 ? ? 1 1 ? 1 C27 C 13 55.44 ? ? 1 ? ? ? ? ? CB ? bmse010126 2 7 ? ? 1 1 ? 1 C5 C 13 56.38 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 8 ? ? 1 1 ? 1 C6 C 13 56.38 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 9 ? ? 1 1 ? 1 C7 C 13 56.46 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 10 ? ? 1 1 ? 1 C8 C 13 56.46 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 11 ? ? 1 1 ? 1 C9 C 13 56.46 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 12 ? ? 1 1 ? 1 C10 C 13 56.46 ? ? 4 ? ? ? ? ? OMe ? bmse010126 2 13 ? ? 1 1 ? 1 C19 C 13 63.41 ? ? 1 ? ? ? ? ? G ? bmse010126 2 14 ? ? 1 1 ? 1 C17 C 13 72.66 ? ? 1 ? ? ? ? ? CG ? bmse010126 2 15 ? ? 1 1 ? 1 C18 C 13 72.66 ? ? 1 ? ? ? ? ? BG ? bmse010126 2 16 ? ? 1 1 ? 1 C38 C 13 75.33 ? ? 1 ? ? ? ? ? A ? bmse010126 2 17 ? ? 1 1 ? 1 C35 C 13 81.29 ? ? 1 ? ? ? ? ? B ? bmse010126 2 18 ? ? 1 1 ? 1 C37 C 13 86.45 ? ? 1 ? ? ? ? ? BA ? bmse010126 2 19 ? ? 1 1 ? 1 C36 C 13 86.56 ? ? 1 ? ? ? ? ? CA ? bmse010126 2 20 ? ? 1 1 ? 1 C11 C 13 103.23 ? ? 1 ? ? ? ? ? C2 ? bmse010126 2 21 ? ? 1 1 ? 1 C12 C 13 103.23 ? ? 1 ? ? ? ? ? C6 ? bmse010126 2 22 ? ? 1 1 ? 1 C13 C 13 103.71 ? ? 1 ? ? ? ? ? B2 ? bmse010126 2 23 ? ? 1 1 ? 1 C14 C 13 103.71 ? ? 1 ? ? ? ? ? B6 ? bmse010126 2 24 ? ? 1 1 ? 1 C15 C 13 104.68 ? ? 1 ? ? ? ? ? A2 ? bmse010126 2 25 ? ? 1 1 ? 1 C16 C 13 104.68 ? ? 1 ? ? ? ? ? A6 ? bmse010126 2 26 ? ? 1 1 ? 1 C24 C 13 128.85 ? ? 1 ? ? ? ? ? C1 ? bmse010126 2 27 ? ? 1 1 ? 1 C40 C 13 129.34 ? ? 1 ? ? ? ? ? A4 ? bmse010126 2 28 ? ? 1 1 ? 1 C41 C 13 135.61 ? ? 1 ? ? ? ? ? B4 ? bmse010126 2 29 ? ? 1 1 ? 1 C26 C 13 136.65 ? ? 1 ? ? ? ? ? A1 ? bmse010126 2 30 ? ? 1 1 ? 1 C25 C 13 138.83 ? ? 1 ? ? ? ? ? B1 ? bmse010126 2 31 ? ? 1 1 ? 1 C39 C 13 141.45 ? ? 1 ? ? ? ? ? C4 ? bmse010126 2 32 ? ? 1 1 ? 1 C31 C 13 152.95 ? ? 1 ? ? ? ? ? A3 ? bmse010126 2 33 ? ? 1 1 ? 1 C32 C 13 152.95 ? ? 1 ? ? ? ? ? A5 ? bmse010126 2 34 ? ? 1 1 ? 1 C29 C 13 153.22 ? ? 1 ? ? ? ? ? C3 ? bmse010126 2 35 ? ? 1 1 ? 1 C30 C 13 153.22 ? ? 1 ? ? ? ? ? C5 ? bmse010126 2 36 ? ? 1 1 ? 1 C33 C 13 153.98 ? ? 1 ? ? ? ? ? B3 ? bmse010126 2 37 ? ? 1 1 ? 1 C34 C 13 153.98 ? ? 1 ? ? ? ? ? B5 ? bmse010126 2 38 ? ? 1 1 ? 1 C20 C 13 168.48 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 2 39 ? ? 1 1 ? 1 C21 C 13 168.58 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 2 40 ? ? 1 1 ? 1 C22 C 13 169.91 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 2 41 ? ? 1 1 ? 1 C23 C 13 170.76 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 2 42 ? ? 1 1 ? 1 H102 H 1 3.11 ? ? 1 ? ? ? ? ? BB ? bmse010126 2 43 ? ? 1 1 ? 1 H101 H 1 3.11 ? ? 1 ? ? ? ? ? CB ? bmse010126 2 44 ? ? 1 1 ? 1 H105 H 1 4.73 ? ? 1 ? ? ? ? ? BA ? bmse010126 2 45 ? ? 1 1 ? 1 H104 H 1 4.76 ? ? 1 ? ? ? ? ? CA ? bmse010126 2 46 ? ? 1 1 ? 1 H106 H 1 6.05 ? ? 1 ? ? ? ? ? A ? bmse010126 2 47 ? ? 1 1 ? 1 H89 H 1 6.70 ? ? 4 ? ? ? ? ? 2 ? bmse010126 2 48 ? ? 1 1 ? 1 H90 H 1 6.70 ? ? 4 ? ? ? ? ? 6 ? bmse010126 2 49 ? ? 1 1 ? 1 H91 H 1 6.76 ? ? 4 ? ? ? ? ? 2 ? bmse010126 2 50 ? ? 1 1 ? 1 H92 H 1 6.76 ? ? 4 ? ? ? ? ? 6 ? bmse010126 2 51 ? ? 1 1 ? 1 H94 H 1 6.76 ? ? 4 ? ? ? ? ? 2 ? bmse010126 2 52 ? ? 1 1 ? 1 H95 H 1 6.76 ? ? 4 ? ? ? ? ? 6 ? bmse010126 2 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010126 2 1 2 bmse010126 2 1 3 bmse010126 2 1 4 bmse010126 2 2 7 bmse010126 2 2 8 bmse010126 2 2 9 bmse010126 2 2 10 bmse010126 2 2 11 bmse010126 2 2 12 bmse010126 2 3 38 bmse010126 2 3 39 bmse010126 2 3 40 bmse010126 2 3 41 bmse010126 2 4 47 bmse010126 2 4 48 bmse010126 2 4 49 bmse010126 2 4 50 bmse010126 2 4 51 bmse010126 2 4 52 bmse010126 2 stop_ save_ save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010126 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 4 "1D 13C" 3 $sample_3 bmse010126 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010126 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C1 C 13 20.06 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 3 2 ? ? 1 1 ? 1 C2 C 13 20.06 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 3 3 ? ? 1 1 ? 1 C3 C 13 20.29 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 3 4 ? ? 1 1 ? 1 C4 C 13 20.63 ? ? 4 ? ? ? ? ? AcMe ? bmse010126 3 5 ? ? 1 1 ? 1 C28 C 13 53.61 ? ? 1 ? ? ? ? ? BB ? bmse010126 3 6 ? ? 1 1 ? 1 C27 C 13 53.85 ? ? 1 ? ? ? ? ? CB ? bmse010126 3 7 ? ? 1 1 ? 1 C5 C 13 55.72 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 8 ? ? 1 1 ? 1 C6 C 13 55.72 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 9 ? ? 1 1 ? 1 C7 C 13 55.87 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 10 ? ? 1 1 ? 1 C8 C 13 55.87 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 11 ? ? 1 1 ? 1 C9 C 13 55.87 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 12 ? ? 1 1 ? 1 C10 C 13 55.87 ? ? 4 ? ? ? ? ? OMe ? bmse010126 3 13 ? ? 1 1 ? 1 C19 C 13 62.16 ? ? 1 ? ? ? ? ? G ? bmse010126 3 14 ? ? 1 1 ? 1 C17 C 13 71.31 ? ? 1 ? ? ? ? ? CG ? bmse010126 3 15 ? ? 1 1 ? 1 C18 C 13 71.31 ? ? 1 ? ? ? ? ? BG ? bmse010126 3 16 ? ? 1 1 ? 1 C38 C 13 73.92 ? ? 1 ? ? ? ? ? A ? bmse010126 3 17 ? ? 1 1 ? 1 C35 C 13 79.76 ? ? 1 ? ? ? ? ? B ? bmse010126 3 18 ? ? 1 1 ? 1 C37 C 13 84.85 ? ? 1 ? ? ? ? ? BA ? bmse010126 3 19 ? ? 1 1 ? 1 C36 C 13 85.00 ? ? 1 ? ? ? ? ? CA ? bmse010126 3 20 ? ? 1 1 ? 1 C11 C 13 102.36 ? ? 1 ? ? ? ? ? C2 ? bmse010126 3 21 ? ? 1 1 ? 1 C12 C 13 102.36 ? ? 1 ? ? ? ? ? C6 ? bmse010126 3 22 ? ? 1 1 ? 1 C13 C 13 102.70 ? ? 1 ? ? ? ? ? B2 ? bmse010126 3 23 ? ? 1 1 ? 1 C14 C 13 102.70 ? ? 1 ? ? ? ? ? B6 ? bmse010126 3 24 ? ? 1 1 ? 1 C15 C 13 103.30 ? ? 1 ? ? ? ? ? A2 ? bmse010126 3 25 ? ? 1 1 ? 1 C16 C 13 103.30 ? ? 1 ? ? ? ? ? A6 ? bmse010126 3 26 ? ? 1 1 ? 1 C24 C 13 126.98 ? ? 1 ? ? ? ? ? C1 ? bmse010126 3 27 ? ? 1 1 ? 1 C40 C 13 127.45 ? ? 1 ? ? ? ? ? A4 ? bmse010126 3 28 ? ? 1 1 ? 1 C41 C 13 133.69 ? ? 1 ? ? ? ? ? B4 ? bmse010126 3 29 ? ? 1 1 ? 1 C26 C 13 135.21 ? ? 1 ? ? ? ? ? A1 ? bmse010126 3 30 ? ? 1 1 ? 1 C25 C 13 137.38 ? ? 1 ? ? ? ? ? B1 ? bmse010126 3 31 ? ? 1 1 ? 1 C39 C 13 140.08 ? ? 1 ? ? ? ? ? C4 ? bmse010126 3 32 ? ? 1 1 ? 1 C31 C 13 151.38 ? ? 1 ? ? ? ? ? A3 ? bmse010126 3 33 ? ? 1 1 ? 1 C32 C 13 151.38 ? ? 1 ? ? ? ? ? A5 ? bmse010126 3 34 ? ? 1 1 ? 1 C29 C 13 151.58 ? ? 1 ? ? ? ? ? C3 ? bmse010126 3 35 ? ? 1 1 ? 1 C30 C 13 151.58 ? ? 1 ? ? ? ? ? C5 ? bmse010126 3 36 ? ? 1 1 ? 1 C33 C 13 152.41 ? ? 1 ? ? ? ? ? B3 ? bmse010126 3 37 ? ? 1 1 ? 1 C34 C 13 152.41 ? ? 1 ? ? ? ? ? B5 ? bmse010126 3 38 ? ? 1 1 ? 1 C20 C 13 167.91 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 3 39 ? ? 1 1 ? 1 C21 C 13 168.02 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 3 40 ? ? 1 1 ? 1 C22 C 13 169.26 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 3 41 ? ? 1 1 ? 1 C23 C 13 169.89 ? ? 4 ? ? ? ? ? AcC=O ? bmse010126 3 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010126 3 1 2 bmse010126 3 1 3 bmse010126 3 1 4 bmse010126 3 2 7 bmse010126 3 2 8 bmse010126 3 2 9 bmse010126 3 2 10 bmse010126 3 2 11 bmse010126 3 2 12 bmse010126 3 3 38 bmse010126 3 3 39 bmse010126 3 3 40 bmse010126 3 3 41 bmse010126 3 stop_ save_